kopano-common-8.6.0.0-lp150.1.4 >  A ZwM/=„H_tyd Qhz~։;FN*ըFgZX~@T褕.yX_O7-Xt24{Ԩjq]dC8z3r:3-˯PYѰNn7h/T w 86 PaٛwTL _+xDn\IΔf\OD MX>R `{ԫQ׉>2[XĎKU"|KS `P}a6a36bf75b9a5d12a6c2f66c05f0eab9ab16774bd0e5ca5496853a240b7b793a7f33ccf274902c7fd84fe56f21f14a54a7bb3cc2tZwM/=„h BrcV- tK.}gMTΦ6.M_Y3A#-cv9!kl@/7|aHȳN_/-df龏 X=hNZekfopsiWԳnF:6W@C൜ ܀P3ziHaJދ>7./ɡ`Fh V$4% -m/\3 m[L !]z8 iԓ>p?C?Bd " Hx|  H d      T    4  `   ( Q8 X9 : (=> >>F>G>0H>hI>X>Y>\>]?,^? b@cAldAeAfAlAuAvB zBBBBBCkopano-common8.6.0.0lp150.1.4Shared files for Kopano Core servicesCommon components for services of Kopano Core.Zvbuild74oopenSUSE Leap 15.0openSUSEAGPL-3.0-onlyhttps://bugs.opensuse.orgProductivity/Networking/Email/Servershttps://kopano.io/linuxx86_64/usr/bin/getent group kopano >/dev/null || \ /usr/sbin/groupadd -r kopano /usr/bin/getent passwd kopano >/dev/null || \ /usr/sbin/useradd -c "Kopano unprivileged account" \ -g kopano -r kopano -s /sbin/nologin PNAME=kopano SUBPNAME= SYSC_TEMPLATE=/usr/share/fillup-templates/sysconfig.$PNAME$SUBPNAME # If template not in new /usr/share/fillup-templates, fallback to old TEMPLATE_DIR if [ ! -f $SYSC_TEMPLATE ] ; then TEMPLATE_DIR=/var/adm/fillup-templates SYSC_TEMPLATE=$TEMPLATE_DIR/sysconfig.$PNAME$SUBPNAME fi SD_NAME="" if [ -x /bin/fillup ] ; then if [ -f $SYSC_TEMPLATE ] ; then echo "Updating /etc/sysconfig/$SD_NAME$PNAME ..." mkdir -p /etc/sysconfig/$SD_NAME touch /etc/sysconfig/$SD_NAME$PNAME /bin/fillup -q /etc/sysconfig/$SD_NAME$PNAME $SYSC_TEMPLATE fi else echo "ERROR: fillup not found. This should not happen. Please compare" echo "/etc/sysconfig/$PNAME and $TEMPLATE_DIR/sysconfig.$PNAME and" echo "update by hand." fi chown -Rh kopano:kopano /var/log/kopano 2>/dev/null || : chown kopano:kopano /var/lib/kopano 2>/dev/null || : if [ -x /usr/bin/systemd-tmpfiles ]; then /usr/bin/systemd-tmpfiles --create kopano-tmpfiles.conf || : fi FF AAA큤A큤A큤AZvZvZvZvZvZvZvZvZVZVZvZvZvZv4ca99f5441b7fa4637c9e2cbcefa8a1fdd174ea164c73c6b68bb3df1b51dd3168586efbe7b42193d3eb3938e920d25a4c19361c603030eb2c153e982a4a508d175a00c75e9e022261d292dbaff60a2a109d2ff44368b07a484a461110c7d00fb57c8ff33c9c0cfc3ef00e650a1cc910d7ee479a8bc509f6c9209a7c2a11399d60d9d3b43a20e737665bfda32a78505e2b31b0353b60d4fac2713e1fe1861d211cd82e2dc75beaa13a924e79c7448ee80b6dbe52dabb3a8f272c34afdb3339f533be1a69ab7f95f7ebb394f0590a13c259954831aaa341ec11a6731511c013d84f58c4f5bca670e0c93516ffa363815b3984c00d77652780b1c56c63dc3f97671rootrootrootrootrootrootrootrootrootrootrootrootrootkopanorootrootrootrootrootrootrootrootrootrootrootrootrootkopanokopano-8.6.0.0-lp150.1.4.src.rpmconfig(kopano-common)kopano-commonkopano-common(x86-64)    /bin/sh/bin/sh/usr/sbin/groupadd/usr/sbin/useraddconfig(kopano-common)cronlogrotaterpmlib(CompressedFileNames)rpmlib(FileDigests)rpmlib(PayloadFilesHavePrefix)rpmlib(PayloadIsXz)8.6.0.0-lp150.1.43.0.4-14.6.0-14.0-15.2-14.14.1Zw@Z@ZxG@ZP@Z#@Z@Z ,@YY@YeYW@Y@YY^&@Y@X@X @XX@XY@XGX5X#jengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.derbrown@suse.