kopano-backup-8.6.0.0-lp151.2.5 >  A \`/=„,}BC=v)jrr*߆,BM K w7bds ڟ l4o 6!W#d0p`(F4RpFA ?Ad " O /8F ` 4 P   d, T  (-)4*9+G,H-L8P9: >;D; F;G;(H;`I;X;Y;\;]< ^< b>"c>d?(e?-f?0l?2u?Dv?|w@,x@dy@z@@@@A Ckopano-backup8.6.0.0lp151.2.5Utility to back up and restore Kopano storeskopano-backup is a MAPI-level backup/restore tool. It can sync complete users/stores to disk using ICS to incrementally sync the respective MAPI items, and can process stores in parallel.\_Bbuild326openSUSE Leap 15.1openSUSEAGPL-3.0-onlyhttps://bugs.opensuse.orgProductivity/Networking/Email/Servershttps://kopano.io/linuxx86_64chown -Rh kopano:kopano /var/log/kopano 2>/dev/null || :y EA큤A큤AA큤A\_\_ ZV\_ \_ \_ Zw@\_ \_ \_\_ \_\_\_f4e025902d7cac1f0b3adaa7f05a18dbd69ff79dd5a39def676e7a3cda1033432229e597baa8519c1df63c6adcc283cf5b83ca89e8fbba8cea7e12e30d704938c72813a806d9caf7c5f9054780187f5e6913ed86e39650612fa201f6398c975b444fa71a431c6275d2d18ad7a08e16d00b25f83ebe7aaabe755b8cd6267379e12f9aab5f5cf3bc890e79597bbcffcac78e0d1c8653d787cac682cf1aca44f588196a646f127148113d82499381fb2c52370e4f8542ce72074cb05635ed8c39992260787f066bcf7a150970a9a7b1d5a4a44bc298f3d8f4d6ec91c44991ccb00e9ba6cce94120e754d24bc35763a23947cfcf6df24bd16eb7ff859654620b67be2223d7555d38bb75257f4ad390580ca91634c1bb4dee3f1db5855becdd24e8e4rootrootrootrootrootrootrootrootrootrootrootrootrootkopanorootrootrootrootrootrootrootrootrootrootrootrootrootkopanokopano-8.6.0.0-lp151.2.5.src.rpmkopano-backupkopano-backup(x86-64)@@    /bin/sh/bin/sh/usr/bin/python3kopano-commonpython(abi)python3-kopanorpmlib(CompressedFileNames)rpmlib(FileDigests)rpmlib(PayloadFilesHavePrefix)rpmlib(PayloadIsXz)3.68.6.0.03.0.4-14.6.0-14.0-15.2-14.14.1if [ "$1" -ne 2 ]; then exit 0; fi # putback previously existing cfgs after they get untracked once if [ ! -e "/etc/kopano/backup.cfg" -a \ -e "/etc/kopano/backup.cfg.rpmsave" ]; then mv -v "/etc/kopano/backup.cfg.rpmsave" \ "/etc/kopano/backup.cfg" fikopano-backupZw@Z@ZxG@ZP@Z#@Z@Z ,@YY@YeYW@Y@YY^&@Y@X@X @XX@XY@XGX5X#jengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.derbrown@suse.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dem.kromer@kopano.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.de- Update to new upstream release 8.6.0 * Enhancements: * spooler: rules support testing for out-of-office flag * kopano-spamd: new daemon for spam learning in Kopano/SpamAssasin * kopano-oof: new utility for Out Of Office * kopano-storeadm: new utility replacing the store functions of kopano-admin * daemons: added the --dump-config option * inetmapi: ensure all generated messages has a Message-ID * gateway: handle a zero-length PR_TRANSPORT_MESSAGE_HEADERS property as if it was absent * Changes: * gateway: generate Internet headers if missing * inetmapi: ensure all messages have a Message-Id- Update to new bugfix release 8.5.4 * server: emit log entry when LDAP is