kopano-spooler-10.0.5-bp153.1.25 >  A `MKH!M@eee2!*m@zQE9߄/iaf%IhC m! ")>NcN1æ 3SRD @2JKX_L')2gTw=~Bs00];t¨!GoCi4e/\f*E>3 Nu^-PZH%(F$MӇ=E+bL xOm<Zk6Sl3 J꧙Eȴwp|D)+^_mB?Jµk-H253b2f5d6c7429e6f1f1027945e96f08f355de071e51f00e52a5ebcfcf48dbe1e31c0a161f07ac3efbe972a12908b30f9adc42e9`MKH!M@eee.8UN!`& BYu ?[&?© wvO|V@y˂ ïdjߜkq 1 w 'yOb67;1{ Q NbJW A7WIꮖ;fɅ 1;G1%Ё7ƖΓh(AVo: fO7Rfh+`z#UAU̪f]o }ꀹ94ɋfjAӵQi"o":T\k  lJŽOr[>pRl?\d # B 6\ou{  P p         Jt+++\`u({)*+,-8*9*:.*=}+>}3?};@}CD}KF}SG}hH}I}X}Y}\}]}^~wb7cdEeJfMlOu`vw(xHyhz XCkopano-spooler10.0.5bp153.1.25E-mail Spooler for Kopano CoreThe outgoing e-mail spooler. This service makes sure that e-mails sent by clients are converted to Internet e-mail and forwarded to an SMTP server.`MKs390p21qSUSE Linux Enterprise 15 SP3openSUSEAGPL-3.0-onlyhttps://bugs.opensuse.orgProductivity/Networking/Email/Servershttps://kopano.io/linuxs390x if [ -x /usr/bin/systemctl ]; then test -n "$FIRST_ARG" || FIRST_ARG="$1" [ -d /var/lib/systemd/migrated ] || mkdir -p /var/lib/systemd/migrated || : for service in kopano-spooler.service ; do sysv_service=${service%.*} if [ ! -e /usr/lib/systemd/system/$service ] && [ ! -e /etc/init.d/$sysv_service ]; then mkdir -p /run/systemd/rpm/needs-preset touch /run/systemd/rpm/needs-preset/$service elif [ -e /etc/init.d/$sysv_service ] && [ ! -e /var/lib/systemd/migrated/$sysv_service ]; then /usr/sbin/systemd-sysv-convert --save $sysv_service || : mkdir -p /run/systemd/rpm/needs-sysv-convert touch /run/systemd/rpm/needs-sysv-convert/$service fi done fi if [ -x /usr/bin/systemctl ]; then test -n "$FIRST_ARG" || FIRST_ARG="$1" [ -d /var/lib/systemd/migrated ] || mkdir -p /var/lib/systemd/migrated || : if [ "$YAST_IS_RUNNING" != "instsys" ]; then /usr/bin/systemctl daemon-reload || : fi for service in kopano-spooler.service ; do sysv_service=${service%.*} if [ -e /run/systemd/rpm/needs-preset/$service ]; then /usr/bin/systemctl preset $service || : rm "/run/systemd/rpm/needs-preset/$service" || : elif [ -e /run/systemd/rpm/needs-sysv-convert/$service ]; then /usr/sbin/systemd-sysv-convert --apply $sysv_service || : rm "/run/systemd/rpm/needs-sysv-convert/$service" || : touch /var/lib/systemd/migrated/$sysv_service || : fi done fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ "$FIRST_ARG" -eq 0 -a -x /usr/bin/systemctl ]; then # Package removal, not upgrade /usr/bin/systemctl --no-reload disable kopano-spooler.service || : ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_STOP_ON_REMOVAL" && . /etc/sysconfig/services test "$DISABLE_STOP_ON_REMOVAL" = yes -o \ "$DISABLE_STOP_ON_REMOVAL" = 1 && exit 0 /usr/bin/systemctl stop kopano-spooler.service ) || : fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ $1 -eq 0 ]; then # Package removal for service in kopano-spooler.service ; do sysv_service="${service%.*}" rm "/var/lib/systemd/migrated/$sysv_service" || : done fi if [ -x /usr/bin/systemctl ]; then /usr/bin/systemctl daemon-reload || : fi if [ "$FIRST_ARG" -ge 1 ]; then # Package upgrade, not uninstall if [ -x /usr/bin/systemctl ]; then ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_RESTART_ON_UPDATE" && . /etc/sysconfig/services test "$DISABLE_RESTART_ON_UPDATE" = yes -o \ "$DISABLE_RESTART_ON_UPDATE" = 1 && exit 0 /usr/bin/systemctl try-restart kopano-spooler.service ) || : fi fie@~WAA큤A`MK`MK `MK`MK`MK`MK `MK `MK54e38c57ea626269d7f9db3a5eb8a541de76666492b75f4f30d0e5026907efd65bc369fde128a1f4b162e71f717b40edfa54b308d5c1a819592b7b150bcccd0e1bb14cc8f75003841f028687499733b7c27fc613fb5b24ce199f5547cbb5198cae5151db4520d162858b354609b66788db286f36aa46d5d5affb762928f62f3238761077d51b88ca423f19e039780412f05852ff4f791b48a30f576b1c52f9edrootrootrootrootrootrootrootkopanorootrootrootrootrootrootrootkopanokopano-10.0.5-bp153.1.25.src.rpmkopano-spoolerkopano-spooler(s390-64)  @@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@    /bin/sh/bin/sh/bin/sh/bin/sh/bin/shkopano-commonkopano-dagent-pytilskopano-langlibc.so.6()(64bit)libc.so.6(GLIBC_2.2)(64bit)libc.so.6(GLIBC_2.4)(64bit)libdl.so.2()(64bit)libdl.so.2(GLIBC_2.2)(64bit)libgcc_s.so.1()(64bit)libgcc_s.so.1(GCC_3.0)(64bit)libkcarchiver.so.0()(64bit)libkcarchiver.so.0(KC_10.0)(64bit)libkcinetmapi.so.0()(64bit)libkcinetmapi.so.0(KC_10.0)(64bit)libkcutil.so.0()(64bit)libkcutil.so.0(KC_10.0)(64bit)libkcutil.so.0(KERNEL32_1)(64bit)libmapi.so.1()(64bit)libmapi.so.1(KC_10.0)(64bit)libmapi.so.1(MAPI32_1)(64bit)libpthread.so.0()(64bit)libpthread.so.0(GLIBC_2.2)(64bit)libpthread.so.0(GLIBC_2.3.2)(64bit)libstdc++.so.6()(64bit)libstdc++.so.6(CXXABI_1.3)(64bit)libstdc++.so.6(CXXABI_1.3.9)(64bit)libstdc++.so.6(GLIBCXX_3.4)(64bit)libstdc++.so.6(GLIBCXX_3.4.11)(64bit)libstdc++.so.6(GLIBCXX_3.4.15)(64bit)libstdc++.so.6(GLIBCXX_3.4.19)(64bit)libstdc++.so.6(GLIBCXX_3.4.20)(64bit)libstdc++.so.6(GLIBCXX_3.4.21)(64bit)libstdc++.so.6(GLIBCXX_3.4.22)(64bit)libstdc++.so.6(GLIBCXX_3.4.9)(64bit)rpmlib(CompressedFileNames)rpmlib(FileDigests)rpmlib(PayloadFilesHavePrefix)rpmlib(PayloadIsXz)10.0.59.0.210.0.53.0.4-14.6.0-14.0-15.2-1kopano-dagent-pytils9.0.24.14.1if [ "$1" -ne 2 ]; then exit 0; fi # putback previously existing cfgs after they get untracked once if [ ! -e "/etc/kopano/spooler.cfg" -a \ -e "/etc/kopano/spooler.cfg.rpmsave" ]; then mv -v "/etc/kopano/spooler.cfg.rpmsave" \ "/etc/kopano/spooler.cfg" fi test -n "$FIRST_ARG" || FIRST_ARG="$1" if [ $1 -eq 0 ]; then # Package removal for service in kopano-spooler.service ; do sysv_service="${service%.*}" rm "/var/lib/systemd/migrated/$sysv_service" || : done fi if [ -x /usr/bin/systemctl ]; then /usr/bin/systemctl daemon-reload || : fi if [ "$FIRST_ARG" -ge 1 ]; then # Package upgrade, not uninstall if [ -x /usr/bin/systemctl ]; then ( test "$YAST_IS_RUNNING" = instsys && exit 0 test -f /etc/sysconfig/services -a \ -z "$DISABLE_RESTART_ON_UPDATE" && . /etc/sysconfig/services test "$DISABLE_RESTART_ON_UPDATE" = yes -o \ "$DISABLE_RESTART_ON_UPDATE" = 1 && exit 0 /usr/bin/systemctl try-restart kopano-spooler.service ) || : fi fikopano-spooler^^T@^r @^h^(9@]q]X]µ]@]z3@\"\@\X)@[j@[@[h8@[;e@[ @Za@Zw@Z@ZxG@ZP@Z#@Z@Z ,@YY@YeYW@Y@YY^&@Y@X@X @XX@XY@XGX5X#Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt Jan Engelhardt jengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.derbrown@suse.