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dem.kromer@kopano.comjengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.dejengelh@inai.de- Update to new upstream release 8.6.0 * Enhancements: * spooler: rules support testing for out-of-office flag * kopano-spamd: new daemon for spam learning in Kopano/SpamAssasin * kopano-oof: new utility for Out Of Office * kopano-storeadm: new utility replacing the store functions of kopano-admin * daemons: added the --dump-config option * inetmapi: ensure all generated messages has a Message-ID * gateway: handle a zero-length PR_TRANSPORT_MESSAGE_HEADERS property as if it was absent * Changes: * gateway: generate Internet headers if missing * inetmapi: ensure all messages have a Message-Id- Update to new bugfix release 8.5.4 * server: emit log entry when LDAP is missing server info objects * spooler: avoid deadlock due to double mutex acquisition within one thread * php: mapi_icaltomapi did not copy the iCal recipients to the MAPI object * archiver had forgotten to create its SQL tables on first use * php: make ParseICal able to deduce organizer addresses * admin: --user-count failed to print user counts * server: fix broken cache handling for ICS bulk restriction matching * icalmapi: handle BDAY VCF and REV VCF property * libserver: restore PR_EMS_AB_HOME_MDB- Update to final tag 8.5.0 * libserver: store size for orphaned stores was reported incorrectly * client: have OpenEntry check for NULL entryids and entryids too short * dagent, client: fix nonfunctional HTML filter * common: switch logging to stderr when pipe dies * spooler: avoid printing garbage when non-worker child exits- Update to new upstream tag 8.4.91 (RC) * Enhancements: * server: new "server_listen" directive replacing "server_bind" * server: stronger keep-alive * server: further general performance improvements * server: update PR_LOCAL_COMMIT_MAX on hard-deletes * server: speed up contact and search folder querying * server: skip some unnecessary attachment accesses * spooler: introduce indexed_headers config directive * search: pass "limit_results" to xapian to improve performance * search: optionally index draft folders * unixplugin: support multiple non_login_shells * unixplugin: add /sbin/nologin as a non_login_shell (new installs only) * gateway: RFC 6154 support * kopano-spamd: new program * icalmapi: support URL, NICKNAME, PRODID in vcards * Fixes: * gateway: generate envelope using inetmapi if not present yet * spooler: only evaluate rules