kopano-monitor-10.0.5-bp153.1.25 >  A `L3!M@eee V \4E@ΰ3+!>B)jӣo5.d]XJe4Jו{jGok-2eR""t`2Ç=EfݾV3ȐYx)bDQRp>pLD?4d # A "H[ah  < t       2 @x,d!(!v!()*%+4,8-<8@*9*:z*=}w>}?}@}D}F}G}H}I~$X~4Y~@\~x]~^} bgc duezf}luvw xDy|z0Ckopano-monitor10.0.5bp153.1.25Quota monitor for Kopano CoreRegularly checks stores for total usage. If a quota limit has been exceeded, an e-mail will be internally sent to this account.`L3Ylamb56SUSE Linux Enterprise 15 SP3openSUSEAGPL-3.0-onlyhttps://bugs.opensuse.orgProductivity/Networking/Email/Servershttps://kopano.io/linuxx86_64 if [ -x /usr/bin/systemctl ]; then test -n "$FIRST_ARG" || FIRST_ARG="$1" [ -d /var/lib/systemd/migrated ] || mkdir -p /var/lib/systemd/migrated || : for service in kopano-monitor.service ; do sysv_service=${service%.*} if [ ! -e /usr/lib/systemd/system/$service ] && [ ! -e /etc/init.d/$sysv_service ]; then mkdir -p /run/systemd/rpm/needs-preset touch /run/systemd/rpm/needs-preset/$service elif [ -e /etc/init.d/$sysv_service ] && [ ! -e /var/lib/systemd/migrated/$sysv_service ]; then /usr/sbin/systemd-sysv-convert --save $sysv_service || : mkdir -p /run/systemd/rpm/needs-sysv-convert touch /run/systemd/rpm/needs-sysv-convert/$service fi done fi if [ -x /usr/bin/systemctl ]; then test -n "$FIRST_ARG" || FIRST_ARG="$1" [ -d /var/lib/systemd/migrated ] || mkdir -p /var/lib/systemd/migrated || : if [ "$YAST_IS_RUNNING" != "instsys" ]; then /usr/bin/systemctl daemon-reload || : fi for service in kopano-monitor.service ; do sysv_service=${service%.*} if [ -e /run/systemd/rpm/needs-preset/$service ]; then /usr/bin/systemctl preset $service || : rm "/run/systemd/rpm/needs-preset/$service" || : elif [ -e /run/systemd/rpm/needs-sysv-convert/$service ]; then /usr/sbin/systemd-sysv-convert --apply $sysv_service || : rm "/run/systemd/rpm/needs-sysv-convert/$service" || : touch /var/lib/systemd/migrated/$sysv_service || : fi done fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ "$FIRST_ARG" -eq 0 -a -x /usr/bin/systemctl ]; then # Package removal, not upgrade /usr/bin/systemctl --no-reload disable kopano-monitor.service || : ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_STOP_ON_REMOVAL" && . /etc/sysconfig/services test "$DISABLE_STOP_ON_REMOVAL" = yes -o \ "$DISABLE_STOP_ON_REMOVAL" = 1 && exit 0 /usr/bin/systemctl stop kopano-monitor.service ) || : fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ $1 -eq 0 ]; then # Package removal for service in kopano-monitor.service ; do sysv_service="${service%.*}" rm "/var/lib/systemd/migrated/$sysv_service" || : done fi if [ -x /usr/bin/systemctl ]; then /usr/bin/systemctl daemon-reload || : fi if [ "$FIRST_ARG" -ge 1 ]; then # Package upgrade, not uninstall if [ -x /usr/bin/systemctl ]; then ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_RESTART_ON_UPDATE" && . /etc/sysconfig/services test "$DISABLE_RESTART_ON_UPDATE" = yes -o \ "$DISABLE_RESTART_ON_UPDATE" = 1 && exit 0 /usr/bin/systemctl try-restart kopano-monitor.service ) || : fi fij@! AA큤AA큤A`L3T`L3P`L3P`L3P`L3P`L3P`L3T`L3N`L3T`L3T`L3T`L3O`L3O`L3T61099c6cc18d55f48dce1bb497300e4e4a93142fb789d5688a64bf231b971a52420ddd89bfe2b4fdf63c15e1e28c97bd9c5910bae4a6d7d2ea86b57a1e200f82420ddd89bfe2b4fdf63c15e1e28c97bd9c5910bae4a6d7d2ea86b57a1e200f82420ddd89bfe2b4fdf63c15e1e28c97bd9c5910bae4a6d7d2ea86b57a1e200f82289792887c91bf24d50bf015f1d453dc3c71bb8516ca2e79b44333a32027c2e97aba117dd0994a88f3f245511722d1131d354929e203a7998c94f88c80ff27397d4c91dbea2a74ea6112ef4b404284f71356165db794608ac050b4699d17475a35fee4cbccfa3aa8b3bec58cd467b22a8a50dffb2fa0347e2bc951508ebd60dda39d3a011379bdc525ac52bd572cc561cfd3d71e9860303525bee491e34bbec1rootrootrootrootrootrootrootrootrootrootrootrootrootkopanorootrootrootrootrootrootrootrootrootrootrootrootrootkopanokopano-10.0.5-bp153.1.25.src.rpmconfig(kopano-monitor)kopano-monitorkopano-monitor(x86-64) @@@@@@@@@@@@@@@@@@@@@@    /bin/sh/bin/sh/bin/sh/bin/sh/bin/shconfig(kopano-monitor)kopano-commonlibc.so.6()(64bit)libc.so.6(GLIBC_2.14)(64bit)libc.so.6(GLIBC_2.2.5)(64bit)libc.so.6(GLIBC_2.4)(64bit)libgcc_s.so.1()(64bit)libgcc_s.so.1(GCC_3.0)(64bit)libkcutil.so.0()(64bit)libkcutil.so.0(KC_10.0)(64bit)libkcutil.so.0(KERNEL32_1)(64bit)libmapi.so.1()(64bit)libmapi.so.1(KC_10.0)(64bit)libmapi.so.1(MAPI32_1)(64bit)libpthread.so.0()(64bit)libpthread.so.0(GLIBC_2.2.5)(64bit)libstdc++.so.6()(64bit)libstdc++.so.6(CXXABI_1.3)(64bit)libstdc++.so.6(CXXABI_1.3.9)(64bit)libstdc++.so.6(GLIBCXX_3.4)(64bit)libstdc++.so.6(GLIBCXX_3.4.11)(64bit)libstdc++.so.6(GLIBCXX_3.4.15)(64bit)libstdc++.so.6(GLIBCXX_3.4.20)(64bit)libstdc++.so.6(GLIBCXX_3.4.9)(64bit)rpmlib(CompressedFileNames)rpmlib(FileDigests)rpmlib(PayloadFilesHavePrefix)rpmlib(PayloadIsXz)10.0.5-bp153.1.2510.0.53.0.4-14.6.0-14.0-15.2-14.14.1if [ "$1" -ne 2 ]; then exit 0; fi # putback previously existing cfgs after they get untracked once if [ ! -e "/etc/kopano/monitor.cfg" -a \ -e "/etc/kopano/monitor.cfg.rpmsave" ]; then mv -v "/etc/kopano/monitor.cfg.rpmsave" \ "/etc/kopano/monitor.cfg" fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ $1 -eq 0 ]; then # Package removal for service in kopano-monitor.service ; do sysv_service="${service%.