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dem.kromer@kopano.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.de- Update to release 10.0.5 * Enhancements: * gateway: support loading MAPI folders with slash in their name. * Fixes: * admin: fix stack exhaustion calling AclRightsToString. * admin: fix out-of-bounds access in ConsoleTable. * dagent: change SMTP error code for plugin failure from permanent to transient category. * server: recognize more MariaDB-specific status codes and initiate reconnect if needed. * server: fix a cache pollution with PR_HTML and PR_RTF_COMPRESSED. * dagent: failure to run actions will no longer stop rule processing. * mapi4linux: avoid M4LMAPISession going away while ECMsgStore object(s) still alive.- Update to release 10.0.4 * Enhancements: * daemons: service units now run with systemd protections on. * icalmapi: support reading multi-iCal and multi-vCard files. * Fixes: * dagent, spooler: workaround crash during Python GC. * dagent, gateway: avoid stack exhaustion in HTML filter. * gateway: avoid non-atomic replacement of SSL context. * gateway: avoid one crash case for deeply-nested HTML mail. * server: cure a mysql wait phase during shutdown. * server: cure a crash when the SQL server has shut down. * daemons: avoid deadlock during signal handling. * libserver: fix use-after-free and crash on shutdown. * Various null deref warnings from clang --analyze were fixed. * libserver: resolve memory leak of MYSQL objects.- Update to release 10.0.3 * Enhancements: * server: new config directive request_log_method and request_log_file. * server: The log_level=0x100000 bit (SOAP) no longer has a meaning; use the request_log_file mechanism instead.- Update to release 10.0.2 * dagent: add processing time stats and publish via surveyclient * common: fix a malloc/delete[] mismatch in kc_utf8_to_punyaddr * Respect KOPANO_SOCKET environment variable in all programs * server: support numeric UID/GID for local_admin_users directive * daemons: support numeric UID/GID for run_as_* directives- Update to release 10.0.1 * common: avoid computing log messages that will not get shown [KC-1674] * freebusy: fix crash in RecurrenceState::Exception instantiation * client: IDN support [KC-1659] * In config files, fractional values can now be used for sizes ("0.5G").- Update to release 9.0.2 * Enhancements: * storeadm: print entity types in orphan list [KC-718] * client: improve dreaded "gsoap connect: ()" reporting * server: fix dreaded "SSL_accept: (null)" reporting * ECtools: add kopano-vcfimport * Fixes: * client: resolve rogue file descriptor closing [KC-1397, KC-1462, KC-1518, KC-1584, KS-42330, KS-43193, KS-43409, KS-43618, KS-43677, KS-43693, KS-43907, KS-43925, KS-43936] * dagent: resolve crash when appointment has empty organizer [KC-1637] * spooler: regard redirected messages as having recipients [KC-1638]- Drop chown calls from scriptlets [boo#1154309]- Update to release 8.7.85 * daemons: support "%xxx"-style interface identifiers in bindspecs (the "server_listen" or similarly-named directives in .cfg files) * client: send fewer logoff calls [KC-1590] * daemons: AF_LOCAL sockets were erroneously owned by root rather than run_as_user [KC-1616] * pyko: avoid circular strong reference from notification to store [KC-1572] * php: add missing successful return value for zif_mapi_vcfstomapi [KC-1487] * client: unbreak translation of newly created store folder names [KC-1607] * dagent: the server_bind_intf option is removed in favor of %xxx * search: put back the old value for limit_results=1000- Update to release 8.7.84 * server: new installations will use files_v2 by default [KC-567] * icalmapi: vCard 4.0 (RFC 6350) is now emitted * kopano-set-oof has been removed; use `kopano-oof` instead [KC-981] * kopano-localize-folders has been removed; use `kopano-storeadm -Y` instead * admin: the --mr-process option has been added * dbadm: the "populate" action has been added * daemons: the {pop3,imap,etc.}_listen directives can now take an interface specifier similar to ping(8), e.g. "%eth0" * server/ldapplugin: LDAP group membership cache [KC-1588]- Update to release 8.7.83 * libserver: fix "withholding" of properties from clients [KC-1547] * dagent, spooler: threaded more is enabled by default now [KC-1475] * ldapplugin: 22% speedup in retriving the entire user list [KC-1399] * client: enable write-caching for properties on stores and folders; improves e.g. store creation time by 17% [KC-1585] * Dropped Python2 and PHP5 support- Update to new upstream release 8.7.3 * Fixes: * dagent: standard casing for RFC 5322 headers [KF-2100] * daemons: do not fail startup on IPv4-only systems [KC-1400] * Feed HTML through libtidy before using it for the to-plaintext conversion stage [KS-40722] * server: fix crash on shutdown [KF-2179] * server: address a potential crash due to type mismatch [KF-2151] * server: use utf8mb3 with mysql 5.1 [KC-1423] * server: avoid entering truncated tproperties data into the cache [KC-1417] * server: avoid using OpenLDAP-specific filters that 389-ds does not know about [KC-1402] * server: fixed TLS negotiation errors with openSSL 1.1.1 [KC-1439] * spooler: avoid unnecessary QP encoding in header fields [KC-1430] * spooler: fix hang on process termination [KC-1449] * srvadm: do not complain about default_store_locale [KC-1416] * dbadm: some long-running statements can now be run in parallel with the new -j option [KS-42617] * pyko: expand stubbed messages when dumping [KC-1159,KC-1168] * pyko: don't mix str/int busy statuses [KC-1433] * oof: fix erroneous -u parsing [KC-1425] * oof: make --message option set the right property [KC-1435] * server: complete utf8mb4->utf8 fallback for RHEL6 [KC-1423] * inetmapi: modified appointments need to produce a new Message-ID [KC-1458] * dagent: set Bcc/RecipMe flags appropriately [KC-319] * inetmapi: restore FQDN in Message-IDs [KC-1393] * inetmapi: parse fake "From:" header better to hinder proliferation of impersonations [KC-1350] * stats: print "PR_..." instead of proptag numbers [KC-1495] * server: no more unbounded thread number increase [KC-1446] * php: fix crash in zif_mapi_getprops [KC-1507] * Enhancements: * backup: do record outofoffice settings * php-ext: performance measurement log now contains a timestamp, thread identifier, and global monotonic counter. This can be used for estimating the achieved command rate.