that are explicitly enabled using PR_RULE_STATE * Changes: * /etc/kopano is no longer prepopulated, create .cfg manually if you need to override anything * server: remove support for upgrading databases older than ZCP 7.2 * gateway: use threaded mode for reduced memory usage on many-user systems (new installs only) * gateway: the "imap_store_rfc822" config directive is removed * server: the "counter_reset" config directive is removed * spooler: the "always_send_utf8" config directive is removed- Add 0001-build-fix-build-error-w.r.t.-gettimeofday.patch- Replace references to /var/adm/fillup-templates with new %_fillupdir macro (boo#1069468)- Update to bugfix snapshot 8.4.4 * common: fix detection of local connections that need not use zlib compression * libserver: improve ECICS error reporting * dagent: reenable automated backtraces when invoked with -f * php5-ext: fix positive retval setting in error case * dagent: redirect rule led to crash * inetmapi: overwrite recipients instead of appending- Update to bugfix release 8.4.2 * server: revert NO_UNSIGNED_SUBTRACTIONS edit- Update to bugfix release 8.4.1 * inetmapi: handle empty/invalid Sender in RFC2822 mails * spooler: for send-later mails, check trash, not outbox- Update to new upstream release 8.4.0 * dagent, gateway: whitelist-based HTML filter * provider: speed up getIDsFromNames by reducing SQL queries * client: speedup from-scratch MAPI session creation by avoiding extraneous logon-logoff cycles during provider initialization * client: add API for dump+restore of MAPI session profile data so libmapi users can skip provider reinitialization at program startup * mapi: disable very slow RTF compression * server: add entry cache for S3 backend * icalmapi: handle up to three email addresses in a vcard * icalmapi: support ADR, ORG, TITLE tags in VCF files * backup: save and restore store-level ACLs * backup: merge store-level metadata- Add Requires for kopano-migration-imap [boo#1055939]- Update to new bugfix snapshot 8.3.3~24 * server: fix disabling of shared reminders [KC-728]- Update to new bugfix snapshot 8.3.3~22 * gateway: trim CRLF from PR_EC_IMAP_BODY{,STRUCTURE} and make Apple Mail client work again [KC-668, KC-720] * server: disallow empty value for embedded_attachment_limit and depth counting error [KC-745] * common: fix incorrect timeout check in scheduler which had disabled softdeletes [KC-638] * server: disable reminders from shared stores [KC-758] * catch pointer underflows / NULL pointers [KC-694, KC-60, KC-177, KC-355, KC-378, KC-379, KC-669, KC-754] * libserver: avoid creating multi-stream gzip files [KC-104, KC-304, KC-597]- Update to new bugfix release 8.3.1 * inetmapi: do not force HTML when use_tnef is set to minimal [KC-664] * spooler: avoid a use-after-free, and a deadlock after this failure [KC-588] * server: avoid unchecked return value and unsigned underflow [KC-656] * php: rework pointer value storing * daemons: call initgroups when switching user and don't fall over [KC-684,KC-690] - Update to new bugfix release 8.3.2 * gateway: fix an IMAP protocol error [KC-668] Apple Mail/Alpine did not show mails with long encoded subjects * common: restore ability to output crashdump [KC-630] * inetmapi: avoid short allocation on group expansion [KC-388,KC-727]- Update to new upstream release 8.3 * Enhancements: * migration-pst: call SaveChanges only once [KC-534] * Fixes: * caldav: avoid a nullptr dereference [KC-236] * cachestat: avoid exception and unpack tuple [KC-402] * ldapplugin: revert "catch empty ldap_search_base" [KC-602] * spooler: fix crash on forwarding rules [KC-608]- Update to snapshot 8.3.0~1007 * Enhancements: * gateway: optimize LIST, SELECT, STATUS [KC-490] * icalmapi: VCF conversion [KC-420] * Fixes: * migration-pst: skip root folder more intelligently [KC-487] * migration-pst: MV properties are handled better [KC-457] * client: add extra checks for EID sizes [KC-500] * gateway: enforce user and password checking on local socket [KC-396,KC-490] * Changes: * migration-pst: ignore decode errors [KC-521] * common: fix empty text bodies when converting U+0000 from HTML [KC-557] * icalmapi: reworked copying description into mail body [KC-568]- Build-fix include of kopano-migration-imap- Update to snapshot 8.3.0~694 * migration-pst: skip root folder without hard-coded name check * client: add extra checks for EID sizes to CompareEntryIDs * php-ext: use /usr/share/kopano/php for mapi classes- Update to snapshot 8.3.0~667 * Changes: * server: make softdelete_lifetime config setting a reloadable property [KC-472] * icalmapi: handle missing timezone for RRULE [KC-414] * migration-pst: filter metadata at start of subject [KC-424]- Update to snapshot 8.3.0~334 * Enhancements: * gateway, server: reload SSL certificates on SIGHUP [KC-301] * dagent: log_raw_message option can now be used selectively on users [KC-370] * Fixes: * gateway: report missing attachments over IMAP better [KC-436] * inetmapi: avoid overzealously generating winmail.dat [KC-348] * common: fix spurious crash in sk_SSL_COMP_free on shutdown [KC-443] * backup: improved logging when ACL does not resolve to user/group [KC-431] * migration-pst: show usage, not traceback, for invalid options [KC-372] * inetmapi: avoid buffer overread on rejected recipients (showed garbage in logs) [KC-398] * Changes: * server: compressed attachments now get the same permissions as uncompressed ones [KC-380] * backup: maintain deleted folders and add --purge N option [KC-376]- Update to 8.3 snapshot 223 * Enhancements: * mapi: drop global lock and replace singleton allocmore table by per-object vectors [KC-328] * swig: expose group and company properties in Python [KC-320] * xapian-compact.py: new -c option to specify config file [KC-205] * utils: support setting out-of-office without an until-date [KC-275] * Fixes: * pyko: do not throw backtraces on log messages [KC-340] * server: S3 object sizes were shown wrongly [KC-351] * inetmapi: do not always generate winmail.dat [KC-348] * icalmapi: timezone search was broken [KC-313] * The RTF encoder incorrectly produced paragraphs where it should have created linefeeds [KC-338] * The RTF decoder failed to see that \uXXXX could start a paragraph [KC-338] * The RTF decoder erroneously created a new paragraph on \pard [KC-338] * server: Ctrl-C now works in gdb [KC-171] * inetmapi: avoid an infinite recursion on SMIME handling [KC-366] * ics: make creation of new syncids work incrementally [KC-208] * libserver: change incorrect compare operator for EID_V0 [KC-365] * Of special mention: * search: python3 support (but requires new python-xapian and, as a result, a db migration or full reindexing) * Developer/packager notes: * KC variables and functions now live in the KC:: C++ namespace [KC-369]- Update to 8.2 snapshot 451 * == Fixes == * dagent: iCal descriptions caused wrong body parts to be displayed [KC-138] * dagent: mr-process failed to copy attachments to the calendar item [KC-202] * dagent: restore/rework forced ASCII charset upgrade [KC-294] * == Enhancements == * kopano-stats: bind 'q' key to exit as well [KC-105] * presence: log authentication errors * Improved PHP7 support [*,KC-330] * == Changes == * search: log to file (if set) instead of stdout [KC-204] * search: treat '_' as a word break [KC-290] * swig: resolve crash when python programs end [KC-269] * config: change ldap_object_search_filter for WebApp to be able to search by mail address [KC-337] * gateway/client: avoid resynchronizing RTF body content [KC-338]- Update to 8.2 snapshot 397 * == Fixes == * backup: avoid exceptions on problematic rules/ACLs/delegates [KC-213,KC-266] * The comment for server.cfg's "disabled_features" was wrong [KC-262] * php: fix crash by adding missing pointer type conversions [KC-274] * dagent: the "Received" debugging header had the wrong target address * gateway: do not emit an X-Mailer field when retrieving mail [KC-277] * server/ldap: report empty ldap_search_base setting * client: verify peer's SSL certificate name [KC-156] * admin: support unwrapping "default:" type URLs [KC-289] * backup: fix tracebacks when used with ZCP [KC-306,KC-307,KC-308] * server: implement missing readback of compressed attachments [KC-285] * search: add script for findroot upgrade [KC-300] * php: ICS import/export functions [KC-302] * server: AWS4-HMAC-SHA256 support for S3 [KC-170] * pyko: permit "public@company" syntax to specify stores [KC-317] * dagent: new AUTORESPOND_BCC option for use with OOF [KC-319] * == Enhancements == * PST importer [KC-59] * Python 3 support [KC-48,KC-267] * search: files are now compacted, and their uid/gid checked [KC-188] * server: allow search folder creation outside of own store [KC-271] * dagent: forwarding by rule can be restricted with a whitelist [KC-109] * == Changes == * Non-Delivery Reports now originate from "Mail Delivery System" (like postfix) instead of yourself [KC-309] * Support for building with a no-SSLv2 OpenSSL 1.1. [KC-230] If you run such a setup, be aware that a config setting like "ssl_protocol = !SSLv2" in one or more of kopano-{server,gateway,ical}.cfg can inhibit the process from starting. * Cleanup of the example LDAP configuration files. [KC-229] /usr/share/doc/kopano/example-configs/ now has just a ldap.cfg, and no more ldap{,ms}.{active-directory,ldap}.cfg. * The example LDAP config file now has a different proposed value for ldap_object_search_filter for OpenLDAP. [KC-218] * spooler: messages with reminder will be sent with a TNEF copy [KC-152] * admin: group features will no longer be shown [KC-239]/bin/sh/bin/shbuild74 1525118691 8.6.0.0-lp150.1.48.6.0.0-lp150.1.48.6.0.0-lp150.1.4 kopanosystemdsystemsysusers.dkopano-sysusers.conftmpfiles.dkopano-tmpfiles.confkopano-commonAGPL-3sysconfig.kopanokopano-coredump.5.gzkopano.7.gzmapi.7.gzkopano/etc/logrotate.d//usr/lib//usr/lib/systemd//usr/lib/sysusers.d//usr/lib/tmpfiles.d//usr/share/doc/packages//usr/share/doc/packages/kopano-common//usr/share/fillup-templates//usr/share/man/man5//usr/share/man/man7//var/log/-fmessage-length=0 -grecord-gcc-switches -O2 -Wall -D_FORTIFY_SOURCE=2 -fstack-protector-strong -funwind-tables -fasynchronous-unwind-tables -fstack-clash-protection -gobs://build.opensuse.org/openSUSE:Leap:15.0/standard/86c3fd30918bf4c33cc95b8d31f5de85-kopanocpioxz5x86_64-suse-linuxASCII textdirectorytroff or preprocessor input, ASCII text (gzip compressed data, max compression, from Unix)|Q{ 77utf-840619fef3d01dc55caac302cb626f9c2eaab0761c663e11977fe290434367849?7zXZ !t/@] crv(vX0zOp^f=ɭο8x-VT쿣=DQ ?8½ICaojdrWŻrmx0"Āɝ'P@;d>nݬoJYf^PEՋP@JgD9$ug  0AK2:E01 H#])]T>g3AzlSbBk:߀E`GCZe^7v}NK[~,Rq嬂rIg`p,B΃*!n;݀q(E'ӉwLG`Fa)~jZ,r{FT˾&] 3,r.@V|2:R f"2ÿ˔Fk+\ڊLN1kŞZ[z)"ҫ[8 Mr=ƳD+ (9aJB< qKMgU &ǃ]C BMC m#]Y(I.v݅&ܿN=^0gwK*"Ji(N8bqdbg-VĈ1Ru_@>(Ę]Xۺv-P >{Gݏ65\.ˮ+mv:&؟[ʑ5)3bv8,%mx#65RS-!