*}" rm "/var/lib/systemd/migrated/$sysv_service" || : done fi if [ -x /usr/bin/systemctl ]; then /usr/bin/systemctl daemon-reload || : fi if [ "$FIRST_ARG" -ge 1 ]; then # Package upgrade, not uninstall if [ -x /usr/bin/systemctl ]; then ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_RESTART_ON_UPDATE" && . /etc/sysconfig/services test "$DISABLE_RESTART_ON_UPDATE" = yes -o \ "$DISABLE_RESTART_ON_UPDATE" = 1 && exit 0 /usr/bin/systemctl try-restart kopano-monitor.service ) || : fi fikopano-monitor^^T@^r @^h^(9@]q]X]µ]@]z3@\"\@\X)@[j@[@[h8@[;e@[ @Za@Zw@Z@ZxG@ZP@Z#@Z@Z ,@YY@YeYW@Y@YY^&@Y@X@X @XX@XY@XGX5X#Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt jengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.derbrown@suse.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dem.kromer@kopano.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.de- Update to release 10.0.5 * Enhancements: * gateway: support loading MAPI folders with slash in their name. * Fixes: * admin: fix stack exhaustion calling AclRightsToString. * admin: fix out-of-bounds access in ConsoleTable. * dagent: change SMTP error code for plugin failure from permanent to transient category. * server: recognize more MariaDB-specific status codes and initiate reconnect if needed. * server: fix a cache pollution with PR_HTML and PR_RTF_COMPRESSED. * dagent: failure to run actions will no longer stop rule processing. * mapi4linux: avoid M4LMAPISession going away while ECMsgStore object(s) still alive.- Update to release 10.0.4 * Enhancements: * daemons: service units now run with systemd protections on. * icalmapi: support reading multi-iCal and multi-vCard files. * Fixes: * dagent, spooler: workaround crash during Python GC. * dagent, gateway: avoid stack exhaustion in HTML filter. * gateway: avoid non-atomic replacement of SSL context. * gateway: avoid one crash case for deeply-nested HTML mail. * server: cure a mysql wait phase during shutdown. * server: cure a crash when the SQL server has shut down. * daemons: avoid deadlock during signal handling. * libserver: fix use-after-free and crash on shutdown. * Various null deref warnings from clang --analyze were fixed. * libserver: resolve memory leak of MYSQL objects.- Update to release 10.0.3 * Enhancements: * server: new config directive request_log_method and request_log_file. * server: The log_level=0x100000 bit (SOAP) no longer has a meaning; use the request_log_file mechanism instead.- Update to release 10.0.2 * dagent: add processing time stats and publish via surveyclient * common: fix a malloc/delete[] mismatch in kc_utf8_to_punyaddr * Respect KOPANO_SOCKET environment variable in all programs * server: support numeric UID/GID for local_admin_users directive * daemons: support numeric UID/GID for run_as_* directives- Update to release 10.0.1 * common: avoid computing log messages that will not get shown [KC-1674] * freebusy: fix crash in RecurrenceState::Exception instantiation * client: IDN support [KC-1659] * In config files, fractional values can now be used for sizes ("0.5G").- Update to release 9.0.2 * Enhancements: * storeadm: print entity types in orphan list [KC-718] * client: improve dreaded "gsoap connect: ()" reporting * server: fix dreaded "SSL_accept: (null)" reporting * ECtools: add kopano-vcfimport * Fixes: * client: resolve rogue file descriptor closing [KC-1397, KC-1462, KC-1518, KC-1584, KS-42330, KS-43193, KS-43409, KS-43618, KS-43677, KS-43693, KS-43907, KS-43925, KS-43936] * dagent: resolve crash when appointment has empty organizer [KC-1637] * spooler: regard redirected messages as having recipients [KC-1638]- Drop chown calls from scriptlets [boo#1154309]- Update to release 8.7.85 * daemons: support "%xxx"-style interface identifiers in bindspecs (the "server_listen" or similarly-named directives in .cfg files) * client: send fewer logoff calls [KC-1590] * daemons: AF_LOCAL sockets were erroneously owned by root rather than run_as_user [KC-1616] * pyko: avoid circular strong reference from notification to store [KC-1572] * php: add missing successful return value for zif_mapi_vcfstomapi [KC-1487] * client: unbreak translation of newly created store folder names [KC-1607] * dagent: the server_bind_intf option is removed in favor of %xxx * search: put back the old value for limit_results=1000- Update to release 8.7.84 * server: new installations will use files_v2 by default [KC-567] * icalmapi: vCard 4.0 (RFC 6350) is now emitted * kopano-set-oof has been removed; use `kopano-oof` instead [KC-981] * kopano-localize-folders has been removed; use `kopano-storeadm -Y` instead * admin: the --mr-process option has been added * dbadm: the "populate" action has been added * daemons: the {pop3,imap,etc.