- Update to 8.7.0 stable git HEAD * dagent: standard casing for RFC 5322 headers [KF-2100] * daemons: do not fail startup on IPv4-only systems [KC-1400] * Feed HTML through libtidy before using it for the to-plaintext conversion stage [KS-40722] * server: fix crash on shutdown [KF-2179] * server: address a potential crash due to type mismatch [KF-2151] * server: use utf8mb3 with mysql 5.1 [KC-1423] * srvadm: do not complain about default_store_locale [KC-1416] * dbadm: some long-running statements can now be run in parallel with the new -j option [KS-42617] * pyko: expand stubbed messages when dumping [KC-1159,KC-1168]- Update to 8.7.0 stable * server: fix disappearing inbox rules [KC-1359] * kopano-dbadm: new action "usmp" and "usmp-charset" * server: no more automatic upgrade to utf8mb4, use `kopano-dbadm usmp` instead [KF-1394] * dagent: the spam_header_name was not matched correctly [KF-1961] * dagent/client/libserver: fix inadvertent AF_LOCAL->SSL redirect [KC-1368] * client: ABEIDs were parsed wrong (and it broke with gcc8) [KC-1386] * php7-ext: cease modifying potentially-immutable PHP variables [KC-1355]- Update to 8.7~beta release (8.6.90) * dagent, gateway, ical: modern socket specification in .cfg with lmtp_listen=, pop3_listen=, imap_listen=, ical_listen=, etc. * dagent: PF_LOCAL socket support for communicating with postfix * dagent: limited support for RFC 6531 (SMTPUTF8) * server: LDAP STARTTLS support for user backend * spooler: new config value log_raw_message=error * daemons: coredumps no longer rely on fs.suid_dumpable * server: support for Unicode supplemental plane (Emojis) * spooler: add copy_delegate_mails=move-to-rep config directive * kopano-ibrule: new utility for MAPI rules * server: experimental "files_v2" attachment storage * kopano-statsd: new daemon that records dagent/server/spooler statistics * This is an abridged list; there are more changes to configuration and behavior; see RELNOTES.txt in the "kopano-common" package for more details.- Update to new snapshot 8.6.7.2 * Fixes: * gateway, spooler: (re-)activate RFC 2047 header generation (Outlook is still unable to read the RFC 2231 headers that are generated normally) [KC-1226] * srvadm: make --purge-softdelete=0 work * Enhancements: * dagent: advertise 8BITMIME/RFC6152 support [KS-41452] * dagent/client: fixed broken umlauts in PR_EC_BODY_FILTERED when input was not UTF-8 [KC-1225]- Update to new upstream release 8.6.6 * ical: handle double quotes in Content-Type header * server: repair broken timing log messages for ldapplugin * php7-ext: cure stack corruption in mapi_vcftomapi * gateway: avoid uncaught exception when client disconnects midway * dagent: avoid always running into K-2383 * server: avoid SSL crash near ERR_clear_error on shutdown- Update to new upstream snapshot 8.6.2.25 * Fixes: * ical: handle double quotes in Content-Type header * Enhancements: * client: now emits warnings about own incomplete PR_RULES_DATA processing * inetmapi: now emits a warning when runtime vmime is too old * server: fewer stat calls to the attachment backend * Changes: * dagent: default for log_timestamp changed to "yes"- Update to new upstream snapshot 8.6.1.99 * Fixes: * Fix crash due to ODR violation * libserver: drop all remains of clientupdatestatus table * gateway: fix crash when new client immediately disconnects * mapi: avoid garbage at end of malformed RTF * Enhancements: * kopano-dbadm: new diagnostics program for offline database modification * kopano-server: allow use of --ignore-da to skip schema update that won't complete * build: support ICU 61 * propmap: expose kopanoHidden LDAP attribute as PR_EC_AB_HIDDEN * Changes: * daemons: disable SSL renegotiation for OpenSSL 1.1+ * server: invalid port strings are now rejected * client: quiesce verbose logon failure messages * boot: set default and UTF-8 locale for services- Update to new upstream release 8.6.1 * Fixes: * backup: ignore error when server cannot find attachments * server: search folders were not loaded on startup * monitor: handle absence of config file * dagent: do not treat -d option like -c was given * server: fix a case where an old kopano-server would refuse to start with a newer database even if --ignore-da was used * server: fix server/client getting slower when named properties are created multiple times [KC-1108] * client: fix data corruption when server returns high named property IDs [KC-1107] * Changes (generally requires admin action): * inetmapi: stop treating empty indexed_headers as "X-*" * dagent: cease indexing X-Headers by default * dagent: turn indexed_headers from a prefix list into an exact-match set * If you need certain e-mail headers copied into named properties, they MUST be explicitly listed _one by one_ in dagent.cfg:indexed_headers now. * Enhancements: * server: reorder SQL log messages so the error is shown first, and do say when the message was truncated- Update to new upstream release 8.6.0 * Enhancements: * spooler: rules support testing for out-of-office flag * kopano-spamd: new daemon for spam learning in Kopano/SpamAssasin * kopano-oof: new utility for Out Of Office * kopano-storeadm: new utility replacing the store functions of kopano-admin * daemons: added the --dump-config option * inetmapi: ensure all generated messages has a Message-ID * gateway: handle a zero-length PR_TRANSPORT_MESSAGE_HEADERS property as if it