missing server info objects * spooler: avoid deadlock due to double mutex acquisition within one thread * php: mapi_icaltomapi did not copy the iCal recipients to the MAPI object * archiver had forgotten to create its SQL tables on first use * php: make ParseICal able to deduce organizer addresses * admin: --user-count failed to print user counts * server: fix broken cache handling for ICS bulk restriction matching * icalmapi: handle BDAY VCF and REV VCF property * libserver: restore PR_EMS_AB_HOME_MDB- Update to final tag 8.5.0 * libserver: store size for orphaned stores was reported incorrectly * client: have OpenEntry check for NULL entryids and entryids too short * dagent, client: fix nonfunctional HTML filter * common: switch logging to stderr when pipe dies * spooler: avoid printing garbage when non-worker child exits- Update to new upstream tag 8.4.91 (RC) * Enhancements: * server: new "server_listen" directive replacing "server_bind" * server: stronger keep-alive * server: further general performance improvements * server: update PR_LOCAL_COMMIT_MAX on hard-deletes * server: speed up contact and search folder querying * server: skip some unnecessary attachment accesses * spooler: introduce indexed_headers config directive * search: pass "limit_results" to xapian to improve performance * search: optionally index draft folders * unixplugin: support multiple non_login_shells * unixplugin: add /sbin/nologin as a non_login_shell (new installs only) * gateway: RFC 6154 support * kopano-spamd: new program * icalmapi: support URL, NICKNAME, PRODID in vcards * Fixes: * gateway: generate envelope using inetmapi if not present yet * spooler: only evaluate rules that are explicitly enabled using PR_RULE_STATE * Changes: * /etc/kopano is no longer prepopulated, create .cfg manually if you need to override anything * server: remove support for upgrading databases older than ZCP 7.2 * gateway: use threaded mode for reduced memory usage on many-user systems (new installs only) * gateway: the "imap_store_rfc822" config directive is removed * server: the "counter_reset" config directive is removed * spooler: the "always_send_utf8" config directive is removed- Add 0001-build-fix-build-error-w.r.t.-gettimeofday.patch- Replace references to /var/adm/fillup-templates with new %_fillupdir macro (boo#1069468)- Update to bugfix snapshot 8.4.4 * common: fix detection of local connections that need not use zlib compression * libserver: improve ECICS error reporting * dagent: reenable automated backtraces when invoked with -f * php5-ext: fix positive retval setting in error case * dagent: redirect rule led to crash * inetmapi: overwrite recipients instead of appending- Update to bugfix release 8.4.2 * server: revert NO_UNSIGNED_SUBTRACTIONS edit- Update to bugfix release 8.4.1 * inetmapi: handle empty/invalid Sender in RFC2822 