}_listen directives can now take an interface specifier similar to ping(8), e.g. "%eth0" * server/ldapplugin: LDAP group membership cache [KC-1588]- Update to release 8.7.83 * libserver: fix "withholding" of properties from clients [KC-1547] * dagent, spooler: threaded more is enabled by default now [KC-1475] * ldapplugin: 22% speedup in retriving the entire user list [KC-1399] * client: enable write-caching for properties on stores and folders; improves e.g. store creation time by 17% [KC-1585] * Dropped Python2 and PHP5 support- Update to new upstream release 8.7.3 * Fixes: * dagent: standard casing for RFC 5322 headers [KF-2100] * daemons: do not fail startup on IPv4-only systems [KC-1400] * Feed HTML through libtidy before using it for the to-plaintext conversion stage [KS-40722] * server: fix crash on shutdown [KF-2179] * server: address a potential crash due to type mismatch [KF-2151] * server: use utf8mb3 with mysql 5.1 [KC-1423] * server: avoid entering truncated tproperties data into the cache [KC-1417] * server: avoid using OpenLDAP-specific filters that 389-ds does not know about [KC-1402] * server: fixed TLS negotiation errors with openSSL 1.1.1 [KC-1439] * spooler: avoid unnecessary QP encoding in header fields [KC-1430] * spooler: fix hang on process termination [KC-1449] * srvadm: do not complain about default_store_locale [KC-1416] * dbadm: some long-running statements can now be run in parallel with the new -j option [KS-42617] * pyko: expand stubbed messages when dumping [KC-1159,KC-1168] * pyko: don't mix str/int busy statuses [KC-1433] * oof: fix erroneous -u parsing [KC-1425] * oof: make --message option set the right property [KC-1435] * server: complete utf8mb4->utf8 fallback for RHEL6 [KC-1423] * inetmapi: modified appointments need to produce a new Message-ID [KC-1458] * dagent: set Bcc/RecipMe flags appropriately [KC-319] * inetmapi: restore FQDN in Message-IDs [KC-1393] * inetmapi: parse fake "From:" header better to hinder proliferation of impersonations [KC-1350] * stats: print "PR_..." instead of proptag numbers [KC-1495] * server: no more unbounded thread number increase [KC-1446] * php: fix crash in zif_mapi_getprops [KC-1507] * Enhancements: * backup: do record outofoffice settings * php-ext: performance measurement log now contains a timestamp, thread identifier, and global monotonic counter. This can be used for estimating the achieved command rate.- Update to 8.7.0 stable git HEAD * dagent: standard casing for RFC 5322 headers [KF-2100] * daemons: do not fail startup on IPv4-only systems [KC-1400] * Feed HTML through libtidy before using it for the to-plaintext conversion stage [KS-40722] * server: fix crash on shutdown [KF-2179] * server: address a potential crash due to type mismatch [KF-2151] * server: use utf8mb3 with mysql 5.1 [KC-1423] * srvadm: do not complain about default_store_locale [KC-1416] * dbadm: some long-running statements can now be run in parallel with the new -j option [KS-42617] * pyko: expand stubbed messages when dumping [KC-1159,KC-1168]- Update to 8.7.0 stable * server: fix disappearing inbox rules [KC-1359] * kopano-dbadm: new action "usmp" and "usmp-charset" * server: no more automatic upgrade to utf8mb4, use `kopano-dbadm usmp` instead [KF-1394] * dagent: the spam_header_name was not matched correctly [KF-1961] * dagent/client/libserver: fix inadvertent AF_LOCAL->SSL redirect [KC-1368] * client: ABEIDs were parsed wrong (and it broke with gcc8) [KC-1386] * php7-ext: cease modifying potentially-immutable PHP variables [KC-1355]- Update to 8.7~beta release (8.6.90) * dagent, gateway, ical: modern socket specification in .cfg with lmtp_listen=, pop3_listen=, imap_listen=, ical_listen=, etc. * dagent: PF_LOCAL socket support for communicating with postfix * dagent: limited support for RFC 6531 (SMTPUTF8) * server: LDAP STARTTLS support for user backend * spooler: new config value log_raw_message=error * daemons: coredumps no longer rely on fs.suid_dumpable * server: support for Unicode supplemental plane (Emojis) * spooler: add copy_delegate_mails=move-to-rep config directive * kopano-ibrule: new utility for MAPI rules * server: experimental "files_v2" attachment storage * kopano-statsd: new daemon that records dagent/server/spooler statistics * This is an abridged list; there are more changes to configuration and behavior; see RELNOTES.txt in the "kopano-common" package for more details.- Update to new snapshot 8.6.7.2 * Fixes: * gateway, spooler: (re-)activate RFC 2047 header generation (Outlook is still unable to read the RFC 2231 headers that are generated normally) [KC-1226] * srvadm: make --purge-softdelete=0 work * Enhancements: * dagent: advertise 8BITMIME/RFC6152 support [KS-41452] * dagent/client: fixed broken umlauts in PR_EC_BODY_FILTERED when input was not UTF-8 [KC-1225]- Update to new upstream release 8.6.6 * ical: handle double quotes in Content-Type header * server: repair broken timing log messages for ldapplugin * php7-ext: cure stack corruption in mapi_vcftomapi * gateway: avoid uncaught exception when client disconnects midway * dagent: avoid always running into K-2383 * server: avoid SSL crash near ERR_clear_error on shutdown- Update to new upstream snapshot 8.6.2.25 * Fixes: * ical: handle double quotes in Content-Type header * Enhancements: * client: now emits warnings about own incomplete PR_RULES_DATA processing * inetmapi: now emits a warning when runtime vmime is too old * server: fewer stat calls to the attachment