was absent * Changes: * gateway: generate Internet headers if missing * inetmapi: ensure all messages have a Message-Id- Update to new bugfix release 8.5.4 * server: emit log entry when LDAP is missing server info objects * spooler: avoid deadlock due to double mutex acquisition within one thread * php: mapi_icaltomapi did not copy the iCal recipients to the MAPI object * archiver had forgotten to create its SQL tables on first use * php: make ParseICal able to deduce organizer addresses * admin: --user-count failed to print user counts * server: fix broken cache handling for ICS bulk restriction matching * icalmapi: handle BDAY VCF and REV VCF property * libserver: restore PR_EMS_AB_HOME_MDB- Update to final tag 8.5.0 * libserver: store size for orphaned stores was reported incorrectly * client: have OpenEntry check for NULL entryids and entryids too short * dagent, client: fix nonfunctional HTML filter * common: switch logging to stderr when pipe dies * spooler: avoid printing garbage when non-worker child exits- Update to new upstream tag 8.4.91 (RC) * Enhancements: * server: new "server_listen" directive replacing "server_bind" * server: stronger keep-alive * server: further general performance improvements * server: update PR_LOCAL_COMMIT_MAX on hard-deletes * server: speed up contact and search folder querying * server: skip some unnecessary attachment accesses * spooler: introduce indexed_headers config directive * search: pass "limit_results" to xapian to improve performance * search: optionally index draft folders * unixplugin: support multiple non_login_shells * unixplugin: add /sbin/nologin as a non_login_shell (new installs only) * gateway: RFC 6154 support * kopano-spamd: new program * icalmapi: support URL, NICKNAME, PRODID in vcards * Fixes: * gateway: generate envelope using inetmapi if not present yet * spooler: only evaluate rules that are explicitly enabled using PR_RULE_STATE * Changes: * /etc/kopano is no longer prepopulated, create .cfg manually if you need to override anything * server: remove support for upgrading databases older than ZCP 7.2 * gateway: use threaded mode for reduced memory usage on many-user systems (new installs only) * gateway: the "imap_store_rfc822" config directive is removed * server: the "counter_reset" config directive is removed * spooler: the "always_send_utf8" config directive is removed- Add 0001-build-fix-build-error-w.r.t.-gettimeofday.patch- Replace references to /var/adm/fillup-templates with new %_fillupdir macro (boo#1069468)- Update to bugfix snapshot 8.4.4 * common: fix detection of local connections that need not use zlib compression * libserver: improve ECICS error reporting * dagent: reenable automated backtraces when invoked with -f * php5-ext: fix positive retval setting in error case * dagent: redirect rule led to crash * inetmapi: overwrite recipients instead of appending- Update to bugfix release 8.4.2 * server: revert NO_UNSIGNED_SUBTRACTIONS edit- Update to bugfix release 8.4.1 * inetmapi: handle empty/invalid Sender in RFC2822 mails * spooler: for send-later mails, check trash, not outbox- Update to new upstream release 8.4.0 * dagent, gateway: whitelist-based HTML filter * provider: speed up getIDsFromNames by reducing SQL queries * client: speedup from-scratch MAPI session creation by avoiding extraneous logon-logoff cycles during provider initialization * client: add API for dump+restore of MAPI session profile data so libmapi users can skip provider reinitialization at program startup * mapi: disable very slow RTF compression * server: add entry cache for S3 backend * icalmapi: handle up to three email addresses in a vcard * icalmapi: support ADR, ORG, TITLE tags in VCF files * backup: save and restore store-level ACLs * backup: merge store-level metadata- Add Requires for kopano-migration-imap [boo#1055939]- Update to new bugfix snapshot 8.3.3~24 * server: fix disabling of shared reminders [KC-728]- Update to new bugfix snapshot 8.3.3~22 * gateway: trim CRLF from PR_EC_IMAP_BODY{,STRUCTURE} and make Apple Mail client work again [KC-668, KC-720] * server: disallow empty value for embedded_attachment_limit and depth counting error [KC-745] * common: fix incorrect timeout check in scheduler which had disabled softdeletes [KC-638] * server: disable reminders from shared stores [KC-758] * catch pointer underflows / NULL pointers [KC-694, KC-60, KC-177, KC-355, KC-378, KC-379, KC-669, KC-754] * libserver: avoid creating multi-stream gzip files [KC-104, KC-304, KC-597]- Update to new bugfix release 8.3.1 * inetmapi: do not force HTML when use_tnef is set to minimal [KC-664] * spooler: avoid a use-after-free, and a deadlock after this failure [KC-588] * server: avoid unchecked return value and unsigned underflow [KC-656] * php: rework pointer value storing * daemons: call initgroups when switching user and don't fall over [KC-684,KC-690] - Update to new bugfix release 8.3.2 * gateway: fix an IMAP protocol error [KC-668] Apple Mail/Alpine did not show mails with long encoded subjects * common: restore ability to output crashdump [KC-630] * inetmapi: avoid short allocation on group expansion [KC-388,KC-727]- Update to new upstream release 8.3 * Enhancements: * migration-pst: call SaveChanges only once [KC-534] * Fixes: * caldav: avoid a nullptr dereference [KC-236] * cachestat: avoid exception and unpack tuple [KC-402] * ldapplugin: revert "catch empty ldap_search_base" [KC-602] * spooler: fix crash on forwarding rules [KC-608]- Update to snapshot 8.3.0~1007 * Enhancements: * gateway: optimize LIST, SELECT, STATUS [KC-490] * icalmapi: VCF conversion [KC-420] * Fixes: * migration-pst: skip root folder more intelligently [KC-487] * migration-pst: MV properties are handled better [KC-457] * client: add extra checks for EID sizes [KC-500] * gateway: enforce user and password checking on local socket [KC-396,KC-490] * Changes: * migration-pst: ignore decode errors [KC-521] * common: fix empty text bodies when converting U+0000 from HTML [KC-557] * icalmapi: reworked copying description into mail body [KC-568]- Build-fix include of kopano-migration-imap- Update to snapshot 8.3.0~694 * migration-pst: skip root folder without hard-coded name check * client: add extra checks for EID sizes to CompareEntryIDs * php-ext: use /usr/share/kopano/php for mapi classes- Update to snapshot 8.3.0~667 * Changes: * server: make softdelete_lifetime config setting a reloadable property [KC-472] * icalmapi: handle missing timezone for RRULE [KC-414] * migration-pst: filter metadata at start of subject [KC-424]- Update to snapshot 8.3.0~334 * Enhancements: * gateway, server: reload SSL certificates on SIGHUP [KC-301] * dagent: log_raw_message option can now be used selectively on users [KC-370] * Fixes: * gateway: report missing attachments over IMAP better [KC-436] * inetmapi: avoid overzealously generating winmail.dat [KC-348] * common: fix spurious crash in sk_SSL_COMP_free on shutdown [KC-443] * backup: improved logging when ACL does not resolve to user/group [KC-431] * migration-pst: show usage, not traceback, for invalid options [KC-372] * inetmapi: avoid buffer overread on rejected recipients (showed garbage in logs) [KC-398] * Changes: * server: compressed attachments now get the same permissions as uncompressed ones [KC-380] * backup: maintain deleted folders and add --purge N option [KC-376]- Update to 8.3 snapshot 223 * Enhancements: * mapi: drop global lock and replace singleton allocmore table by per-object vectors [KC-328] * swig: expose group and company properties in Python [KC-320] * xapian-compact.py: new -c option to specify config file [KC-205] * utils: support setting out-of-office without an until-date [KC-275] * Fixes: * pyko: do not throw backtraces on log messages [KC-340] * server: S3 object sizes were shown wrongly [KC-351] * inetmapi: do not always generate winmail.dat [KC-348] * icalmapi: timezone search was broken [KC-313] * The RTF encoder incorrectly produced paragraphs where it should have created linefeeds [KC-338] * The RTF decoder failed to see that \uXXXX could start a paragraph [KC-338] * The RTF decoder erroneously created a new paragraph on \pard [KC-338] * server: Ctrl-C now works in gdb [KC-171] * inetmapi: avoid an infinite recursion on SMIME handling [KC-366] * ics: make creation of new syncids work incrementally [KC-208] * libserver: change incorrect compare operator for EID_V0 [KC-365] * Of special mention: * search: python3 support (but requires new python-xapian and, as a result, a db migration or full reindexing) * Developer/packager notes: * KC variables and functions now live in the KC:: C++ namespace [KC-369]- Update to 8.2 snapshot 451 * == Fixes == * dagent: iCal descriptions caused wrong body parts to be displayed [KC-138] * dagent: mr-process failed to copy attachments to the calendar item [KC-202] * dagent: restore/rework forced ASCII charset upgrade [KC-294] * == Enhancements == * kopano-stats: bind 'q' key to exit as well [KC-105] * presence: log authentication errors * Improved PHP7 support [*,KC-330] * == Changes == * search: log to file (if set) instead of stdout [KC-204] * search: treat '_' as a word break [KC-290] * swig: resolve crash when python programs end [KC-269] * config: change ldap_object_search_filter for WebApp to be able to search by mail address [KC-337] * gateway/client: avoid resynchronizing RTF body content [KC-338]- Update to 8.2 snapshot 397 * == Fixes == * backup: avoid exceptions on problematic rules/ACLs/delegates [KC-213,KC-266] * The comment for server.cfg's "disabled_features" was wrong [KC-262] * php: fix crash by adding missing pointer type conversions [KC-274] * dagent: the "Received" debugging header had the wrong target address * gateway: do not emit an X-Mailer field when retrieving mail [KC-277] * server/ldap: report empty ldap_search_base setting * client: verify peer's SSL certificate name [KC-156] * admin: support unwrapping "default:" type URLs [KC-289] * backup: fix tracebacks when used with ZCP [KC-306,KC-307,KC-308] * server: implement missing readback of compressed attachments [KC-285] * search: add script for findroot upgrade [KC-300] * php: ICS import/export functions [KC-302] * server: AWS4-HMAC-SHA256 support for S3 [KC-170] * pyko: permit "public@company" syntax to specify stores [KC-317] * dagent: new AUTORESPOND_BCC option for use with OOF [KC-319] * == Enhancements == * PST importer [KC-59] * Python 3 support [KC-48,KC-267] * search: files are now compacted, and their uid/gid checked [KC-188] * server: allow search folder creation outside of own store [KC-271] * dagent: forwarding by rule can be restricted with a whitelist [KC-109] * == Changes == * Non-Delivery Reports now originate from "Mail Delivery System" (like postfix) instead of yourself [KC-309] * Support for building with a no-SSLv2 OpenSSL 1.1. [KC-230] If you run such a setup, be aware that a config setting like "ssl_protocol = !SSLv2" in one or more of kopano-{server,gateway,ical}.cfg can inhibit the process from starting. * Cleanup of the example LDAP configuration files. [KC-229] /usr/share/doc/kopano/example-configs/ now has just a ldap.cfg, and no more ldap{,ms}.{active-directory,ldap}.cfg. * The example LDAP config file now has a different proposed value for ldap_object_search_filter for OpenLDAP. [KC-218] * spooler: messages with reminder will be sent with a TNEF copy [KC-152] * admin: group features will no longer be shown [KC-239]/bin/sh/bin/sh/bin/sh/bin/sh/bin/shs390p21 161567822910.0.5-bp153.1.2510.0.5-bp153.1.25kopano-spooler.servicekopano-spoolerkopanoexample-configspooler.cfgkopano-spooler.cfg.5.gzkopano-spooler.8.gzkopano/usr/lib/systemd/system//usr/sbin//usr/share/doc/packages//usr/share/doc/packages/kopano//usr/share/doc/packages/kopano/example-config//usr/share/man/man5//usr/share/man/man8//var/log/-fmessage-length=0 -grecord-gcc-switches -O2 -Wall -D_FORTIFY_SOURCE=2 -fstack-protector-strong -funwind-tables -fasynchronous-unwind-tables -fstack-clash-protectionobs://build.opensuse.org/openSUSE:Backports:SLE-15-SP3/standard/9967ad34b0d2feac827c73925a4d2402-kopanocpioxz5s390x-suse-linuxASCII textELF 64-bit MSB shared object, IBM S/390, version 1 (SYSV), dynamically linked, interpreter /lib/ld64.so.1, BuildID[sha1]=e6edbf4225b9d719a35bf352bd0ce217266bf64f, for GNU/Linux 3.2.0, not strippeddirectorytroff or preprocessor input, ASCII text, with very long lines (gzip compressed data, max compression, from Unix)troff or preprocessor input, ASCII text (gzip compressed data, max compression, from Unix)RR RRRRRR%R"R&R R$RR!RRR#RRRR R RRRRRR RR Rg48N"m1libkcpyplug010.0.5utf-831a18c1a701845f5974156f512f5529fe818cf5023a5e53b1f7c9aac9b8e6403?7zXZ !t/v] crv(vX0ǔ%Z^|{"^^_+9bb֘[`*.