mails * spooler: for send-later mails, check trash, not outbox- Update to new upstream release 8.4.0 * dagent, gateway: whitelist-based HTML filter * provider: speed up getIDsFromNames by reducing SQL queries * client: speedup from-scratch MAPI session creation by avoiding extraneous logon-logoff cycles during provider initialization * client: add API for dump+restore of MAPI session profile data so libmapi users can skip provider reinitialization at program startup * mapi: disable very slow RTF compression * server: add entry cache for S3 backend * icalmapi: handle up to three email addresses in a vcard * icalmapi: support ADR, ORG, TITLE tags in VCF files * backup: save and restore store-level ACLs * backup: merge store-level metadata- Add Requires for kopano-migration-imap [boo#1055939]- Update to new bugfix snapshot 8.3.3~24 * server: fix disabling of shared reminders [KC-728]- Update to new bugfix snapshot 8.3.3~22 * gateway: trim CRLF from PR_EC_IMAP_BODY{,STRUCTURE} and make Apple Mail client work again [KC-668, KC-720] * server: disallow empty value for embedded_attachment_limit and depth counting error [KC-745] * common: fix incorrect timeout check in scheduler which had disabled softdeletes [KC-638] * server: disable reminders from shared stores [KC-758] * catch pointer underflows / NULL pointers [KC-694, KC-60, KC-177, KC-355, KC-378, KC-379, KC-669, KC-754] * libserver: avoid creating multi-stream gzip files [KC-104, KC-304, KC-597]- Update to new bugfix release 8.3.1 * inetmapi: do not force HTML when use_tnef is set to minimal [KC-664] * spooler: avoid a use-after-free, and a deadlock after this failure [KC-588] * server: avoid unchecked return value and unsigned underflow [KC-656] * php: rework pointer value storing * daemons: call initgroups when switching user and don't fall over [KC-684,KC-690] - Update to new bugfix release 8.3.2 * gateway: fix an IMAP protocol error [KC-668] Apple Mail/Alpine did not show mails with long encoded subjects * common: restore ability to output crashdump [KC-630] * inetmapi: avoid short allocation on group expansion [KC-388,KC-727]- Update to new upstream release 8.3 * Enhancements: * migration-pst: call SaveChanges only once [KC-534] * Fixes: * caldav: avoid a nullptr dereference [KC-236] * cachestat: avoid exception and unpack tuple [KC-402] * ldapplugin: revert "catch empty ldap_search_base" [KC-602] * spooler: fix crash on forwarding rules [KC-608]- Update to snapshot 8.3.0~1007 * Enhancements: * gateway: optimize LIST, SELECT, STATUS [KC-490] * icalmapi: VCF conversion [KC-420] * Fixes: * migration-pst: skip root folder more intelligently [KC-487] * migration-pst: MV properties are handled better [KC-457] * client: add extra checks for EID sizes [KC-500] * gateway: enforce user and password checking on local socket [KC-396,KC-490] * Changes: * migration-pst: ignore decode errors [KC-521] * common: fix empty text bodies when converting U+0000 from HTML [KC-557] * icalmapi: reworked copying description into mail body [KC-568]- Build-fix include of kopano-migration-imap- Update to snapshot 8.3.0~694 * migration-pst: skip root folder without hard-coded name check * client: add extra checks for EID sizes to CompareEntryIDs * php-ext: use /usr/share/kopano/php for mapi classes- Update to snapshot 8.3.0~667 * Changes: * server: make softdelete_lifetime config setting a reloadable property [KC-472] * icalmapi: handle missing timezone for RRULE [KC-414] * migration-pst: filter metadata at start of subject [KC-424]- Update to snapshot 8.3.0~334 * Enhancements: * gateway, server: reload SSL certificates on SIGHUP [KC-301] * dagent: log_raw_message option can now be used selectively on users [KC-370] * Fixes: * gateway: report missing attachments over IMAP better [KC-436] * inetmapi: avoid overzealously generating winmail.dat [KC-348] * common: fix spurious crash in sk_SSL_COMP_free on shutdown [KC-443] * backup: improved logging when ACL does not resolve to user/group [KC-431] * migration-pst: show usage, not traceback, for invalid options [KC-372] * inetmapi: avoid buffer overread on rejected recipients (showed garbage in logs) [KC-398] * Changes: * server: compressed attachments now get the same permissions as uncompressed ones [KC-380] * backup: maintain deleted folders and add --purge N option [KC-376]- Update to 8.3 snapshot 223 * Enhancements: * mapi: drop global lock and replace singleton allocmore table by per-object vectors [KC-328] * swig: expose group and company properties in Python [KC-320] * xapian-compact.py: new -c option to specify config file [KC-205] * utils: support setting out-of-office without an until-date [KC-275] * Fixes: * pyko: do not throw backtraces on log messages [KC-340] * server: S3 object sizes were shown wrongly [KC-351] * inetmapi: do not always generate winmail.dat [KC-348] * icalmapi: timezone search was broken [KC-313] * The RTF encoder incorrectly produced paragraphs where it should have created linefeeds [KC-338] * The RTF decoder failed to see that \uXXXX could start a paragraph [KC-338] * The RTF decoder erroneously created a new paragraph on \pard [KC-338] * server: Ctrl-C now works in gdb [KC-171] * inetmapi: avoid an infinite recursion on SMIME handling [KC-366] * ics: make creation of new syncids work incrementally [KC-208] * libserver: change incorrect compare operator for EID_V0 [KC-365] * Of special mention: * search: python3 support (but requires new python-xapian and, as a result, a db migration or full reindexing) * Developer/packager notes: * KC variables and functions now live in the KC:: C++ namespace [KC-369]- Update to 8.2 snapshot 451 * == Fixes == * dagent: iCal descriptions caused wrong body parts to be displayed [KC-138] * dagent: mr-process failed to copy attachments to the calendar item [KC-202] * dagent: restore/rework forced ASCII charset upgrade [KC-294] * == Enhancements == * kopano-stats: bind 'q' key to exit as well [KC-105] * presence: log authentication errors * Improved PHP7 support [*,KC-330] * == Changes == * search: log to file (if set) instead of stdout [KC-204] * search: treat '_' as a word break [KC-290] * swig: resolve crash when python programs end [KC-269] * config: change ldap_object_search_filter for WebApp to be able to search by mail address [KC-337] * gateway/client: avoid resynchronizing RTF body content [KC-338]- Update to 8.2 snapshot 397 * == Fixes == * backup: avoid exceptions on problematic rules/ACLs/delegates [KC-213,KC-266] * The comment for server.cfg's "disabled_features" was wrong [KC-262] * php: fix crash by adding missing pointer type conversions [KC-274] * dagent: the "Received" debugging header had the wrong target address * gateway: do not emit an X-Mailer field when retrieving mail [KC-277] * server/ldap: report empty ldap_search_base setting * client: verify peer's SSL certificate name [KC-156] * admin: support unwrapping "default:" type URLs [KC-289] * backup: fix tracebacks when used with ZCP [KC-306,KC-307,KC-308] * server: implement missing readback of compressed attachments [KC-285] * search: add script for findroot upgrade [KC-300] * php: ICS import/export functions [KC-302] * server: AWS4-HMAC-SHA256 support for S3 [KC-170] * pyko: permit "public@company" syntax to specify stores [KC-317] * dagent: new AUTORESPOND_BCC option for use with OOF [KC-319] * == Enhancements == * PST importer [KC-59] * Python 3 support [KC-48,KC-267] * search: files are now compacted, and their uid/gid checked [KC-188] * server: allow search folder creation outside of own store [KC-271] * dagent: forwarding by rule can be restricted with a whitelist [KC-109] * == Changes == * Non-Delivery Reports now originate from "Mail Delivery System" (like postfix) instead of yourself [KC-309] * Support for building with a no-SSLv2 OpenSSL 1.1. [KC-230] If you run such a setup, be aware that a config setting like "ssl_protocol = !SSLv2" in one or more of kopano-{server,gateway,ical}.cfg can inhibit the process from starting. * Cleanup of the example LDAP configuration files. [KC-229] /usr/share/doc/kopano/example-configs/ now has just a ldap.cfg, and no more ldap{,ms}.{active-directory,ldap}.cfg. * The example LDAP config file now has a different proposed value for ldap_object_search_filter for OpenLDAP. [KC-218] * spooler: messages with reminder will be sent with a TNEF copy [KC-152] * admin: group features will no longer be shown [KC-239]/bin/sh/bin/shbuild32 1552834370 8.6.0.0-lp151.2.58.6.0.0-lp151.2.5 