backend * Changes: * dagent: default for log_timestamp changed to "yes"- Update to new upstream snapshot 8.6.1.99 * Fixes: * Fix crash due to ODR violation * libserver: drop all remains of clientupdatestatus table * gateway: fix crash when new client immediately disconnects * mapi: avoid garbage at end of malformed RTF * Enhancements: * kopano-dbadm: new diagnostics program for offline database modification * kopano-server: allow use of --ignore-da to skip schema update that won't complete * build: support ICU 61 * propmap: expose kopanoHidden LDAP attribute as PR_EC_AB_HIDDEN * Changes: * daemons: disable SSL renegotiation for OpenSSL 1.1+ * server: invalid port strings are now rejected * client: quiesce verbose logon failure messages * boot: set default and UTF-8 locale for services- Update to new upstream release 8.6.1 * Fixes: * backup: ignore error when server cannot find attachments * server: search folders were not loaded on startup * monitor: handle absence of config file * dagent: do not treat -d option like -c was given * server: fix a case where an old kopano-server would refuse to start with a newer database even if --ignore-da was used * server: fix server/client getting slower when named properties are created multiple times [KC-1108] * client: fix data corruption when server returns high named property IDs [KC-1107] * Changes (generally requires admin action): * inetmapi: stop treating empty indexed_headers as "X-*" * dagent: cease indexing X-Headers by default * dagent: turn indexed_headers from a prefix list into an exact-match set * If you need certain e-mail headers copied into named properties, they MUST be explicitly listed _one by one_ in dagent.cfg:indexed_headers now. * Enhancements: * server: reorder SQL log messages so the error is shown first, and do say when the message was truncated- Update to new upstream release 8.6.0 * Enhancements: * spooler: rules support testing for out-of-office flag * kopano-spamd: new daemon for spam learning in Kopano/SpamAssasin * kopano-oof: new utility for Out Of Office * kopano-storeadm: new utility replacing the store functions of kopano-admin * daemons: added the --dump-config option * inetmapi: ensure all generated messages has a Message-ID * gateway: handle a zero-length PR_TRANSPORT_MESSAGE_HEADERS property as if it was absent * Changes: * gateway: generate Internet headers if missing * inetmapi: ensure all messages have a Message-Id- Update to new bugfix release 8.5.4 * server: emit log entry when LDAP is missing server info objects * spooler: avoid deadlock due to double mutex acquisition within one thread * php: mapi_icaltomapi did not copy the iCal recipients to the MAPI object * archiver had forgotten to create its SQL tables on first use * php: make ParseICal able to deduce organizer addresses * admin: --user-count failed to print user counts * server: fix broken cache handling for ICS bulk restriction matching * icalmapi: handle BDAY VCF and REV VCF property * libserver: restore PR_EMS_AB_HOME_MDB- Update to final tag 8.5.0 * libserver: store size for orphaned stores was reported incorrectly * client: have OpenEntry check for NULL entryids and entryids too short * dagent, client: fix nonfunctional HTML filter * common: switch logging to stderr when pipe dies * spooler: avoid printing garbage when non-worker child exits- Update to new upstream tag 8.4.91 (RC) * Enhancements: * server: new "server_listen" directive replacing "server_bind" * server: stronger keep-alive * server: further general performance improvements * server: update PR_LOCAL_COMMIT_MAX on hard-deletes * server: speed up contact and search folder querying * server: skip some unnecessary attachment accesses * spooler: introduce indexed_headers config directive * search: pass "limit_results" to xapian to improve performance * search: optionally index draft folders * unixplugin: support multiple non_login_shells * unixplugin: add /sbin/nologin as a non_login_shell (new installs only) * gateway: RFC 6154 support * kopano-spamd: new program * icalmapi: support URL, NICKNAME, PRODID in vcards * Fixes: * gateway: generate envelope using inetmapi if not present yet * spooler: only evaluate rules that are explicitly enabled using PR_RULE_STATE * Changes: * /etc/kopano is no longer prepopulated, create .cfg manually if you need to override anything * server: remove support for upgrading databases older than ZCP 7.2 * gateway: use threaded mode for reduced memory usage on many-user systems (new installs only) * gateway: the "imap_store_rfc822" config directive is removed * server: the "counter_reset" config directive is removed * spooler: the "always_send_utf8" config directive is removed- Add 0001-build-fix-build-error-w.r.t.