&v`;swƏw'([Ʇ5QKV'xF*PK=4mQ,Kq\c~U;HggpAsխOd%~|pNlX?="DZrVM)R:d {T2߱`*i2qMdp4ZK]!+0d1)[!n:[1=C"( {FD5lyjvwn+PIRh` TYqM-(ʢtgVanՑSi+3#TkY~#p$AGV--^˵*q3BL{b\s ?tѕ$WRjtQ  ).ȯ{ln ($܊Wa33Tμӷ}J\Y VE #V䆏nyNNX׃jjTamd O#|X gzGP=dg)#hV/Ә'#}f;"YyEldtjElK!YK¿,sc_aFZKݞ>SmsJЏ@^MDdu<2,5'ʼn^A"Wsd-=BHJ ܄zb*ʙ3|'I >{S i/fQTtL~d%'9"i8HRo JDxtĸi5 O*GquSN07*t[(@KBN\[~PML3>Nzbl, o~t'ջBjRDoLAuIqk1!Ȃd=]bF5C@!_)&Tɮ8s`H1v.-'$H3^?xgjhds~asUGJ:+#+*~кgz}"kC :gjv%7U-{I-_&焬'DQ;1q8-{ͻ.'|S u>ϧ.Om+-{*EM1{ (_w v D_s$>cu͌D0uEa-QYz*0o 2cm8BLus78*`^)ܩP>.ŋXc͐w1>b`(> -x7MU,ywm;``8ѳ+B+VЯ!iDKsxK/RfBQ h/]iS ! iG:+DBOڒQzbttX$*F@q^GI}/,\LGZ$ZY*7(s4R '6_IXi=|5ݤ8bgv#w"y?$6f`55-l3t)Z+C KB={k,; nȰ2^myM+ShUKABY[T (ZS@ 3z%ޫs%ÏPa[f,,_v;R+VK$J w`<}lܨh?t3A ٙƛ>1qNrV5B1Y@j' \[XaEFW O*цi414uW}  lO0A(L8|HJ&cXrGڞNx}/K 5h¿Ֆ F6WҼT ͢7B{~9n D|K sUYF_"y9%vxyԃ7Ԩ]P VqX ˟VHYp4'd` >JYm=|1 rL3"]3$E:B0T(2yEC8F#0 ryL]Fi6Fb4g!uT)N:ڽ.̓dz H诶@J^У$*1H9.b߉|Ed7!Zߵև[UIz-0pqz0p{/b%:Af0m7V=.}p跆V[虇jYMcМ#zܞэaO:;}>qx>+qᄴǚx&oHTMвՀʕLAj3õ!wh-r~rMB:OMsKWMOyjͼ`~; g8ڮgZ% )2)#gNcXRq{+UC1F"ݬBS(]儥jhYZUV=fsKeYrU!/ZP){8{vKcG?]$D|H_181K33pLM0`6EV55D!#9ʥ|ZRp|,P0P.*DJ#?jq/0\UE30;gV Γ^ӾQdN^AL8Z҅ X"λviv/f>y/=4ȇUM3ōǯơcx< W5p:ڿK*l;rU@!ob>d\XIm:A{:E@$0A"'-4t/#Fmb; eq"A=utO^.7c ~ dth[hj(rp-X術Whu.c]5숍IT],Σ)0Tj/Y#!EW=DQVs>GN4j/aF˛Xy_BWYgZ4ɾgm7V4`wWVT;<~5NT9]92sYo|OҺR߽ƹl!^>Eub3##V&L\ ɰmP"c 2Jx1xȷ#s-c.Goct2 i?zOVs(m:;8` d+1=ӳEB R(" Ί3jRW/@8S+aZ>ݮLahB$6nyƣ^ORZt;6ܼkǁd'״Rq1z!_D䤦XA!#'`Uܷ.e:5Q+y Z4BJ$/Tu}FoXru}vYR&Or֩N6&3UnG(A<2GdIוP6oбiB\mp`Pʑc^sӃE .asRmT/?tK`cjC~rqYNycjcES~5`1b,G24xEpҭu~me@RDWC Ӡ5;vNǟX%O=,}ÛY[Gष w9Cbz:c!0Lg! \HconDEG w5f_H;:8.<2" NU]Xlzhiw 0cv'H`X[ZxlZSHltB3Z\tuy ]?amBeۉ1>6 QNLdM@0"9/z.&$۳(SJ0mpr R [29ɬ 2@6e7TpHmrQ0%w U`:S'15e* $6cf>ʕxe=\WNvŭTXQ6QdL['WO0ai#%A&UK&SK:V>A'3k 3.sPXD Qf CBJ/ .ÃhZ9pkH>͙S046~8?A(ht\7}F$Y~#a8Z=b/eq?LW嶝3?g| 5}1Iq£ H@ >l. lDBр~ +w޿IIץ|tC ᩝ`gAed(A6>{XF)}=;fA^bT\@L.!P)эݼ|Kh&]sMgDâJ'zVn᳤F~PRtsuSآ ^qPңU&C JAf*&r9P6!(\lPX a/NeRܗhr7xxuVjesu|0 VVn[1o#a ͭ`BV4w.02-Ɣ0 }mR)Xs0۟ԤUK ! S[YG*{Z_@@bxo\B&BT~)sW :q_=Vh5|6q{Db0 ug 7[НNbe}%M S͋+tT_ŋ?q(0^*p W ͠A]g荫~#zmiD؀~lܓ`;_ߖnnyJXI{L>~1X"zuٹUF ;9Ŋ۸ Q=2]Т@&Vdطq.+ t:*+!ab+g.ҽQe~hइ9hl>EQUyZX\U{Icc 3cIJ|) ~kAw㥹̍ Dߺ+9(3, O;KU*FM Fjq[ʭhtJeN~ݫth:7]"cAd7};f_Hs}{v߱q@7(͖~ $z-p:J9d5ic(Z1>q} '0ÔǍ2|88NQ(hvKDQq#3F9 =/:116ҰCꀱΔ5zX_4ci Pә(La~8p@o :qz ?l`Rr*_.3Kp=[,H඲#S8P0,UI@6ЊnZ} N~{OTHuѐ\4_F^ /Ԁ-v"oJr3c񔬣_-Enm< @ vx)n$ӌ ,?C .#** Sj4YHcd]YDZٙVk ] GzI*GE3X+#iiη=DnP4n\kj6qѺb Z4GdԙvvH z24 r7.n=8,kڦ̔lFOTQ6ǕCM~z1z,j :3v!]?( o[."A&9TwsD,ˉHs9KK@r}fv.C.ݵ v"'`H&c7;o#_ZГ\QUfifB&/֔\fw9KPӋ$8bcYsZVߌ>q&՗M{\Πyt1E,_=M[oǚhϫE}[EuؖJ4Pw}^ ?^u2\ؠ3RhcO:r2-;@= 8m_ݰޜ"G,8;XӜ "OTb7lre2٬6>(KuF]nX&T̰+ , --RpǡT_<7F$1_rƁQ.?vb^xb+EB/KI6v!h2d1Ld:@oj}{Df[F+xJ4sS@]kC-7w w/_]=\]}x05 =wcuCg-/ >wLtb$>SN&'kʽҳ-ұ)eF #}ܻwmBe,BώWaQ+66Vl<<{TV%nOեFB6Aȉ2َGVSՑR >/!P}3!'Cya(νøgX7= ѿT"/y -:+⼹Xka8Mr*c^Ѱ]畩F*x6FB aXw6H~$V>CHɢ0J!uQ shz3?XM{*\މn597~q#27iadx1?Rд" RS2*g?^pXjZ+[E[#ߞͳC f xos[w̒OᱵcmmȨ!e^"3mu~_x!Y)2ņ3}Aӭiݎ1rL9C@֞t6Թ4bˏ646q$v6u}n7TړX L! s  (d9A}ZĶX-N>1l6ZSԈ]JbDЏGH18n8Sy?E~awDOk >yÈ/fƕ5#ЖU|=\+ قO^Š DƬvx.&LB1<*%lx<>^5B^+91>rHɴo8(*tz^%Pz2ǷZ5daWu76idXi Hc|\ H@VTu:o7!/&rRYȏsksқs{'i׺G_Q(GHѸ^G!Q>NP] 6/:;Xe_ Q$(ΊfbJh)9f+S=9HC{WwFM(S8SYߨDt,[D2_K훏5exZ:!TQNX߸utJ9:1?KNybm?ٻ?DJV6!YT1PrF89O _ghѶt/c5|EHpl %{P mdvRr ɐ-{m*/n0̊ n|l`M^.mxҠ]x$"u»2^Ɗ@'qYmcNچ9ݜGS6UD/y|HHC~jZoVyPߥn!W,)^Ս?Gk`8%/g3Dt$*8Ifzèe?-[V4 b s5HEQ{xWcI/^9yjHζ]uݐ0rmuT!P_nr#:y3 ]ߑU|2DXAh7 Bȧ;FFfS{^FjJql̵`eE ? y%SA<' V@Ce8/0ֿxH܋Gmv^=/(FKbA.sf: T@/yq>J1"rL'L[ܨkR%^}lx4K&\L0 5FiVEK{mKvNkɹA7:UA:rẺLx.3mrğ*ˋ TmqPF-^YZ}"7W*:Ѿs%T٭Rx)Y;B 3E]VW5ZđOJC߲%ځ T`kL[f]([z t˄`Pg;m]&O 2Si4Z)[˻gA"ѣ&Ȭs +δn >|EV(8]KW G_0yn6EIfSB=t+u!u,W=geFLаFLhvRs6(U$مR4KFi>f$[^4FnJyRO( I }II(J9"n_2sīzC"HZ?1ֵR^BPr;VX}j3o5L6Ԅj%Il+ʪ j,/M t=B0>l>;\Ldlq.jseu{KeAdjm"d|'sNe76BeAӰ4Q\hl _e舄|;> #uJ8tۼ41g^L(d|]2dpfW4br 4ŅO: [iiTYD2bv~;EJT8b++Tt7y #M>uI"Kv~ $oy| ，nN`$<8n;S?<>|/^n+w{NcAozނFa7ZX̀sw^*pϖr,741DASD`IqHU`pE$"Epb>NX/A)6"o%F ޒKixJ#KZZGZs;Ɨa|P G28pȻEϮ`n9v{rꬭJ{Gas4!7!3;o%+8HDM:l5z;x5%%.xH#aU{”adC6b9iP-+}t /CU+2O1S9 lSl iCQ C&0'6B`]TA6l>;4ɅTA#AKKJ7 7?AI88pPm;Σ i'."\(X*2 '[}zGj_12E"Ha-zUrâW>FGjFYآo .*|12Y]Sr^Q`y]{j!P<v`AD> ( [fU%b_rCA٠fJKvLUe)it%5'IjgG:3= jOOsDU@L"%ZPq=c-Yh33#AyF]axb:OzibTcWPbuq.*%$*.;q"4Xq)(Po!C*ӚKqeEϧbIQ 19(֦U!ש JL2$˗?f^zm +Ǣf5k@`ShQ W#Z?CgkǢ@ME>O@S 'Jf$Xc:d}5IC?Sa,~ˑ &wTq$YV"kGԫ(],; Cv'=B?8f Rh$^jU3"3-'Ӳys l#JϼovcM9O3*ް2ow!ˉ6-]"Dh{h;",A҉_Q\s?*4]\po_LOBIGt-{>ҲyiJTn -`VaY߹:=s$py@>繞33T#v>l 5X", R3HTלX/+-&MB O}DHnʪ!$pq x'kg],G *0^a(o ߥ> \('e3T4g A_ SR^Gh66eI NNIWr%YJ`p^U`p]xt`Bo.=JVa`zPRx!79ZC6lb`DHc6x䜼f r.`bA#_7X&Q~I v&Pd=t=@,cTYl!ȤȢgȚӻx#\sX_{ qi1a3DbVj0yْۡ/we'p )jAQvD(^-|嶝}N;bfwc٭y5ܺ:5/e\;+]iFʒs5-\},I~D:O%56dNN#= e({dM__.gU5|jZLDxU7o< 6h[ߌ`-J.zoi]}v%F)L`<-$A(ËTYJ eR5?dhfb>F:=p~U9/W|aeÍ4@^.q7:1~Rē;s+SR$Up {-u*;q @;HqEM&ݿM/)f",E 9yb18啽7OD#˖5> Y¾B[(pp #b0i.×}f:w:G.QZi%B%RCmC ض}5K$/˿橗,.eUʕ ̸`Pq TTQQljQ ٽ2.tW$1 3G!.Ilc H8Ur'W[Q\ܠH:_nC3 -\rX# ,:<e Z%3 1;P!O!P]▨%3QCڤ$^\p N4߯]"QEBP֜fɸWaLB.,o8n䒜zp$M(.fBǝ޺1ƦHaqZ+FGCJ\B<"U S(>X>J孎l)O,<(hmВ`)ZƖ@ 5+! ȵ n~MeN3IN=q:~A5gg਺y|=3hRHyZՈG}aynʹE4{6JĿSA ҙ=o h5p&-dn(aqeVrLc'"[Z 0L 㢔K4^n9@iG\@_c&ֹH #w[%ȥ4|>rz7?4c£|S\A`vUKO`Ykٸx|rC6= GHlwx?[.ӱ'!PQa=)xe%~LBxG1+)Kx6?? 9ٮ=*ZFCx CGoaY{y_BPZ9Ϻ5 \7g.>G 0P lm98a* AP?c&ī)}çZW$t~ T͎cG 0g˖1 Bɶ+nC)VՄ[=i.#>zO5C\3'ߓ9'f-6 H3>} 7|ƪ~NRGPR@EHf 2/E+Xzotss#%=dZ88T!vuS}~FURr 6IXNasZ>.g^$,Zen8!6q!yv}GB%W!!yմYjP D> !y|,-n7}!LP!bDmfk9SW{|O{F2u7t\E?<;To6o8)J Q_fʢXr6VE.epl-63bw|i=nx8|mC|LBI 7zhx-^[דuJ׉q9h7 h sYAjMkKi}s5 TL+&gG&za2,H {+ξ\on#kdgdμ՗a`: 2>Y<99ͣ {!1!0./2hǗg ?eWa%/_l`\YeX-kZTWu޴?HnrhG \]QTGXwGqlcMƇjhG!