kopano_backupkopano_backup-0.1-py3.6.egg-info__init__.py__pycache____init__.cpython-36.pycversion.cpython-36.pycversion.pykopano-backupkopanoexample-configbackup.cfgkopano-backup.cfg.5.gzkopano-backup.8.gzkopano/usr/lib/python3.6/site-packages//usr/lib/python3.6/site-packages/kopano_backup//usr/lib/python3.6/site-packages/kopano_backup/__pycache__//usr/sbin//usr/share/doc/packages//usr/share/doc/packages/kopano//usr/share/doc/packages/kopano/example-config//usr/share/man/man5//usr/share/man/man8//var/log/-fmessage-length=0 -grecord-gcc-switches -O2 -Wall -D_FORTIFY_SOURCE=2 -fstack-protector-strong -funwind-tables -fasynchronous-unwind-tables -fstack-clash-protection -gobs://build.opensuse.org/openSUSE:Leap:15.1/standard/aeb2b8f4bb11f7524fe2e8e53daead11-kopanocpioxz5x86_64-suse-linuxdirectoryASCII textPython script, ASCII text executablepython 3.6 byte-compiledtroff or preprocessor input, ASCII text (gzip compressed data, max compression, from Unix)RRRRRl:AD]ޒb3utf-8cb280c6498e7512407d2f949e14b3af50cd3358256c764dc3d2448511e1e209a?7zXZ !t/@Of] crt:bLL ui]G2o3m|kFgSOߧGӄ2sȤi۩@]is/P8: |]8qv~&<Ɯ)x}g;J@Ya~]Ry gvFY(ؿrĊW.HZ,Jd#e0~qkS} cJ,>&I8D1A7EQd*,?_9^&MYsZOϕgBNt%Cgl]מٻMVT,ݴ̸M4cFu[e|?s;'z-SW%mzԉ 3tZ/wN*(nCI͇ekbZ&ڬyAF B&Tg4W|V١OTc%8}PVfő+LbP%>.ꟽ VJN3!|;Nߍ)*?ͧ8t`x/w08~'"W9PrN_ŨݔBz 2RLlD-;hhb^1 e?mA]`?B?/7Ԛ O`,} 8ذX]`*E{Z>4SS|SvVjr/yg,oM -p z co=㰛o~do< g¾lzqLd c"J ]y-ܨV LZ1_LhqdICt,Kw!̤yȃ>|&˨C)5vNM#Ib3i` /ÛE Ԕ!'hBm2eӁ~pp֛Y=0ĘsYis!cc~mn%^8>MK!꿨?aܱ0Lg3zK%UxKިUb~mgʒ $@@Hܸm^qX G!^h%4}iJPL4}ME,dvE[tP ey.1yŌO^wT. +VW DD{ .\UBΑR*z5Kgf|f3ɯjۺ$Yfd"@/t}A}> .y)-tݘ(׿^&مMWpWwnOcq.Th;mBQ3ZNY={JrFlA2m2D޴_$. #+n+@ >+{Y 68^emɽ*u>;S|Jĸ_J*+k݂pm&,uStT^:d[([ qGb 3¼BTA) vƙ*oo4Knj 9 OW8P $'ùYGͤ*nDq Ty;RuƂk1XG`wQ~U*p+Л|| ペf3bB@ѵ$ޤ`ޟ -EN Zc=Vb.o)5/c3^JO w6B`Rue&R;4=6/:Ӵ8Y25tŴvVf̺{f ;lYX4؉.XuGh6qk.t_1DqT ũXmehYw5K촑4 bU; @)Bdt-e&˒ 8Sa6Bf{Oa3CH3|h "!K)6O+r;,ӬYv_W>!9`D[gPW%z?_vZΗG/PRdym,fiIꊇ4?_0g%sg62OD ee^>>zv| ΊSML1gM:$R< |~@OPH +/imVeonRʊ<&&@!.XxOWfqݝ {kpxn!) UDp&N&B7j谁oKtwpuU6Ę:5Jlנ]kϢC)ʜq6xiQ+KXliNV ζxHBrNKlv2{F8O{F:oO, /qOOhxd o (L^âuڤ.7&O ߪgvpv3*D b+gNh gc< |Sɗ߱-k_myBQd_;]7i ]\ 08˧U/= ٯ5{!"꿺TeVHR,4#38ٯI eB# պGskSw6yX_9_g6Ҹa CUM'끝w 1%?m64%}vքL7G'l&3;$XȌ 1bv&lL4%M%[q7}MErM;xJ=Y}* q= _Z`|c`^"&q c#c^l+cnd2L~.5i~eoy?AXDTpܖM)0=-w1C_"cGH @n]t ]\+26ӎv|^ D܁oUG!9 xzP~)kA;tB ,?o7b5+l ;Et5IQDA1-+sJxS4S7C3U EZ["Os.Мɹ~V̧iic⒳tHx9uH]%U^%|?A/ߗqXj^ '҅o.UC {@BuHɡW*$&;Ǩ`m "b!GG5}D*"*{^jqͰHKGxʺBP} 0}`#"A<^Y.E4vE4.i3_ ]rWP;u`s똘!R{DH Ll= ] GH:lM@sKwb$s+?]* WxsZSoeN6{J/ʓ0(,fU #7xV4nZO_B(5WklqGJc#GuƱ׍ 06yxuC܊@|B}Y¼A1/mQ!ew>]d3Mk] `uQzv40)>_iQ6\7k`|NRV,a:}"_&F:OC$CmVPhJᒪE\FZFsAӷ$^=xAǶIQ ,`l@WTZy w^,WGg+J/3Jkt'Rlt$_z#F5 %;IJDر7tsӤ-ly/$q@DNdcRet 4guo S-t;]h (#6{KSnr sh8Sv?߯im+qdgjN Sg4c.|,92xGzw+e{0_z6DsC JhӅIe *Qy9 tc{`fP||Sˇ3%Կ7 sq~^dC>a= юgqJOOҝf NX;3*2:7S 6>?or0Uxtѱ}of:􍑐b595v/k.=e? (Zf3PeoV2謻7j1M䞪Sc`3m7ΜJQ9>x-epHmQHwl `l'sbFpZpiZ>x<Ong)HSt/8ڪxj-xCNz״ sik wU$%MtƘ:s&.eZ H("-u#ñ^㙄qPjx?iWabt"qt 'Ϧ*^X*"k$5kAH!