-gettimeofday.patch- Replace references to /var/adm/fillup-templates with new %_fillupdir macro (boo#1069468)- Update to bugfix snapshot 8.4.4 * common: fix detection of local connections that need not use zlib compression * libserver: improve ECICS error reporting * dagent: reenable automated backtraces when invoked with -f * php5-ext: fix positive retval setting in error case * dagent: redirect rule led to crash * inetmapi: overwrite recipients instead of appending- Update to bugfix release 8.4.2 * server: revert NO_UNSIGNED_SUBTRACTIONS edit- Update to bugfix release 8.4.1 * inetmapi: handle empty/invalid Sender in RFC2822 mails * spooler: for send-later mails, check trash, not outbox- Update to new upstream release 8.4.0 * dagent, gateway: whitelist-based HTML filter * provider: speed up getIDsFromNames by reducing SQL queries * client: speedup from-scratch MAPI session creation by avoiding extraneous logon-logoff cycles during provider initialization * client: add API for dump+restore of MAPI session profile data so libmapi users can skip provider reinitialization at program startup * mapi: disable very slow RTF compression * server: add entry cache for S3 backend * icalmapi: handle up to three email addresses in a vcard * icalmapi: support ADR, ORG, TITLE tags in VCF files * backup: save and restore store-level ACLs * backup: merge store-level metadata- Add Requires for kopano-migration-imap [boo#1055939]- Update to new bugfix snapshot 8.3.3~24 * server: fix disabling of shared reminders [KC-728]- Update to new bugfix snapshot 8.3.3~22 * gateway: trim CRLF from PR_EC_IMAP_BODY{,STRUCTURE} and make Apple Mail client work again [KC-668, KC-720] * server: disallow empty value for embedded_attachment_limit and depth counting error [KC-745] * common: fix incorrect timeout check in scheduler which had disabled softdeletes [KC-638] * server: disable reminders from shared stores [KC-758] * catch pointer underflows / NULL pointers [KC-694, KC-60, KC-177, KC-355, KC-378, KC-379, KC-669, KC-754] * libserver: avoid creating multi-stream gzip files [KC-104, KC-304, KC-597]- Update to new bugfix release 8.3.1 * inetmapi: do not force HTML when use_tnef is set to minimal [KC-664] * spooler: avoid a use-after-free, and a deadlock after this failure [KC-588] * server: avoid unchecked return value and unsigned underflow [KC-656] * php: rework pointer value storing * daemons: call initgroups when switching user and don't fall over [KC-684,KC-690] - Update to new bugfix release 8.3.2 * gateway: fix an IMAP protocol error [KC-668] Apple Mail/Alpine did not show mails with long encoded subjects * common: restore ability to output crashdump [KC-630] * inetmapi: avoid short allocation on group expansion [KC-388,KC-727]- Update to new upstream release 8.3 * Enhancements: * migration-pst: call SaveChanges only once [KC-534] * Fixes: * caldav: avoid a nullptr dereference [KC-236] * cachestat: avoid exception and unpack tuple [KC-402] * ldapplugin: revert "catch empty ldap_search_base" [KC-602] * spooler: fix crash on forwarding rules [KC-608]- Update to snapshot 8.3.0~1007 * Enhancements: * gateway: optimize LIST, SELECT, STATUS [KC-490] * icalmapi: VCF conversion [KC-420] * Fixes: * migration-pst: skip root folder more intelligently [KC-487] * migration-pst: MV properties are handled better [KC-457] * client: add extra checks for EID sizes [KC-500] * gateway: enforce user and password checking on local socket [KC-396,KC-490] * Changes: * migration-pst: ignore decode errors [KC-521] * common: fix empty text bodies when converting U+0000 from HTML [KC-557] * icalmapi: reworked copying description into mail body [KC-568]- Build-fix include of kopano-migration-imap- Update to snapshot 8.3.0~694 * migration-pst: skip root folder without hard-coded name check * client: add extra checks for EID sizes to CompareEntryIDs * php-ext: use /usr/share/kopano/php for mapi classes- Update to snapshot 8.3.0~667 * Changes: * server: make softdelete_lifetime config setting a reloadable property [KC-472] * icalmapi: handle missing timezone for RRULE [KC-414] * migration-pst: filter metadata at start of subject [KC-424]- Update to snapshot 8.3.0~334 * Enhancements: * gateway, server: reload SSL certificates on SIGHUP [KC-301] * dagent: log_raw_message option can now be used selectively on users [KC-370] * Fixes: * gateway: report missing attachments over IMAP better [KC-436] * inetmapi: avoid overzealously generating winmail.dat [KC-348] * common: fix spurious crash in sk_SSL_COMP_free on shutdown [KC-443] * backup: improved logging when ACL does not resolve to user/group [KC-431] * migration-pst: show usage, not traceback, for invalid options [KC-372] * inetmapi: avoid buffer overread on rejected recipients (showed garbage in logs) [KC-398] * Changes: * server: compressed attachments now get the same permissions as uncompressed ones [KC-380] * backup: maintain deleted folders and add --purge N option [KC-376]- Update to 8.3 snapshot 223 * Enhancements: * mapi: drop global lock and replace singleton allocmore table by per-object vectors [KC-328] * swig: expose group and company properties in Python [KC-320] * xapian-compact.py: new -c option to specify config file [KC-205] * utils: support setting out-of-office without an until-date [KC-275] * Fixes: * pyko: do not throw backtraces on log messages [KC-340] * server: S3 object sizes were shown wrongly [KC-351] * inetmapi: do not always generate winmail.dat [KC-348] * icalmapi: timezone search was broken [KC-313] * The RTF encoder incorrectly produced paragraphs where it should have created linefeeds [KC-338] * The RTF decoder failed to see that \uXXXX could start a paragraph [KC-338] * The RTF decoder erroneously created a new paragraph on \pard [KC-338] * server: Ctrl-C now works in gdb [KC-171] * inetmapi: avoid an infinite recursion on SMIME handling [KC-366] * ics: make creation of new syncids work incrementally [KC-208] * libserver: change incorrect compare operator for EID_V0 [KC-365] * Of special mention: * search: python3 support (but requires new python-xapian and, as a result, a db migration or full reindexing) * Developer/packager notes: * KC variables and functions now live in the KC:: C++ namespace [KC-369]- Update to 8.2 snapshot 451 * == Fixes == * dagent: iCal descriptions caused wrong body parts to be displayed [KC-138] * dagent: mr-process failed to copy attachments to the calendar item [KC-202] * dagent: restore/rework forced ASCII charset upgrade [KC-294] * == Enhancements == * kopano-stats: bind 'q' key to exit as well [KC-105] * presence: log authentication errors * Improved PHP7 support [*,KC-330] * == Changes == * search: log to file (if set) instead of stdout [KC-204] * search: treat '_' as a word break [KC-290] * swig: resolve crash when python programs end [KC-269] * config: change ldap_object_search_filter for WebApp to be able to search by mail address [KC-337] * gateway/client: avoid resynchronizing RTF body content [KC-338]- Update to 8.2 snapshot 397 * == Fixes == * backup: avoid exceptions on problematic rules/ACLs/delegates [KC-213,KC-266] * The comment for server.cfg's "disabled_features" was wrong [KC-262] * php: fix crash by adding missing pointer type conversions [KC-274] * dagent: the "Received" debugging header had the wrong target address * gateway: do not emit an X-Mailer field when retrieving mail [KC-277] * server/ldap: report empty ldap_search_base setting * client: verify peer's SSL certificate name [KC-156] * admin: support unwrapping "default:" type URLs [KC-289] * backup: fix tracebacks when used with ZCP [KC-306,KC-307,KC-308] * server: implement missing readback of compressed attachments [KC-285] * search: add script for findroot upgrade [KC-300] * php: ICS import/export functions [KC-302] * server: AWS4-HMAC-SHA256 support for S3 [KC-170] * pyko: permit "public@company" syntax to specify stores [KC-317] * dagent: new AUTORESPOND_BCC option for use with OOF [KC-319] * == Enhancements == * PST importer [KC-59] * Python 3 support [KC-48,KC-267] * search: files are now compacted, and their uid/gid checked [KC-188] * server: allow search folder creation outside of own store [KC-271] * dagent: forwarding by rule can be restricted with a whitelist [KC-109] * == Changes == * Non-Delivery Reports now originate from "Mail Delivery System" (like postfix) instead of yourself [KC-309] * Support for building with a no-SSLv2 OpenSSL 1.1. [KC-230] If you run such a setup, be aware that a config setting like "ssl_protocol = !SSLv2" in one or more of kopano-{server,gateway,ical}.cfg can inhibit the process from starting. * Cleanup of the example LDAP configuration files. [KC-229] /usr/share/doc/kopano/example-configs/ now has just a ldap.cfg, and no more ldap{,ms}.{active-directory,ldap}.cfg. * The example LDAP config file now has a different proposed value for ldap_object_search_filter for OpenLDAP. [KC-218] * spooler: messages with reminder will be sent with a TNEF copy [KC-152] * admin: group features will no longer be shown [KC-239]/bin/sh/bin/sh/bin/sh/bin/sh/bin/shlamb56 1615606617 10.0.5-bp153.1.2510.0.5-bp153.1.2510.0.5-bp153.1.25 kopanoquotamailcompanywarning.mailuserhard.mailusersoft.mailuserwarning.mailkopano-monitor.servicekopano-monitorkopanoexample-configmonitor.cfgkopano-monitor.cfg.5.gzkopano-monitor.8.gzkopano/etc//etc/kopano//etc/kopano/quotamail//usr/lib/systemd/system//usr/sbin//usr/share/doc/packages//usr/share/doc/packages/kopano//usr/share/doc/packages/kopano/example-config//usr/share/man/man5//usr/share/man/man8//var/log/-fmessage-length=0 -grecord-gcc-switches -O2 -Wall -D_FORTIFY_SOURCE=2 -fstack-protector-strong -funwind-tables -fasynchronous-unwind-tables -fstack-clash-protectionobs://build.opensuse.org/openSUSE:Backports:SLE-15-SP3/standard/9967ad34b0d2feac827c73925a4d2402-kopanocpioxz5x86_64-suse-linuxdirectoryASCII textELF 64-bit LSB shared object, x86-64, version 1 (SYSV), dynamically linked, interpreter /lib64/ld-linux-x86-64.so.2, BuildID[sha1]=0406ed1a7b44c14baa0b67c1248ac06afbc7364a, for GNU/Linux 3.2.0, not strippedtroff or preprocessor input, ASCII text (gzip compressed data, max compression, from Unix)R RRRRRR RR RRRRRRRRR RRR R_8Hlutf-8cec53ceeac2e6c84d188fbf20e0ae8b5b9a4eda13ca38c3f8c503649428e05f2?@7zXZ !t/o] crt:bLLŮƊG;Drr"#OI.*–;iJBr(d{̅hd'l K!EM"[xPEXrS߮lT[v}!/?0TF }I_)5ϗG`ypbiz`8Vla5\:~?! =elYܠƖPXC9``쬭E>=5I{Rx);VvDRkN/$7܇ܻ2$㬅CE)Ĕ*֦ o NA݇㌅m~xmܔwB_#oH`ַ:eƭm݊M{mÛ_*w7o]DN* 8`%fRm(39WsHBsܞ6z\c/Wn!XNoi5jjF/2=O^ Lа$o k>A"WV9nP {c&B s zy..)2}0CƙC= , D6~Qx`M98PQT"/+iVy؞BV//V4?{-'Wb}9 UC}YF%BTzq'w܂8Ddr>2Netp~}DX6e$ݟXWƠT9CzWߌ$!n%΀b]joٳhYJ *,G>HTixQ[DCժ^4TcxY ^ûmpTFes/Z&K5}l n̘2n 9陒ak'0Vl/FGsX:aC;.R 4+d;3ҳ߇RX1j*$DAz D+sN,hX"اcPz1 e %u#r+ھ܋ݓ^!