/l'֎ ^:!Jcjo1T1d</-&mI -jLzd6Z~9m;BZ am 3n!YAk4gϔkB_ɰ:H |j6* .&砡];_dT3N ;҇ 6o}kuI"& QaI<MT9KVY B:WLް Tދ[Zf]86.Q*9no]XǞOȔώ@*`]yFA=RW!)ؠrKU?+Y^LNX j܀f#n! I~ #9 / ɣ;@zgN2[Licp59S8}mT9E͡,þ9ß+;A%(,7O2"hbE=˓W:}ݮvVZ>wJ4S9,ɮ2^ߺ:W1< j <%Is5lA+qr(_&1zHDD20K3d.ܶ͟jf C(pM}!'#`(/kHTh\I?ݹj+Uܥ/;8eF|޴wB'I*R:>V[#"W: [MJ`Ǧ&&p%(kiMu놹c-|/[yìTH{niޜAwn@PP/6}d}+:xf|d;0tnFh)m*NɯcGJc|"[ȩ= ZGٻΚ۾vBsJH8ŅZ:vqsu1}G? } Q{qܭMwN hBvEVSm e 5$ T~yf,S0m.(,S 55J&襺zcw2𴰮P-Ѳ@<=9|6Sj;sTADU\`Ok%vBz yYzb,?"FQMOUg\Fmi'W>'.L"dLY"M%&9h#Ͳ5PBi;\؀cH 0lhfb($-M>00"'0ݗɭz7੏Z+ T63w87<8t4eXMu??(B AX ~u *-YA/ 2AYW3%Í6Ʋ1UC1e _vx᠑r"Ik۵eW3~L"B_)1zE/,#l;3!muy;6WZ9\yiJ~,\EDVJU-Hl)XJϒ3=!@9e4ÇIYir>#z5!CxcH䲰>L1J9z5 (7Ʈ╸ZA$TF'i~Q_I3bMmyWsH"'|\9ILM/^a;ʼFWjGm 6 Qn_>u3]=G@vFk{~nWbiTЇbŋo-A#*,F&EˣjbCI(6bB;ְ_f:JkVdgt*3IXI3bq v9QSOjUY˶I=JMEP5rs1M6_I*A@bL'_ %R9&0Rb `4T8>}rP|OCz,EK^443S߰#/Cܳ, m@a'8huPp#Y1uF5'mYe2Y[%'CD*:AЦVoٍUY\/tm<?*L9{̑\'-fuSG xZ6X38~w?v̷Yq85;bJLL+Nh`[KY*o+S}tR2%޲]:{pjDN{zGmGhW+N.{$*Qmp]e;5/zUeW@^0J#Q%tod,fJfi=@]Rn'"6$g>LŒNϣ3]Y5h60ft$~@ӾN 6N[ li{W7-|@{=Ǝ ͑Ǘ좥,)}`llR"+:0fuWej蘬DbEK ƕ9mI- PrgAcK\)X"~fV\kF勤'0\Q6658Ph(Gް1WI>+3RNԃ]M^@6y8 y'YY/DHf<\ӗPpR8oqz'!us9:w`.s]#kkbYlO Y{0FEޅ%To{M-0M =}_@e,zXƑjʠ+"w洺¥$< `ɜkbⷾ) 0+U5*Ӵ{,:C(ut)6TbJ%䥜\HdV@I٨èeAOOK?ґ\p* hn 8ZCQAB՛#zYղZdCMS˭I=*>fz *ff UbHgB" ?.5<3i$rm[߅b8 c^݉oLݥ8 {1= Q`/vuX%;Ά w ]T/wH~Y,iohRYJ!x7`ҙPw^э<@ى2'Wpo~6VpM ꯹ٟuPz'q%Ϊ^JadE5(-/ݢmuTYڢH>%@~q7xɧ{QM1g[$ ) ;&;[Y:yɔRx^ pԭ>0yf0o7mCsk-1/2!-|>9WeÀڊB~<[o*Εa \.954X jQ'T&#.@$4). cXW"lIhaRTHD:νgMۚ*sڛ`t 6N!;T+jQb;]kh;s5p?@JTV֞͑6)![y 9tرՒhaeJ7 BL=H3@\X#G},W'-  =zOJ4]G.Dc_KErFהI'-u%O^)=6]//x-Ӊ0+ ѐ.rrn/ 9$BCe|CF~IC0@7~ŵlkzΫocIox6 E8 9f4'Q ˂6h ~%'9KB3EkWrTP*bjo]hk Y>UPsD.03 ` O˾WP*~܋g:NeϿM%YPnDOG6;wlcpA_Ʒ/=zF&X" ysK߈;H!O9~5f֗^mstC;/w*6'gDIV$ս''\aΪz !{mde+;Ki!ĸT®5J=˰|[e7;"*P9Ä~o/Bq#gЪd wǗbǁ\[ǒ_Ip }F1VWq2~1HRv .> *M@wf)B-%Yyvg0in4,s+$BnT$kDu{>v5aVO`;(r%{bW1Fy9ن$wn(ٻ*BɷP0eS/lޫ;s q P<-"5?Ɉ6bWkk*$A\ `|69ol >!RlOՊ'%;!l~ʗ:m;nyݻo2@ЊQ>j(H6xꅞwoN??n '%t9BSlj/u"V o %:"RdhH_MA䭃/C'آx-Pey$}$"9 t/*bYNDmĊ8b3GL{n16ۺfCSN/wy$bEJѷ$~Y# 7%.GlzhbYVƒ WV䜰RbIE =,قkzb2FRԧX+aـg }߫e؃z146;zY2bP  X5@-Ϫ`us096-UJ;עA- ف&f{n/e*GϙvbXgGa?ѥi.w1qμjLjmgܥ x$6]u]ՌYڞAùrQvn0:v.$'–YFX7=@,PSqqV.Lm q %K>'{Thd$/[9!04)aYM }->Ω<ŗ7\׾Ak|D`֣-)u1]ǎ~J&W&NvKN # 6}F7oE7>+67=MztD3'ʄM_4L(KWgQeo@L EZS[,g/ɁFWu`|T$OᾈHu: 6qhƕ j^ ̢F/e>*l" _̞ZIe3mh7LfjQ0]&)nrN_e\ٯdn+a: ڂw`!Q͗#ثWXa322L7ndA165ΆM{*p͸\wd70*@D >MpkM#n9.Vv 6O/S8]>BDYA,Ff$*h84r϶-o sF>F(̹NjªgKpUWt#2|5]AY+Z<˱# S*֐7JFTj#tAOQw(0p}SnӼ7{mf(" t_*#D=dzU U,''U%Z8_ "<4ES00)4v K7V~/JKߏ,}|jTC"d!T˚}'jq6pS/KtJb)a&GZ0hi֜n"cGw+@pU8^Z*=H3bÝU@4PӘ"&BtK""P64NkKS䮷xq!tO^ƺ-7|s3p:ۊ̂pcې!L su C,J1 W11ͽ0j:KS8J@|R ֙ZG!Jqzk'(X rv+#D1tL# )9v@M95 φ٫mpb/, GX(p--,RxÚ3;[5NJ$N'ehjtg"ƨ x~H*9l(lJ9vYCѾ9S3G_ټ#7ؙs"1VHFukX#{q?i²I?pO]Da|Ʀ}P rL[{=+N^d8OvzҤ,߷I XZAT9%H@p=Ef|i5&#A;q! Žni~|\\{7dћ# \9 ˀe oPiKR튾CThQ2XZm: D;9j@-V&)a=Vȶ7AA J{Eun$+|D-䈍JyBN Dh W]s0ju=Af%Z+cZ%fSfk&Pk|/lK~3AƗ^QsFncz ]urNG&eGoX?#VK-ןumk*@* /?0>%_[{o.}(*Fv4!5-S܁k^مiizs-t)x9l5Z꼒|4?G!Fvb;.~P6 =IMTtKL;Qr%$)G+I˭c]+J c~a| GSX@}6P[SI8$c'ӕݺ@bit'e+8nf ?! ös`+Q`?;&t΀_T+]_U$qMKx O-8|r[Xb+`bOf LWrAI}fq4V_)tĦs+auS{TV/X5O^XV6ʨaı&8c7˪nO6pc5 c& q'tߍMrT# np{fЕy~ݣJ/ 7GǞmtXa<:̷ y6dtz8p:;zA\qɵ*fFJ) hr߷l(ee鉺ы=ߠ9|f0M (fkd_EX%p13PcP5{T}F}[KB0><78rf]8S`?#`lg̋B:(ut ]y^ƼW"z=Kx81Ŭ2C0O e2o*u63`~'CGE {N-AIHF'iB?>5R_( R)TiԱcK'$YׄXK6<<_H:yC~Zm8hI8H#}0F.h% w>q͹FF3OO{vU*N,` ;G!b| nZ "aS{?]Pe(]7RX{R9it3׿uaGh;zhԬl :E8y6Yqj @M]*3PYYU-5{O[M{}6Q"ႎLPlGT]9)ұ o;~shhu :2.h/P@:]'Rs/n+_Aq+ڰc\%wဈM؏ÞUԊwr$Q\ ViqihyU4.a f2|"&y5&H}4x!ri xv`zu2ߦoع_ՂD/nQH7#s ws=[\:y#aU1msBK7?e?':|v. /YXKNF"Q9^d$[gAxΦKUh&}aev$@&~t%mfQDT|t`L5pwT 3 B@[smhnI]1mxuBl {HAIxVF%|cMLPBN!耊>{aTF9\fO7kkgd-Bi*<5Lv6~"q&@p(DBIDhg0ATaϋ[6o7_'B5Zo}j|=rY*jMKffsL~S ]Rqh[XYfS(*-pؘ>儒oOzaR!jǫkq55ؚ#Z@}El @eƸY84 4 HkG(xd'r&Kcm8|dY#=EȊ˧AuQݝVE۪G` ":ŝYZS{Ұ]8UY9GgzUSgp&`{br_x7^`@p-vlU@O PK C٘:sܸ3TD ?ꦢrGſzWSIJ đCEXBUÍM@) $-L,@ 9I w?,: ,ǹZǠoz BVug"dbi; :Rj `'b|yu yF|VZ$)zVM9(0,N\I|=&CszFeg%qv{~h~a{ p#jާ7K~-~rpHBu^)0ˌ%ҤyWVŧN+󏨟``%kY}/ͳ+$@jݗ2QQP⎰ Bq>ϫA=դ:}j d/5R¹̙+]U:dRqc*i閘 ]Nݭʷ@WzH^Rג vw#_4~iFkbk}u;n,<MP*j+rHN;YSq8/U:a8#ΊՐqByniNmsf&~s@'KȼWiF>^G0^2Ң6tНD%kZm8H_bT}=BKh"5/*j(UyIVnr|"^&޲(m 8rs.M*`Q\ny4;_'OV@/d,bڱd}=#yþ OXtM>PZepV rї~[MPlb*CCZA~_7 ).:&9YM)E9Rjz<>L)Ϟ0}-Iqn"H&]E2€]bDӚ=JQ7a(M? ɨ܄tk8yjWq4̱?](TF;W*ITm7?rsZ `ba]|'@m<^7džm0JJx~)Q EpzpF{ގ˽w|6twh}*z)5y ,twYCW:Ct?RF(zȰk"hVq}ZY 8--N1~Å]k:9g$K _nV~&QB}M"}Qcx=7l1\ޔ~4 VgUCuet,qBŝl19$˥; 8 ͏5NojП T) rL m 8=3A5bn[)_)Tt0m}ɦM/h;C^ӥ N*ZzPw2ކ}J^ӷou8C@]ڝC3nZj6*!'RiCHXZyruG4B EjݿrBوKM$v'=q:B)H^']`und )Oo־j\:>a<2LZZnoZ+Q}\'UĦ{[?OtqA 5m\, $8ޢr^ka}2 _oV6p)3:egfڛ>򣱺V\La@G;sO`u-N$,}=Q1\LjunRTb./E]QJk:S[}v^dh|{l./0ԩHB{&96Ƹl ,w* G!He8S*k'k#eπ(f'媩po];m:u\Yr&`7 !3L(Y|p<҆|#h-u]4cQ PsP{lw8o []hr$@򔺬ue&VS,9GR֍b[XIg }U-GM5i׽&HSU2!v/b17p=Ag}>8 uWR];KF TJYK,&l>Ҹ3*=ήP\)h,;5Z!x0 d*A ogF8<ј/6O4c+ˌ{&3QKs u2;'Ьxp*+p0 (\UjkAznzwU;~q|%ڼNt2 /,gYoKDgwvQ~Dχ Ul8Ğ;NW4Zg #Ck 8t{iBk?u-2,|Wh9r4xΓ rP zJ₣Ύ Qɍ {f{?*ͧv`s:L1 "YN˔`ĶB[ɬ7ZDa'&cs6|0e8[zУD׷dBj>q~zSHFv,mjuhu?35_yLH[3)wzdrwRC'98!O1l3\ MsuO='kzk.[}37O~L:.]tH*T%wffH !']{I'˛p{څ&Z%Bv5 8RP5u \R?W"[/CL т#@L5gV0=W}z8qo_ߍCO֯-4=M~y1^2:&pρ=4a}ABRkIG lJ['a%Ȩ=U.fSɛ곿cYe_D4d=G4}8omBJ,ψ8{ LkuJ2jT sx߰}/] P^Ւ޿"?f}h x w*N*(ps5GlpRn٨xͦHZ>ga֖YT7O u!(m<j2C[Z6E޿krUƈ\*e;!_d2uE9F'<{9w e))T,vPY͖ \YsV9Z6[GV~8A>lsez V:l:0 FC$:*jt>ae(slDpx~D *)pF.ȹ?4j"nxiWK~îʜ)T3u&Y _8Dza0n_@2sB436F61SP`)IYFڤɓ84ʈuwjʖ)-1>nJ-䄻rX8"I;RfڠONU7ԟ[{tkOUOﳻ1/ik5> ٸ Wbo }٢^sM6QNny=ѾF+-:m'O+Z,-3Syʲ~YMxz`iJ5t|t~>rpca&|Lֆdz!hx&j\&2Թ=$f4Js4T"X7]b yP8-xɶ \C#Ww=6_MܼG,ns)v:6 dٸ#4^g &+Y'刉(aiInX_ƌlqr8È?T09Iy_SbN19Y"?xNKtsB '1&ujP܏r;C yFyKeNOYETVȞXrB7f۔/=yUua?!VlNOpٙ8T-,5;#=Nv~i T|:@C BζJ`0Æ gE;blZ:\6]:jeIA)8k9iX H4|>G&33~&fA.v71cLlxy|BFQv zVͱ峡B\S/~MJuc^LHxyPZ` S$(q_?p%7'm̄1SnI;kkD) c;YG6e GEGmLڝ.b]2 XmI,; k}P]E!/9bT#{Ez,&ױYtiUV0SQ ,M!2nyC9ty7of*pTG$8m|{IѨA ")4m 3Ɣ@ )C4O<7K[;"N2-syyO:K#5P4 uK 0rȋ lkk%˃@Dib8ܥEN]&XNrOY% ]VO<dPJXMb/"mżlUcα~tחki(T \.Mpg*}֪s? I!!ڛW  NjYsfϵaL]&}=!5pl-k;G|YD`x7{2BA>isIZ0Lbi$x_XR8yԢte'x fK"Nb UY䪳t/jifzgʠEhw8Kc~oiLc){ VStswvsOW6rapk0u(߮[V%,AI&*EZ^RGo@wƪjإ>* hܓ>e` % C '^<"HP7y 6+4åLO8#;oQX(!QP[XTL:EB' ɿœt0%*C0rR+si @o2O7 +sS&5[G ,@~xHޘ@ꁠLcԃ _r#Vq@O/A> Ǧى>k^W$'_ Ā&9;e"zfh3z-_)o P 8IdUgrI+.29HH|/G㚵ʡqG6;¹Vi0{`5c3Ѽ&fmҧ֒{s@SjB9Φc"ү/ʋ"9YZe)y g WE36y5:Iߟ8[2=cYF C-\஽ ĭ8+vԭ9 ;W'txq E;h| 3)* +剆UĻo;XA!hx0vDRE'x:(n?s/zԟkz[VKn#Ft~_WٛGTÔ6I=xG pv z*"ɝG"4CӔNRS[E1WQ^Z=.