ɒr "=w(;Е$iE<*U`h`0~Qn"NKT (fbMJx$W`%Dʵpf ( )w9LS ]eRy5MMLVtۣYP{E'B -ԒG[L1E ʊO0}b+:5ZXp> n;(Qor0xѾ"Ŏ YG*ƈ,fv'E=Q,?,uFW>ltdq//5^ںVhhGȶۯ @EOa:x)鋍+Aq/)N/,K{dg}M=\l1EjP~%?qG%t(a8WDaQlz&+F{1 qd@Vfw-j+,3u&(]pp^;w\![|f"P9R}D-Zٶ]b}x0N4!u}H1zڳDm֔~PYNA AN/ňa(Sei \R0TM: OPӾTVY& O_6ӋQ*:%ʒ Tx;&_#|"LˇvE:;կ[eCͰ˕,3yX*tй=ĵ<)qPqIgEAGӮj蓹_nhRD[%GMVsp`Um2L)K ;1öu7bQ'Fh y}.>POO]ʄ굿iGɒ^2+\B{"rHc-l+=n*Kk<:rI;ת|G^h2h<^ͩ䣏 J+;ؖRZlβIYEɼiRSod7kmG'ϝ 0uQ(akj>?=fn~$ȝ)V հ8kvψ!a[zݿ]?m3 9xDL{o<{ vGN 8|)^I^KgDºx{2Osx 1$5a_,Z 'C@˧Ä~"Ş>=*sVEv7Q6\@N="27"4lr hw F|EXũIw2#pP/smr438F1(dN=+t4$(v 3 s^%yp;P`$۪{mޗ(D:Y %D&箕*RGq}#0go^"HA "&E@fh#>C AHa9m3x##W?cVOxط(}]G &3Ӱ,؊ǧ ɘ5N&nqCA9);_*M/]8e(tq^wCW;B<@Ӫ=9f9S:r g0v~eܩM=s;xV^GYNh"e]ordN<<->HmS" 0iW՗۵g]+>9o0` 'MiM)`?M)C}Oie].N63Lu¢11 [Iih8ȭVRHZ5JHpWuTA|1|fB.~| MRP\UwL +o?.^׋i pϡmW}ݛ[&o`kM+X)y YD!x&&? {bIgb/$q{ILZ;ѤC=i51-ЏKCњf@u|I~H|ʶxU͉B ̩q69RiB3ħHFĚ&g>)UM|T>.o} ) /*ISeOGnD`[KwzZA}h \odzZJl)v%m#QXy#`s`{_^(!OXdぱGNmbZ})%#HU_^݁]|L:MOF.:8?'f`v,D~H\3rTb7 ouO3Ȉ._rB(L,0ܧ&w>J!iAXw:$,BG^ Χ1:Z'5LV`dz -3/q꓀ux&򌇗KbmkN_ OH`S}V~<k( x]2ng"y S:i˭eE첯πpoDi7 JT+f_㐓)f}e7Bh]02Kr9zDqJjSNXtywI#>O6?>{:'5>__hֿ1Ջ/_ʜSZȬagA,|;o3al/3"p^;Z\kK98Bl,s-9x3VoE?xʮ 'y)<8n՛u&'"u¡׌-KƛcWfbS/c9C;MhQ}_Od`@R*'@4uoTrG3{(|eف ⷴq&Rz^0}ᲭiVgJw/MVcV凬 c ۍlmͻV#MKTt5)ȑ|##~g7%a)~&`ʅ<^_9 bV9}er;m8 =BCCkWri~ma2|x,\RT6G mœOGTn}zZmѣGsP{Rx}Hnk!ՃF֧ۤcV.wn6eЅK$K} m Ce?Lq7c ɾ&9{b?f 2$2 ף=5D N頞dEI8{wtf1/17w)(/TTեgvJ-yq&ҸKʹe4E8[ߠ ZsmZ(8'I ߏCdho[lKf~͐\VnsY~~b QSHϳP$g:a0rPG_*RB"U_! )>Ǽr@Btl1n-#Lh͌@dOHDUq+'s3)0Bvi5QHsA5!{iI@@#>8[M4I10"^&nKZ$%?[\҃9>BJǎ_*('T 4O܈) x e,A `M780RV{V$;V*lO :rAxg*9'"w%` gf_ @ 6 cf7 .a˺9JâiA<<*7@ 7 D5ЊP1c~:xst_++:K2UqBl٨_/);_2c ЄtȗhL bP:'vj9 $2AY֋YMV}~ Ԅ"ʁQz,S68pgS|Ytǘa>D 4*?N(k= U6 Q+A3I ՂT =0#9tv5"Gh?,xs9 m-nEj USf_`2KxP;]C+V#/X/U3WMPsC#︰u}@8է  LE$3x6hh$iBi %K = 420Q1m3ӨؗIͶت5J6늰kA -Jhc"!XnP)"OGףIm$*uDA$A1n`>qѡ %[d0MH 7L$N$#`eukXjUp {}lW4υ .j 7Pˏr$^"qIP_.~\F"՛?Gfp \R*ۙC\yo(:{hʿ)Ompx$KVV pҝK=++.u{ }?c a(OHdm۷ 2uN\ȶ)Okhr[hv(f<]9|zw \2)[UЂb \"4=KAU<U:l6-&' Tsy! .G&2o\a+~{7y5~$>HV/v?ϲ]'Gvs 1&{ǵ4(Żdm&5fWpxWO5cs]==8u+q4_~VHV2i ܨk$pYM5b[7.bUqx8W7j ,*S.*RUs2N2~FYxSvb6*PP<ř'SF^ݗc ꪗ~ziBfOm#%۔zÁaf%{^< wKX}%|Ȣ]%5ܨ;sQiCaTn\{(aUmH :t4׾gNFF8•o7rh)Tvq(3NC-b3g đ^mYm_=虦ⴡ)(_Rva;gFh>8(r+ Պ:vhLuh5Vڗ\<=i9(! SvN_襕z%B۲i:y *)j 5Q2fagi5]v+/]8 Ϯ^9.d$ZД7Pw#. ׎8ϱШ|e,vFT HX.=2֒fU4)`L$zh^ɱ̠p#{X\:'uIafeѲ$72DFLh2)Hiϕ4xd-1PhPmIqGÙNg +b1L83q {luIԼҶf2qQE?]%Wl),MCfR1{ehEGNɍfs$S#Y}㧯G2֩5N3fdK{.;0ZcHa⸵EY\KPQ5MuwYI䀺]on]~Onnx2 GW#D-ؐ,w;825Pcxmq<YkrWU~CrDU)4H>v""$q<1jZIvr߼}vQk#3kSqfu(1z)1 :Wfj*ҁNlQjyOkêDdfث0[D+q-c(?US. [ $-u$z!Yo@ĸm;ԏЩ |sGN''QrgŧMSzv nHipR?ʢRajPЧ_%;+#3`h2pBR v[{l'*~2Lty+O+t Z^⹞,\Dz:հ#ԇ {d@$3Uw2aeOk(`0_/6`v?Ɉݏb@T"fmc߯{S`'LG6vTkO"!Br; YK`#дӒ4g/d/R)(̊.akPcV/39x"e.Lh"^նAJ Ʃ?%ͯGȘY9D]󭬟`Pr i}ʯў>b)R 8oԼ^h=n8dAO4HL3vJ:KTJmv$X4EKvKwPB['~N{n*:1Wʷ4l`;l?yԅU>E}T%9 NJeVѤJًtXesa6'"6l5yqREE%3 =Y0օ؟r?v+_DzSx * M ގ :!+-wL):x0[BcT#aW~Y}l.