ż|z>j]6:鍴smZ@Ѓ8z>N#]\oEbMl1!Rk#b"_?q.ѷeg8B(V-0GظvY;*9[]Ne)~Qܦx9*F;Gx䝮9OV}Nz Qi(A+3EjSAL߀DxǙ>=)^n*7˨~w +y 1qg ,mBGxncb[i8 ɖM]MtϭRkFU7hΡn~Gv5 ŀ$W~{@{@lh'V(Yq%TSd%DyYYWZJ!vku~Tpk$ $KɛZ-%r!6mb JJQyA r5ͽ=GO`w gMrz+/Fn..b2JZjpV/,Ąv, n4]>Пa|M忩zA __6a>E#< ='ޖWesl |Mg^|_pLמ4JgnDTreV֚֠e} w[p_Ip#l5UlY@P4ܝ:[#c?p-f'E*j(Ἳ~"zvщS '/@axnć|"OO"8GI*RDuU\ ãS,̪4z㎆Sܒ*Eu"~"+AgP& 6Joظ<'/'uQמrp,Q8RD-_M+}CqRB*I2 /p¡G2O)^`Tү;e7GfʰTc}nWgGwvSPlQQAi`IPLUߚԊ&pwL fuwDt+'Muap3\ZdtH(mQ@ A_`5vOe[_]] 8^fϟ໬J'(!9ć& C>»KZ̆,-enNtv;K윇 ԄL^=x*(u\OܫG9^s_O|\A|IFs?{'WiGDN5dUa1:PɌ&ؙ w)"j?z{6~p3sQNG]eSGث]Ղ=lP8kx;1zExUL7bl\Y }A4$/qV=x{?k֊oCtd !#$o$d"1XEe[@ @kպ:R,q˅;ZW2(p2гb6v?΃ҫejK3\ܠT:A/9w\&\m<eqpp]7KirIo] ca秣#V t B[.q].(V. x2E.m.4dt ĺ-p43I<iI[+;) LPSG\i ]b,>.Ųl/.J TP=,/*!'?(O9FbUX̘o,MxL֑2zAM@"%%oE8NvUKϚ,!\2v?fmJQ ^UޕlTRQ{;R[zxQ&܈f;4Q*h{9Vc}~"8p ϷqcSs)lSS:y*q8*ZMJ԰pwf,Jaw4@MW!ܲ 1#XWՎr2yEkGN_COQC#y r;hH̕{ލ!쭙2O}"8>djP¢t +#c6Q[;i;'IþIEP,؝K= [W$vZIѸTWe&c@A`wI(>Yv!?~(tR>!OðC@P%WB"a(7ZLc˜*ѭa289$A>co2eY5H{r{=. -^xS}C򄙡mIkT!~bORdITٌ8C9/hT뽽@l[^.Ԋ(!!5k46ٷoeW?xAKwoO>ֳ9VctģP Py>QbNj22ƒs~Rv4R\1f_ g,ވ aI0#!4ɻJGYgҼ{.h#8H"rԟҿ͛k=fytP}@w(D>v \7}˥zG(]j;|cV7w< C+&Ĕ#sX;s{H%z ؄}B'Gzky nNv2Sx 孍Lm_T$KJ% Ն?1,7d2Qdr'(5$n$G U:>ZKul0cĕ;LIU*?rY - 8<= ,,MWc5cs~03x(ߦQm ; dN҃ji~ =b$rA'@Vhd )4h2̨=&ڨٍ߾%JusiZCn$=!I5X>$@6^b%RHj[.$2cHun%m&I%rND~0 hx\30kxq$4<-%}`|p-ٖΊƍg9ɛW;䧋鐆XR&Ul1~4"$mG5Iz^ Q/UvbC42KOMc<Rse_ LOl7BO < 5 um8Dz}Ӂo5a1#_>㮳?s,֕`rн,P2R¥r8֕FT4| ܍>NC#h{MRuS/0/ϫ5Ƭ];nhf6Ip,5)";o󏥍Yzpn="2a㜧z6XQ$D'׀9y;"[z`de#1 sm{FmGM68!յ-r07on뜿\5(ku$ :ҍڷWTl(& ,pq48ヸܱP SV/G fUA^lo5ݞ?Dq*gʼH*QD[U={R{4N_%06ye OF V{vyzv%h-ʙPjbz]Hy KAOAf} 1)'_ڦ7D!ffIX/ By58wϪeAnW^_b|lβK%yˁ%gw.,+ >AvR&B|nĨ(i'Ql d.|1-ĬpBJxнXAFARU:}.# _WWZ8~gwG01g}C;yw.&_oƩ2 \Wq*_94Fp#M _ f*E)&H D4?Y:VE9TJrP lAWEʩ1'Jg"j<ĕҚO^+K##jYkƽv|̩`FGD?'U)&QF#kW׮hxz8xn<|!ag"Se,~p/2lcC w)A(,"<̑7a%^Z+]㳅 =yGu{T4yp5im@kv3%:#:==7'odad۩nR$\PI9NP ΋|Q#( 톓h2҉EҤ-* "W%zeFb S@ VO-1䇏58v-o7߀vh% E%Q?Vi2B*Xe5ix*}?ҳٴ4EKę  FGؐVp7a7s•?ʋ#Y|jhLgH{`$-G]hjTl1\Ɨ¯ s4|{vcߙIζi֚$DO~Ow ! `$*uw:}AW#`I=6Y$bz&7 XX0&0&t԰T7@Eonc18#VKgG8;&|\a$HSzcT s O'͑esUmD H93B[7gnH2oނc-) !h`CA@+K* YG 9y2UOЍxS5-!3R_h[ `QɎIXU]ϔ0QƢ^8uv12zǻ_ސ Iԏ[}k߻6ٕɈOevRwA:̓n4$Sf궜('>kU2#l7.T Bp75_t+NCƶN!p/SAذ뉜 0.|m侻`JhRR\t&%J[v.F$\B3HZо'6z:t4jfX]}-l|ojYswUeJjTe-[Iar^\݇Y$ڊ` ) QiLXSKJ%Ypu2Cu 6ji8|[Fh*Xd2 6((rlV\ ܔdHXyԳp顼 K[nŪQ\#UbsJs,d:"SoVk?){Cd^~ \lbvġt;4n4CWkd)DKߞ ÏӺ}>:==L{ v.s "b! (T|TBp@ *Vni[JZ.uHǰk)ӥ{ zorz{8sjzBJ ,QɖNh#I«NvBh 8 !;.RT-U ./*|gf!]֥od&'hKWC蠶A%0P'PvZeO>> ߯1l,PX>Nnpv#2 ټ@٠  +yK7'7;'I@qKcI (q†Tz,x?VS{2Ϥ9l/6eUХ4'IXq"ѱ"@qƒnrT{f:I!$|f,!X4%Lf!-O#of5U"Yn^;C^ ,y(,IW[ ӊs祮{xOnfUY_Ȼ5#s}Eƿ܂"Kj]d 7 Y^tNAP7Ay,;h\#"67XvPv4-}z%?Y{7͐&)Ha_ zk~ɠP2Mǔd6߹5k6SXT--ϕ|҈.-JIzkK|go@i?[Wh[Lζ͋4.FK bjY?o4}0ŇM򷬚cz%|UE2 <=u&NB1ʆ  ]=\x_%"mHW2q_m_hkDl*_>H Qަx]d  򞯾is&><Rh(H+vQWP[VZ%>I;Ded纷:\k ZHgx;o" ͋=8jG 2khSr{̨Y%"9CpD,aMDFyS/%2׻jVl7  f5/tG-D$ #xE+y%MA"#qőHQ&T—,Ax !+/iNXJ٧LEMJ.f> ۜA"$MÑpu;傅ܞ]""8=)q5gغp/3K&(Iz}pD?!.4[ eĔOhoGHQo_1Jk6& ~k+(Sq\{Hۇ{rY#VuJm=G{ߌ7diIĦٯC/Sɕ_+n+"u(a/=kV?jw~6]?y Ԃ >[ҾƆsSm{xE.+Gr{ͱ!kck?&!_0HnIA/hn~Wؓ>֙1(8t> 1"9N/?p7w`Bʥs¡"=ĺwBU0E0#*LQ 8Y)SvrԴRͼW&zf3?)J@F[Dipi4Ed1jcI,K&[G |:Vߗ?lh%r> Ĵ!3ND]FRlK7oс |ʰdfZ=x|jxkC˂c6 nkQd4Hd]߼s\V-belns`ho ,{L5$A|lLv-z,'.ҒiM`bh =Q i /4wgXZLLc8 A%jIï_ ׮co0tU7puvdbffCTX);bΗx7˩ye3>|ȪE)W eb3Vo歳Ԫ}h:55&D#B9SuTnȘV08!tsg|~ .ՌQNH{l|PQ_A0N33GlCIaEUӴx d $wɴ;i|KRİ$^!}a Q6*S : >mPg¨.-rC'gu Ṯ _2` Km |Sωs1 G 2ܐVxe7o]ZA,N 3Lyr8ٕS&[M#L\W z]v6BĻK[㻌UkRH述n@ܶ~?QS}&[Zݪ[ WD8DajfB_c3I x#%'d3Q("l$6& ӿ|AW `g^Ne+`(O7YEROɾX~W?&}n t|)?<~[֟f6CUQZŁȑ "'9oaTU=\iNY-`Dati7w}5i߰Va9՚h}nIBP$f~k{#kͿM,K;{]wW hqN\}$J.c#Y֣xO{{\9Y8񳯄{Q>Y!`UODKxρ"n0+qng9(l̙'%XCuI?G$[D3c bfL *5):oE:ؓ{{qX`зnaRWԉ'/K%# H:I|{}lEǠ묦o͝oaQ@ޖJt oH j/YEeקHZRщ"Ėp۞ 6ѾV.O:K9΃>%6·BnpC\rQ{dž o SoDQl68m\5̜=sF<zʖ,"1*V0PbъbZ=ckAZ%̯ar͉%GۻL>X |YNYW0>HLU܅c `J9r;Af3p"iCMuݯ:86 d-&HO$! P1OfGWU=^{lip,l^8Uz+3_-W\dːK% P('qSn;yǨ3Oy-kޖI/Vv^ruk G8ا"bK<8$g8 #O"~Ɔ Ǯ{%"DGuݧ! t Gv"ͺ?`ʇ?79ȭCl|fBXfawC* z`){ku+z %m)F.-,Og a( M`LyGQ+8PHfcX ȴbe/9m S K0fyOƖmLZl>U!_Ib29] .ޡ#U|/}5O*^8|>T4t7w wEM)I5TѪ_r "_KL2f Q0ILdHD$064#EfBG빼 ZhNZu٤0$9p9R rei,ڛxNRʊ@o*kD  B?4%w[x;=2)ى/(]  oZGwcC*=J\]\vPejC+j%&S#dI)2wZgB.j($܋sܳ[V*kCڱ\O- MhIFYje8T3pyfT,QξXnO ZnhsxA QXd*߂\cK86mA9ŝH|yIH2`xm$ X-F#VQb|7k/nfC*)vI3j8Fc`6mz,*LPKGYvѐ3E@%hqXAqү e$m@{m#rhx]_FݩS kj&J'+s<>rz<<맋.N.'f_k7Y)'^;#N&cv,p=T? Ƀ&QU8„.Q^)ql哘Τ|N}(keaӟzfƘ4_h+(eJtƼ$ ;NH bZIC eY  H@EsU̩pTh?sI,;tBƚ"{Oն2WOm"퀘DˇHVw+6iN⨞UR!a`(xXQECJ`b@wtepQRױq#RT3Sw퇬ui2#uW^rW:U.! 9P=l* Tʷ~pvG`nz'aH ErLUl?P=4vS/5F@œ#HGg{TSX]Z<{,JyaNy-ϛD}?A k%JGvVFjwdv"K{喬AЅS LtiohUlMUSGɡZct:l!(U=f/9:qw'IH{|<ɣ]7j8ԅU,F:95O8~EDQɳYy8T R⎼[["'vVmm l!*P* 7eKf 9r;Ls$e~GGݞTW(=h>=^#|Es-?̍rtf*D]wwMU2eۓjD>Nrn0u;H ͓98Q¥,xZZk&F}дEϚѬ%kR2x#6-WmU%m' gESKj4/GVڭ+Pn9K/jE{ŪVA~90^J;}7|4$/͚>b: os/#4ejt/21^kS {j0:8|*oOئME :8Y6inʓئxNiVlO89R m}=14^[{*!]ي@.v>%0Uysn]΍T)N!Kiꊀ }Q Uh{ʝUJv% *jv NNR!yxvг }U嚫B1rǁS0z:,[P;r/B+[!af)1%fk늰_sr>5_O0/,;TwZb 5n zz*xدu v?OYpUvcJ\~C8q{ndINUY f́yܔc](Τ?ܐ˳Lߜ8,*#̀mE0|]L#at QR92Mr2lR@vT}L3kTVdgS`<$rq (w& ԥM\h\t\<'o2R$D`v^Mk͐h!1EF bd;Y{D$iO xchpQfv dKtJv S$FnNM!x,ő?6n֙[PhTGB:IڥȂ_NjN(gה,b6$uJeJpe 4ܫb}v*=݊V7wYli8fI լcX)j· UæM,孳o6iFx>_EVI`DJS̗oY'4hh vOз5gRuB07 B}6"u̻ACߞ ]pf&ִy}(&,# pRy=1|ٴ4E`4) ?3?B3mep՞l拺Jl)\ %0]FawX2:ұP-NגI:mOOP5L66WI;Z x|M>5)H/p0l'VfVnpzy)L8ׄͻt xpj.r;7eB˥V'[4!2/ml1AtӾgէL* rpa 24 鸧EX$ÎB(GoHTW-eX,Haݑ7il̟$.fu}CL˭M>WxUߴ[UgGB ?IQȂp^σkvs) 5WfA~G"!gC_K V8ʼn=u|2GےV#wGbĪVa/RF}{=f-L6h?n~.