ը@b:ՏIΦTYmͺHWо- <~6#ܗC"F?yR9T1vʈ5&* S+rͬf]r e4>j)p}̽0 g;00}~})}M6Sŀ){opK;7S3Xew1Dz&&FFnkWP`[$­,鷕G`*S\E/>ry t)zN$mK07vȋLyz`??[u R}R'(h7 Em(6-@ahfs\=}0i B׳C5V$d!e)]Zģ-j|1\0M)X|f У:>Qy~cnҳ/50tf(|(Ű(Xql^rA̴W^+߇ }7teRr&rsEn󠟹(Z Hg`Eq$ 7 x/a#uB* F>(ֲhJ :>Δs \zrnsEߙBnjSp c 0ph+YwGЎ s5s{wrYOA4Wt㱅ק )ЦOOi!@sM'Fk;y/ɏD}} ڛ[@_V)6}*'t]t,Þ- 9! E/䮊@p=~>]i|gstޥVɺc/a~ZMirQ;`(Ē|.vQB)XJ" }~ҳ%t2B܃wSYjfXz9"Qkn@1 %hoְmF]Yz}?N&EGi`2Iխgyt%ѳqlsv%^US e{zױ*36$CW' %.{BVeZіM>Ri]IsğꦨCaQHKprbb s/`F+-J_*! -I"l癗ըW |t#p]=No@HMކl%ĴO\"PRv<6$W<̪XG|,-"Y <8ѺMn7XoVF`wX{Ӵ p_ɂ0cA^:2.ܯFzO8OhU\O#YЇKooӟ0xN! /0>$`"SMNF( FͽDu= Xj6,vxIѫmU!ictn$ns 8e%liy8 QT!jyx{+C3{uSusҽ#4L&lvSkL2qE.a/ʝL 6 9ɣxJ%P4o@Z`/,B3=NUs~Z4oWνMs#'<_J&?p|9v]Yݮ_Wٶ-Q\t<ҁ4R2}zylۧpnv! ]\C)σ,dz5X<\i" NME-h*YHp$;K񌛀J;`-F=H+M r5!Rñ_ō_Ō(:JJ14j 0^H#ڀLl롰REp\4O-+.z)4琳WIӦT\f$P6EA; *Dͻgo)}{ΌO!omP/R@z~somrKXӝJs.4w6h ٭BO՜<-naew_ƽi}W6 V2o>]!S^)~}HN/{-5}pG b @8{-98%yF){nxBB"\MlB߯ɇ;L-('U ^G=- >sZʖgJ<n :wYHY=kFkH-5.<'/B/ MV>Ʋ~m8[A!4iX2MLxɹ M.ᕾS h(XD[{-az]A.\}+zs8*57&=$NaAs=\ȕi.rF6l ]nyLP*RMva ȲYy> -;.59i髡m&/aS-㑉tp)3a`{Q+Cx ~fm@>]P)_®3|1 C<K' oPtD#3JZ:3'vj'ʢLHbF(yG, gEߏ+FJ~7 %:JKHw/lg-@ߚ7NJ" WpDRs*[Cj =GI#|2M/EF̲~m'C u،) h``kY mEl硐@DXj e?LO- [k HcigsDow\U?jpWM6`ܳ9u#X081Yd]^xvs8B k@#Da=U b;ljl^ .$RڜPߟމ׋ZZ ^L^p[ 3'Eog@4.̝?O u&k{ȈK(mpS﹁0FYܫ z9*؂LRŲGT,iN|| D fxݓJx]ȥZ}%M쭬JitsY ?MJAwX0ݡ—J J^J`!1FfǺ೑n&e z!j&i%mX6Vʹ>Lxļf!qgcTtzʀ}b lzU0lKy{f}9'(:B;sd2ZVmZf PaHS>+ܢ"HT5/ Ԛ-%ǻ4>d'9#+J ;+v~YB!L$ gEiA]NDw$F!ӝ=-cJ]au :xHQx2$$L?v9/\7_nayMyzʚ4;Thğ} TamqFFr|5 Ts,u=KIIdUxywnZdlڹfOybƐ *%vi9 # i#S&n`lȼ C3tКbqy/__*{wIcf,vb ]^wJ)-wE$(͇= _Bv@ ۅsbP ydgWNZ%it8 fLdE(ZvT򶻴wE\ TPA| {$XNX#s$qQ/z"2֡Ȩ=zhefܭ 9DI-z$zDo3qє6:ӡȟfa+{F[pS!0w yU Č7e}⮌5MwE8;\9I`#DUm)z "j >4\^ӊA1ZXͱC(=8ſBH) TBzZmOYL#%&Z+v#px%2 m&jkmaTu< yPMPх{Ϣ|c$k\|b" 2(eA)ͽu>hq/9 ѫ@O5&n1; ;=!A$e$~2=S<…?:!Htkr`k󨣙|qoncה?jǍ63:$7ywK ]OYeސį\ 㳷{ϵ-v+фHj"$?FH &_]F밲rˬLN^PDh7Zk1L8cz70tQ*H"$뺤Zmfj"`ϡyF=]Κˀe _M )Aݫ[dRpwF!G46!U\RX!U0Tu;W;Ї-=_!20_'5J/X' 9p4[Z4h.2xx8<+jEd'NsըA̾JG̈́N}_1ndj5"jlaMBD0k]q.ȴ'Ẍ6aszOCש܍p"Ax1j;5N+?ICEӞЂK-=%"^wZkRgdOؾQmezȏ|T|LZX7N}!jBw)VņnPr |Fo"8_wu{{ۦ/u /`Rӳχro%be+ ~a4g$6>o7pPBMH  UP,G &*ư ,"o%CQ@W*reVCp[(vrT@q^+fȩ^龹O%<{#?`Xv)Ud]hټ¼|20x2]JeN;d  [J6sMnkqJ\TG+V)<0' W\%9OY4iT ,:Ǒޚ~ 6{Ӌ0`;KHahlWZcmk!`_D(EwB׃ EYW7JIkȺՅvߝ+,tDv!ŢKPz_`0yXǏS8\Z{W7d 1%_FX㛿qZ֯5 nC>89\ݵUc]C86|nR{ so$jH3O@>@ܢQ4غ.B<%sכ"]ptD.X(jA*7:2I@x҃ȾNxeO dFt!ŅږYx>w6.ߞWuij9v˩'Y L5भ@KRoɹ0!. dz.0/EvwmJ5h+KrXnǡ5ԼO cllRR}(M}Ϡ*5E9 Yy.AECp_\k)Ef* ~#\[}²6^F U'jy!\׭SF3/6i:zh|b3hb$h)eڒ@(JO(sa0 źlOm!y_v2(ޛo@=X*>U 'Il(x@+hWzk֭ Dxmܺj~S^-a  aḡeYhBl A u/Y'Q*+k> ݭΛ[ !0iɩ ~SBIG('ӡ0_$_j!jsbbJK4jzjz4D0wT9&SW q0x%Pc4Ug'(kaE/0*c8~sg $nAassQMYD mv̰T-V531j J(P~î:bn`( KVg+u% #_s+4nȪţ{\Lz:}(3+we3 fd5zkOEDՔO[[nSIP9Ssr 01~8 ѹ_[3)sqpAV)DUT'IIVAMoV==UW/ܢzYw7Fv4 4LK]j|M ]ٴCLnwI]bsKCYEhoj Xm S ^BW!/{%GH c}o-UOJR; > %|&eVwkz犙c@8RR0=΄5by&9gfrb- ]5 + pV9 W-iqJ1_t0_*eu?m" {GbcZ*_~F]-dW ? Ի1ͤɓ8Y0_˾?9H}t2VĈq~1$CHw(O13V]3Dz>+IVCQք?U$*r=XwS²q_)I'h+ 2-yo/ic1צGvn>z7;o+£kuA}{y_;w3ʉE ݥ 8VwP/?f4@zȚE&#'1mR+޶ Կ(Xٗ.H]h/Ä́{#3 1\ 1?6bK!~\T…Y6uG\Z_ BU#`KjBض+^<^ln,ӿpBƑ4n;ԟ46E,iDs9ߗV"筢ܯopCö9&Acnn DiW?vP#=EԹ$ YqiQ=mW5juW|X@-e3|_>kk^޲cA(h2`ɟQ4W:ξ7} ؞~?4iէm՟N YN/pR6w\qɽb39")^Mw-xMwy+jx~:`G¢Ǫf1o6@R&Hk1"1~~lBݵ`~SN[#[aK_FY%a#)nI)Y*fə,a'p1oz~q=囓~0Mb uW"àO̰v]`YT T= \H !οҹvrYE7,K\ݟ,e k6jD Mx{>M1RnN{.{fPڮ]"隸]|:..\?^;x^I\ &Q -<f. XiQ e,$^R` Zs/zb,16/ۮמfDUb9G`_W^p( . vLJ/-%$i/j+:Yܼ&!!Js&}-91^~Eюл[x1& :X/0݈^Y =E~W F5 _Driq-}~#-^R8}`NLt.oBF2T" ƛE[ A讃I.3!KR [y-CE;wqdW'֪/!8?&5s3=ުA{ڞ^q;0rATi"9#Q{B2_/7ƍ+0`Ձ(Gr8GIbxUUc`1K]7gziVH?bNU%/m:t륵wMyQ(t,Y_lFP4..h= uM52LXJ4:+J]ev~xH9 yk-)PxAᎯԓ(kք \JH%_M>,,E暍u׋kN }ۏh}9"L*FRJ2FIA>eobx㏭q+{ѹDwk ݷ}Uc7DhQ$18$gZ(@chP^n y(iS@P56aӃq-9Dyɞ/,, :Xr<6kC Ț:Bmӗ7zbK0~-1c9g6IϼZ$J]gi%@A▬ReS^ ,opLGpgU0/*ؑz`8 gFes)}`]%eՉT³b5I@zkDfVS؝84s:Ya5rޣdF6@U F\0QU!6ީ $忚"b:f=hݝT}ճbX:bBh$Bt $*gQހ1qYuلhmA7fG5i*1)R zbxo-8-ڔYljӬ,%8*y@͇M@`ʂE!LK ;Zw y$ GS(|O>>ƻep[Gv)%uU7tpajDNn!TL*jy(*V4 2a#|8Q" hȹXPǸip@&1hrc%^7GDм$ ,nX}Ռ8 Oʙ'?#6oź'$/{ I\#\pU.?x?rOkN3:<߁e4ՏgSf.6\GjbG-`96-)*Q f_714?zOck Q;9 *= / r0R$5e0LBe﫱8MŪ ɼ2}h&@C) skhNf!z=%LAiEoA4bsrA+d9 +>04; x쥛}Ij`0g)YAsX.ĞSDCuG}dĽpZr2V;)T%a0:0xio$8h3_z.՛:/ER]}zZ4M-9߻ &S~ߒ&pJPj%/R6Cj[ Ӣ8E?U&f-.%|!@۝'$Ht'eh(t 9IA~VL'&X~^-.9j%ŕkB f$ry{#PVZT)0v7{ y3#F-7 q[PkUТb> G}ъ&E|U. /O;6?5#_z͸qMaBI(*X=7 ܆ &Bܦ*HRE2B8lDѳ}qs |֦0(ܝ`p%-mJ\R;,"cܲy+-8Qzz4_Vn9f #4[T(>yMC-^ Q `oH8uL{Y]"O_swz2xT!\<}aCpIv2BͲҐCYh0ry5`8S^)vH ߯w% )`aC@OnF=) E0޵h0DBRA,և-ɢ,EfZwH17W><,xd?}1" yDPR,7-ـgV/q^tk)(f1fɘaf0YI.mr<򖳀.WVV'ưNyNPenQWy>#=DH{G˿'&$BBxd (~/Oj>%DvH8YU@ I`@@fj8tbvQ|r{au<k)$/Z598xk.3&$TL^<8`KLZ +NKD!>h4Ʀ)[T82>@N5JA1Otn{:9NË>^XJL8v1v3a;"ŬcsrL#^֐h6hF|I(_ 4-."Xf"v_5v.#4XCј K8ڨI 5+4 HMC܋cfm9f.ۄ:vs@,/CC:D <%Wk= )0LRi 5ߒ :w<`P=/Wѱ dJfq 䗷6ԭ 7NiPWHB ѥ%Iel LW_uO51-A&r)$oT^8+0mrîR}m[Hw85j$CmWB)؂i½Ql۰S_'0 Z`rfS EKZi5f_mĈ4@P=ųvcBĜg%ټ80/*;J{8!q/F&֖jzfJW BxvHm5(~ JZ^@!sYבҖ|ıQY@"CΓ+NЖ5pؽROnO܆&5E-螟 [_;f~M8~ޙpd ҽ?Q4QdC#x<yJ,iM%j^Bg +Z 9G3p+_DKM戦g!ucոa-ؖbcڶbvE|($憃 y8]sJ}w -v0&6W:w5k£5IӍώr&0gYm),d=-&FL~Xz3f՚˚ft7繿oNhJ#^oe:ac2,9h{" ϲxF/U8L};36~:G$p OD^{XMMMNJd`2 e$p Biˢo+`}uvS;K6bU`яxy[{&Acl휐TNZ=8ds8L5B̆ϱu 6ߧg;$ܧZ΢h NDfM{1oH> ԙ:*coh6ݠ 1/B1e!n=ݎb L$?>)啎 Ŵ)L!hM37QơWՁ >#Pk׫k8^ޙL׎I8t nuV:vZl 8.qɩqhʎ5[I^`jOM2i?3w0'`MmvSɄLV d)kq[ަjQfdxO)>z3ÁyN-§:SȎu9;#l&7{3fL[O\`|X.]3sUp\T ?k~!ՔX/ŒǭwzGas5/c zvײ|[~-m 6>4^̲~}|AlBD o5i4EYrqI7e$cwO;3br&>O:s(,o ɾEKc*QƌH]Z-ʓ[z }?İFAez,[gB-Z>ģyߞ%QMI*Dh_W)Ih\W{Y&WIGP yHX/AՍ]]>&9?]uO^n\l{ `~sI}Hpkk3زN[k =T)05W0 pTIIͰE^"3F1 C:+2(W ܗ̌6|ӵmcB-EB`dNP⟼RY1i[XEYPmM,<\] %L$@_x (EZ:-HtE|Yҧ.O$(ОJ?klOdy36_US2PU؀Ѣ~#5Ie^؞^)9lwҶ 90uɜTΛYwM:v#mn^bʦMHe 6mt"ںyY1Ia?P۰Ba+'h,z01]E/}y~Z`+u_Q 񉤝*6 M J~ ٶ?y*)4 &$x=~b[8dW,Dog9&8u ?CQLѹ؀f,by+bE.یazuiY~"ރʙ&].R &BQh*;8Di˜$׺ջ%?:A-H+T׽#U҂&&v"C:$v_^O(>ds7zύyz s>h0MFi1*!_b Z97v2# 7G>b&2O @#RO&]".zxQq˟ 2c=IzNzz'r  NCϿuOG1*^mYy>S&=9*6f76F*dwDfNQWv#5ʿDw҈"JdNlw܊@ǖo4H28EU""Cs$s[U. !fqu.Gnj'*_*!W 8K:QwTrJlؗ+m]xh\sV9x;4!b hh bnۋܞC$k!X 3ko) h$ ^sylypSb>DȆ)9)xnfVK.>L֞hc))B W*-}pOՑYb9tN{' AKdʴݼ0)'PM BaD5ƃ;d!IQr&czcn5hp4 10--6K Y9۾^ }% sɳly~/m`%hmA>^EiWma~BP%ͬR(fFnЎDm+|)05XBe ^n=h0"8{ʭ[pݒ̟ `WA:F-1DB`pwŀ:b Џ% h/t