- Uk죊 xӖda-qy|;o_6NX,gɓA8T~ݤ ڬ.V|*uH\#&J_S芡\=c`Nfhj Ȗ]@E[z'FKCkTz'xFWC} fd0ݩ*`ᙍű͔2@X$=RׇCrO$WL9ϨՌIᶨ5F-soz7g-n)eFF@~YJT9Dۛ2T6_\eUb`7=7X 4(zvW\ BIs {ŠhP0w Ӟ]4l (͏In(9Q@y,Մ ]~[jl~X5~*=R'Y~ri4bBs b>7a g 4>!W4ƾYqubK/dd^O4#Iⵛ5%<~Cᶛ] gī[DRkP!:Cyahv`CE6#:鋐iK "W8RɧerP>>U,h)ӕ3 b%o&4(Y&Y5&B&Dw۽,<@c)+m!W@zV 2Qސ4qdneib5,EmhOlV=Ӯ 8qE!'>9YF]3Brf[EQ:KB8U>x;<_Cc ._H^49:Wv{o]_Nf, *Xn=au~+a;1ܟihT}ЌC/Ϸ:+31fP QN+D7Z?G\\{՛3 S q֠o{u$CNJ=]IB=߻S]UѾV -D ˹K_B&bD%\v=}yEod'}J|%̃"? iR])q us_l+MPZ5O5$ ]H _ ٸ4Q5wS/sYʘ[RT΅lt˜ &8L yd؏kfL1kb}R`zBJ*jG˴gMN`eI1 +E}\RYLs AEɑ񗜈_#b$Op54&Jh)eO鎰<\Ԝ >$'8a,;z$gM@ЅPD 0u,mVlb* wg"$FK'  /Ӛ;:}TFO4GFng`>4u%;ˊ`bqۆ(pF'&i\ .9}nYSBIJޕKp%SӍ[ğ]MxB*Nrm.<^6F"7| .{06N)QuGq s? g]&gyD>F% _Xj`. |tZ褟b-f D׭2tvVV0ZYQ4SR_ G94.AqE9hpH* =ӿ^/$!P?&5=p&<5Kzt 5xԱzNwB5(rJoo^Ql9n2Z0YX.F scip6*rF6[@%{]N/  K.0 a8elӏT$ j&صͼp'9֔ DCӍHH8>n)v?F΅1Z2\UDÝ'ndBy[[]~@wϜMnIM;"d^VPRx0٭zLE1uʖu=%IVσ[Ç<}CBDR.H/Fd -r{;iM7\0:[r4^*T H'dt@E/NdXܹsdAd=(G !MWoDpQX &4<>UICYu;Yڒ_p˴SaT A0R,8R hpf4ӁOrV6f1[ H8-7ly~irz~:_dip +˾l-sl p  -Tdv]|W>:v]Mp*MȚ)/"*ECUNtp(K;|'gAa~}<^S{eԧ CڣY𶨦u%z"F@W _F-,I:m: bS9UuQM (\If5\68\W;v/ =*^SBI401"}wJ[_Hʤ e}$ʮb4QD\0{^C9@[7֠ltOdHܹ Ywմq֑M8d$,CX^6fJ5w.vuKfM"@KwUbx S5!+!j 4[)Qy m$ߧOVVfr7m2qpt"7(I~ וGì'jV(W3YYU Wk&qw Z w݋ؒ:L- fS]D'2Xe m| D3|}Wvo: $X/DšZǣ0g͊.N~*@v Eh$vɓJνQ K2gɤsƟ]RRIS>)Uoxf}>oBV+[0"2p;1}GUZc>XyRp'A~BZIe 3sI@S4 5R9]Te7Q9?I#f.EiO{^Fpڥ"C3`\ZXZ@,A2$=B>,92/ i o?ǯί~nl R- emFΗ ѣ Y!4+;]"6N{cިl$ #Db4C$߂EgZLe/Ou-K&<o sZ 'v4YvEq=6e7b`vۨp-hA~eۭw㚕3VfWYoPT}J2'Auiz5 AQxܤOyCjhf J*U[+Iwᥓ>FH!G ړAx?w އvA G/s+5`9ޜ˹?*҆r_6=&ý _lȀ"nm+YO.3wSynV1shST?NR2((B)}_] CJQKu_˖[g$'£Kz6{d>y 0gx@vfDהAmvssMxݽ&1ۈ5lvek*)SiqvSa 2LEphOTnH=i.| `Ӫ3'1&Gl65LU['4O4OGH%sKz~l :Ѷ(Xfurdʆ=D!,K>Lv4Ļ[tH_ҒAWR0#v{!Lˑ\jBl5fHDh>&\0H?P0䩉o;)%s^F5 η띕,ᝠWvՈ(oUKàPM2uX"{ @G() am^Y+@S<Cgb_i(QOQh|K) -^vTߺsuj~*бmlv7g/0g̊!0v j-탶.XdvQێ9,}oBFnkH)qE$`H GcMz4̖orX&Cw*q'_!Ҥ]5YlFj {kpW~(:g2xg%`71l6>:n800YZ@ytDL*K׺p}7F@RYM7x-Cn U˛6't '錗C5e oU{3:k(xdRpGI}x)4 ٥uHۘ^^wf6NCiL )|}>'ɱRڈ5mWeNsإÅStMG4[!X14vDA>`;x ̷LmDi_MG7Eyx: G$r` 7o?nd Ul6?Ij uk*5N-$z축ݯDRr*9ot;&}7޲L? (|FoRnJK[{vƢyB{Zz %>MЪŽ-ثy]P'/y^rE{Kf;7;lQ5 R9&v4] F3RyIj5i^ 7"{7aWIOQX> Yx̕}FQK/xa<;lԮ W+ԺGل>zJMl5&ԋ\{/0 :.F{m+rNȊag'`3ZѲ:xdX+aqV^Я%;~Ֆ:KXN2?'|Q./0}K/̖[Ƨo}7>֯: u6jN"zP#ܸʔ z̫ޖD{$ȶ5[ZZFR *+k)9d)H^-]ODwzcA,C d|r,ϝ,\j&+tHo6sOhW̅RχN>y뼯mjw2+w,eF^XU*aPQ Cwo}R6 /N_).[s\6cu"w]8]uVԂN/B x6S~=.S(o &}dq S vHOvB#?%ݽL8be gfhk e'EOzH}X*qn]B(f^/ (@>کhs|RpnC&%?Ch]oҨ5wY㊤PHEC :ku@~ wcyr\[\0̼CDNO>^N@x^Q&=h E(83LJVaNp=-"ˢueg64KK/U{<95R/]WaKلj(9iaS,y==0(91:xmT =5c'^o)cilO{? +ߡoUM1:m0{ͪG8|VWfejn.-a%M/IE$$":0I<"wy8PF~8mٜ&\}[V^wE!&qu;tY؀?aAl,+~ֈSvl+wM _%)Ex ބ9}Ʒ٩]`-Y)k.ٿVF ")ڱf K|TsF_)fgsߤ1d: e#I)1r:TlϤA#|F?,;U܎rged0WET9wXD+?_\zCv2IF0U{=}5s}yet'/#0T;Ħr48QpgQPrC\ $vh5RR$P⌅Fj["9*M@he$] RjS2.QJ9p!YGm)K*L O_EdчفD–?-ɺJƓ s-$n|yWUE&w1lS1@rw_ZiGo d$nޮ9'|/xgL'L#}Wh0h_|X%5i؊};nq!E*1ޙ8 ~6gw甜L8]9MLG4+X3 T».ɠ )~\pS%<$Tڜ*@]իxcNVH."fi2WkZIa\cj-M I/**˳-ҋHB[7صe+>=u4ꬺv,Ef'l0pٔEy${'n~ueBZ3w9h&GU51Čo8V+ocUը(o%>U-w_{9zAFE B9IJ*O\(Ɇmmru՞m6FG7Z1~$pKDl8B˶KW󅨠7g) ^:A7v y, $%*z<`ѝ-HN:,)W7H؆=+WN&5I3lЀ3KE# YZ