-]*XDCQi_+$zXx~' @K.2TsL9q9iDNgqV})OV5 8p2'HϓfRč>B7M~cW*QĘ6\@&'e[Qn8xq}tNC"^q)։wKa1:&-P+ofsSmpx0u-m:ܩwcfW0"}{Alo>G,t7&"Rz#Kf9dVz9ڐ-_U1$ps76 ;_K/*P[Rg@/{BRz[m^zܮ |$>wZß(س ITgМ$\_Tn-Wu9W0eNHtg SL|JC?4b瘷,깆bd'Rl{ ?jyfRNn@(d4S/?mkdt^{sʿtj:aOsN}Ϡ/&$\V+Dr$'ygz5=},EOQC1Vxz QUIM͡AƦ+G)vEhŹb-$1X,^; Ag=㪞Agk:[+dB}FD3ic? υ6I8haMiۨHfԄ5ҿfWyF6^a,4Sϼ&04LJ.^B4l9u 9>ď\)2:f E&JyWDJNa -'S(=>zV6zjF$k{s.D.C`~9olK2!fid%LϟKKd'Co2,aoU]S}O4澝Hn5Fdr76[Y8bH-S=Zm`|Jڣ:.Kx- ÍaT JSF 6eg6|ϽۊgIߤCQEIwynT2`MqOFHTrǫrC6Y[!d&ha!˾>8D‡[Onp7pC@0N0S[^̸dQ sAiyh̊]PWuȍ9,=IG v'{pou=v>eDZ֒छI؎G}LV!N]H >OW_ oLv RlJ&1!,hشqzKI+t..](/hqm9zӵɣc$H $À` w^|)*UፔFImP1~zzi~D(Lfo%#! 8[hw9$SHbT>qFDk|!AoCA|ҧc%='|\S1x 㵑rkHOD+0 Eb#kxWPd[$/fC"j^&2|BN Ex,D=ƌK- [%3%/:2@c9{9D{zo,ːiج=v3N":2rmR>FN=iՙ>SN5ȯ7 9ziLI|6a^'Qs" 0Vf mZ*a(O, `"Jč,'js5:7m1fqQgQILA?3ӄ4=L1N_&+G9*"aD)=nX=sԛ _%DτP^TSeCE_]2wYأ[9{YUlBSwȑjEDb́V ׵ANPahJYcb^srߘ=m_AͦtO yPI*su3uI_qU["MV}$Eox/hD xS|sn{DWH(NC>XQ3_Iv%*F"D~%'e[e3/h!qjvD]1L´>y. Ԉkԕbݦ*!/=DD[Eۆyv?j,PZ#8$'Q#l C0?T}< CTjRugt]۝ZϵtY Ң3#'SL izaޖ#71Tv8e2!j PUAZ"5_hkܯ2["喬Я*Kz%a\d6Nk_/F\+΍X ؤgI1}Kc)W?F$|tڃݽbK4M͜+&sDؘϲuʈ!&Z o$7 u8tZd4:%yc?9iL ΩN#Rt|msjOxKơ^IP|FZ Jm|׻PFE]¶+ax744|yElDwQƵQxs=U7h` p'MG.ք =:ى6:̦0X<Ӟ79G_{Ԗ;&L i4&px$JJ c  S_f^}{s2pNLM)Wl{~s^;.;װùG}dk0 eXTwdžÁG? {Q~q\戳oF kebfPobm+@+ 5Wy:Z>@3@Ѥ0յX}C5L.t$c~X⚄c2j~hv!X=EKh- Dk4ۿi}չ*mqr?Cm>|e=b  ԋSsw4qo.``͒鏮-aZf%Ds{^Gg(VQzv>rzkΛ@ݐZdWkӉ;yaTC˷!~4#W 7\PQI]no5~bF+w㗿f ~)o~[Y% -oKekq"(u$6.K˯m0ar-"^vAg >UB-FHG789]9۵Wq//";(R<~hӁos. -]mCS(<g?5qf[պOšcG':%N&/_xr`ZNwg X Y_CGW3'v?x6r&F/5ƈo-oCE/ӏsq4,;kO9KGL@ D،tk]67.Kv O!"Onb{`bk:}ۆ#êIq 6oƀU]8~P6'uz0?L,!M֯|ҳ@x'p<)pd#v~W'l;2=LE y0="2'*G. گ}p7g f/IG++~|KwdKخPJڟ"`F7aOH42ms8ʸh59KnThI T ͺiRCkY.WO@9_<=$v\BSwHl3,wJcb;1Lhpsv#^VT+ St^$vܝIF XDfIg5ݱE+5JY:?O1+;`%U*;Es/8/*GũJ csWVZ~UT0&==vHqI1L/\  cV<ɍtd&Fo2)x.Q a-b!L3)M9Ghzf)p-=!]!VU<1#RX3`*ؙT fCY| MPv/{>j#(D @RQ8 ߯nѳ`nOaJG Ɣe~XU֊w^6K6tR"^ N6|r]/.`;.uD{f\K|D-AX9K>iխT`HCrƯ#U;Hkc-2WX~a 0зB J=h2*l~|)į[v~+7OrfT(0^jh/?`ztTB:D>;AV][Vx<L !|o`+lM\o,ĢHbZ@ x4Ό%Ҳok4͙f&j:﷥\`פ:6 &-} 8ؘk h6L E3 EGD?[A0K=/z q%Ԏz{45³Ћ&b書{jzѻ,k @n4 W~FVq'TXo.kAbY)-_bǰMS&'4+ݤnB3(j!0؈P8(I%?qHzUOr [)KS! s9@j1wΌ;)wzu#G z }c(A1&܉YM~OTAӪwă?Ww{ Q!),[ Dg6a\\")@!\2&ʏn85丞{$>Nڑm9jY8Csܵd#aAӘ Y,Ur0K,.47[mg4^_Mɱfx,%MVm>۰=tMiJ`K-%…o 0gu)K.{ "c1s8)SVAޠY &iEFbSXٗ{1"`ci@U0c*1vɏi]IOT!D-@ w6XԤ")&0l=ÉWa6:QQ*ͥ1 +`5Z|ėQЋgfI߲gSjG(}YSLz=%mb&3ô-!h y0UVYw^U?"Q%^;bn_vqgZ V1e.ݦp\H;ECZMFR*qhgY`){d?`aOgq=U`uɘA(k>f~_gMe>dp^=`~cgqGNU&RJH9G!zW#Hߊ؀wAsPtk!^n*?dmcw^Th1J- aYqzvBPkHQ[5A6 s.=TcB0-~s~UT*ަ^x>ffw߷w;.B4.H)l3r~L`\{M?p(`A)Pj=1>,P4Z[RJp:\(ioID5*n»W#m+"x;Q(P9^O/|}$IM .EiW4i챝QrvW>':}A[f{P}ϕhLYt3XWST{~ZD4_$Nj[؎5xPG: ݯy{ćۂjL-p.=ޯZW-t_Y%k]BG%Re ksJVl#T<:1*eȝsNP.CJXB_U>9K+9q' ɍW L>?mi*D4JV>3֚j~ ʇȅ遾s"#.OC!Dp璴ŋ-uJ}$]6Q2f=}.}.0nZ #jG A3xo ?O|Q\:õyeڬ;Vw%|#7rjˀN"N";vv1/m:Q  R6 XqMX/0Vqd 3pXHQY;.0㧮v-Pݎ Y.src^He>UpHwW\L*0(($R *x#42?<]e[f;l) #'?ӭf (#tHJ$|NWl.4>zj{{ h#홶˕"-M'COcay\EttBn95V")UMg qD:bm935e`EvdL찲&MV/~R7'D-DHxX-yr{OGPnQ[  ;͙Κ11Jh<29_;kfR1FWZE3i%'rL65Xw蚹ttV[gMljo ҘU9xvBLzС?W dg!߸ 1Hw\5I_f$6;ϙhHbea}. [=-"YUg/UI°TԞ{%.pK~,f<@K?qb7H -d+]Cj $:D5.H8^8B7y{FC_+ ̈́B~[e[RzVkױZ}Fw᠍{PU Kb54y (^^!hurDZ2:A5"*גl_^v~OKF=AfRhU=M) 7kn:)G -#aeLs!V3QI hD4;h<9ceB'n a[Uj" 5%n[25(fRR %(,I9 \ӑ,JmER{=kl[b|v88fI| PQ$ziݺ2x & ldⲽc8o: rְgH;-rK-D TDD&>!V)OzxH0p|Wƫ慗ئuݦ{j_cr3<{YܗfR#tX=$Ddap2FJ|;,$kD#k9U7oW/Ph0dLS>nkU/<>k@^{*A6_!uLٍ̎>~ȳRe%N!ԸCIy/uQ׵99X]ylD* m;GZg3$qkFsAAgDmID82͔j$Ȓm9E5}>bEHOBZC|ۨԞ#p\(2IRpl".'?e/;#vYFjxMw$ D+`>Z JH7Uw|; GSݪ9ޡNC:tمE#o߲WHC)c"Isy@#limTI6#Cj8Yuvo1 #Q]Y1$үAPekiS'H<P&٠/ ϭKf(=IJ?#7&Zn;]W,+Ŷ(;Lc7'Feޤ{uf+iƛQmhKF_|!B_ߥ~qp1=bQ8?7;!:=Oc]_2LLvp`d@ߝUIO73v?ŵtWUwiMԬXY4eTmZTJ{}ƠC Mc UoPFSQM8uDe"K'V)hR? kEJcoPZL݉ЊuPGK8 ywiyMݔ.;)$ʝuxFL?X iED8sV17]~-#K=:XAsys!14@<v*+f/t)b,pc^sqäN+R\ˋ;,Md9/.@@f-Ejgn埔pfCc+d>"]J@3;sە7\16 _^ ڽ.n* %@7{Lc:/CF/|cH`@N@%cM"i&-aW<2G+ H+\ESvF}3m͠+j#e؎eZeL#%^@52óg Ђ٣p.jz!\VL~T@\[ereI Z|-UɒW`MD7Tz$pHAt}&0Wd:<|ˣij5p!M̶j~|()XWĂEN{% Zl _M5N75jDV8u9er2GVvtWY4upvd} Gjۛ3GLpT6IkHFg1\_}~ O|Ab$LV?!;eNqVLh 6X=[XowBuȞ1$Ȉu(d HAFY C+ =o(Ds6M|&o FG7 VXuŃ%".0-KgkpQu;`X/. .Jc8&07?ZDOZc]Wak4w-=}9Al;xFJԗ:`(*Oa8Bq_r@Eʤ/ ) sj%@`b]ca͕w^v.%GӅ7"r'y7&J~CTn)ݮ|$׭)c#wрrR*>/r2 d>1ғ>tmxYKe*y<8\8ZDpRLa;$ﱦ zn6YHuqS!gy|$j\ #ZI'Ǻe3+!)9Jju{%k23%X6@a\GƲnM /@B%+B2ߚDjee9G<|(F:#КR}@r3). (+qJ]{?fR:(SZCŒH*][SMp U KXwg1H'z:zc {#ܣEH0[tzpaĒFQ1n,[vWxD' !IIP+TiuNЛe ѕZ@{DRC*6Ox^ (t|6_nwe6хNJB8ZR2313"El*^«$oEp Kb՘%2C~m=z`il.1K |Jea0Q^dp,)gPHUxPQxec:^+%Cq:qA\** ՇeJ gu:a4oAE+Rv](-,rN#!S@ K Ew|8$3+oaAVؖ1|$>a4YbJ^n\S?0p5^]R]9Q9+/t:u1.j߈Q>e]D JJaCV: $.)qh@ o!iq7m6p!DJvG,j6cd12+:" ТDJ-O*nrm[Z0wIP=)x;/@4 '(|4B &7_ZL( N{5))tkSlź;ly:JĹ2׵Pܵ.h+,G*5XTZL~wV#!aX3T >Mcduv˄V}r4j+&zNۈ;=i0>6L4wGAFBU=!K6z9*eOTKJ= TJ$wyx@|&]ɦܖ-0<5)h\8Rёo@, 6S{jXo8'@-z:0ڨNfG@}ЛljRjBVpɹf$+<]q!怔}?jSp`Y /p(_DzR͝ڍkY} ?Zx\ُӋptnN壉I^z&M'k#ۇ&Nߎ8P.#"hbWAg\(Z O40ooR5q1׊XܹY68`?F'Yɛ:Q>{k͡u6`Њ?!a+U#T^)"5݆7sxCh4Om1|+eM7gDy}.X0g\l-481S |QnjfϾy_| -_'[o`"J8m`h7'Q Y?2y% EWe?5/Xڜ82U eIR[_AK+9_yM\R TE-jd.TLbEYmo\>}=zڦ8*",>lFڔVnCҔ(=K>ҝ/z´!}Cl0eXZ_<3!Ck)YwJ-KFМNPv8?9St]`(klQUO/N+9a>n\6_mb&堂ӆkdF QLo'- D w5iq;'+ y2+ m! 60hP"]j?/_&!\+J&CQyEgu*1$??XmZFU+x_Fp|Pe*r ~<, I#W0|܍D彬ěˮ y _Yün*ܦ'KDR]eȋĶ YZ