}u:&@r 1Ak^)G^-nU{|T2 f2(7SG/eNCq=ny/r%>we1r*n 3(J `X.j '(:p4F];mgq[eg$U@P_ucVwq:_&f{T &\hrٗFo5MZi:ZYx % ~c T6~6%ϜrFlXoNcYڿ/ &4{1/K{lźy\zip0U.3L 4D#,o"j~RA}`P>8RrK#4✉6c8@?ROHPSn& oE|L:S`_^dRG&DgE J00veE* 3{rbAY=X6FP89R JUcF;1*Rt3j>C vԜbVZ @nfʠ1P E~0AŸGfC`uB/ltfj U)"!s?W/?h{tL "䞺_I:`q,rx3`#浉_5$7Q%[k3/!Bt|Cc5j/,RR!ܣ݊f謁/^ 1nɹz5KR~taLw1>r&{_܄T p}F&ɲ *YK y͔dހL0_G{QD-ϒ+߹+$,?l@0<׆diV2a2" r6RG{bQj3 ^`FjQ}R:"s{/]ƎNzj]N T e4-f"FDz>T 8 #Aa)=h0oFx4+-1'Nymt4c6؎qLC~Lː W}0Zǭ/eS!}QX/ Λ.5+)]p屩'Zth ! l;);szエAB*y8 t`ufVAWBR-2Hvr.]ڕpK|7Вwn@5 P½W}@LāC0/#vHW0ϪІP$ :dc&O/$̐A|0Q PEd<5G5uq >sOj_E2&PEvds ϝ_!cE}B v[9+Ņ/\]^/fN]Ü;¥6?X)=beXՎSV'8ߢ˴Np 'kd-*We4"$j2ZWsa1f(X6x@*Z4bf)(}ewApQD 1$˘xubkQIm?|ru9i HYT9ggrh -ܳN@xdY__TLoՎݞŤ7pE ~b/pԳ^V/'kxtҊT%sCJא =y7~8unwm3 orl<.5M%:;锍Fc1}c|T7ܲ2eLLd\?6W;yp`7C]B$g-6?70]?QKA68̵CI4g&.oƄ<..- L lt?QF$ ,/RG6QM bFvO]=)xңvn$fp)A7.O}y"#ͩaBèS,+ Zv~BJWY8ܛӽy:]2֘ m!S6SŷAcIRJ< ʒ͉EMnn 'SLx?iksB-T*3 &dv ߺeTYJAsu8~eo`r}N"*4 ވQtp3^Us00Dk99P*H|[t $J7RPo--Zn[2]҈ْbr/Gv˫0; SDHsNb{v}-t'mudLpQS=}o/)gZ*{bʝ5׋zVts( ]bM{8 -z߻V@:KL@pANR @׈-,~x 8N{c dhWc(ꞏaF]@i2:LywQ8j˽%?"`ٹ԰Ѵ$cʦ(Y|OLKVcUu #_C$\ʽ3z̲{p:,'kL&7WTZW-?{U*ppf,D7V$,L--E-l+ԼA?qea,&4+GY Ao!5u/ƠGQyá"qˀ@f#uQ3sA60jib}.[u)DxehdN v(;t{Z$YK ރM—t2nvbU{!1r: FtXh*q^kꆮ-D&"!h>TzI ۫!MS~ΈV4H$3Dr kR -2৕#\ď/-'XkS8N KEύv> fV߬JV~_y[iM9R<=dO'z'Xo ӆP^J91#@HA/ew+KdoPכ$*>Mb|%\ySRb!Ŵj_pZ_W#7O>݋Ҷ^h죍tJZD>VرW 3V/<"!1k$4 <.<ѡ7pRC$ӽ '>Ɋ ZH@Pmՙ>=Hmr& jyj0rع_v:mSVۈ V@0;$k\Xg ,*fEBOr:q)'w1LsC9m=qi_F3%vsX4}%m/"Aq|#ǟv,OC a¡ oj *w=HXWXnvfN `zýc+O[[Jawߔ/.xnRBң8'5Oj?AB6ʁieU2@v>1=֪]^,)6lbUꚗhEU7O{o6D1-X{Zgb/J,.f Aq3r~~A7z>(e)è'm_*훶O(oo8vL?744mDHс#Bs=gq' 0C9BrJ۠{2CQHԙ]k4z[ivoHޗ1s'lxB܄mHcQkjt.& l  ܶ5N#`x꜄+D8h(fjȁms2w%"{5A\16!tfr= :|'xn0]3h>TZgD[oCdSk&.YŏLE=k3`*WqOƲXveijgIWDůL_16 _֩'t@cu ^`ꃓJJmykSg \i$<ŪE/.8nٿxdLveBe/!blZ|GEȀ3lVp@UvZYWƤ7n;.C< W~ ob$O~A]:Yr~@ğ Ca|(xm(6VB<je?2)2!#䛉 [R%ghl rv]Ӻ8ba2̘{4Y1(Iݒۢ;,/іMUlS>Y(󖉫1PUyUk Yże& Xb.^œ=5Pw@1*8?_j(n9- K}Q_kRSv0Ku|1/D#Mt'+j!%gފ9Gd[B 4,]7\+MNUC f'I=7I:(-d z*p ,(u4- h96$ ;r._&57f{'9(WxmwI^?t5^elBa!wO%сɍ0Uwˑ>/')$[hzt4EƏXTx8_Ajt=0Ɋ(5 0@ w[[ ^[oΟV^1 +tLx%xxx!b$Ci)F"a;+MGMyi\ 96y1mvړY:jcHt⃎OhBsR`t:Koij .MMˋ,anẮUU?5;Vmb-~KDu-`tqeԕfˇK^D4,_6hNVR0QSmS ȉW3P 哯4֊\K,YA84Rib qI?- gNp\]-C;oqHn'` ĸsx+hSI@dBȹumT9 lƢD!ciy邨ߐKrm٩/h̼^kQ-2L9xd=!V0VnW'%mPx.!܄DL79ؚbKkXwȲ7?]5JٴhUv6)+t۬yڌuZJ9kWa,n%P+/~^9ח 1 w CD2j-3M3_m'zC=5;K߾sy7{ehbM0;Qg{2E1Md޿p~È@bQ1jqV\\מ;RZT0cbjӝ4!q_y@9pݗ/AFp6h0봇XvayZˆ%YDVJ-:$9d3'%]9rc(\>jI˿ 뾌6{D_u”~ˎMrT%h|tr5:p] (XDl1?rRH CA˕|x8;/?w>U連v۲LຜsN#—İ,~b  V}.i-H>SܒZ\e&(*{[,eЇ@>Ywz P4yOIy'?&snoThO\Ϧ+e! w3k90P(XfMRW-_ QWTO-7g_ 5ln<D{\ Ucw1{sG9?AP;5>6LW;,8SM/Sx;Ue^m_uҪHWkXV0>V~"JWp؝sh?$U ٞ$RDbjJ|g$cjknh o`?1a/O2Tu${hTJM&:*wN\ Y yLгBgX&QwE#a3Y@% </@5SpowV?{vѡ\^H{0B;V %.u$1+g 5Ms'7~>RaW9pJKǰr{ n֐5$akqLG/cyWvK􍏗8SU!U|$$j:nS" * FE{]V pҺ#\O)"D%}YzRd@wV|\El4Ib+R0c-egIJʳj֩ш_h*OI=zp/BJav1ܟ.x(;ыw{O!bܯCS-A { T^$Q ܳZ꫱= IJ3yݕElxXUFb.0^'>q!]W8+6W4:/U05:Aj5,~Utim0fO$\̟ƕ1[0 ݁).o^Rjb@\q>HR ݳ\rрn5 Fd]E 󰑕~h?1>Z?Wp>?ary31:E4:f"rcYMu q91&h4=Xs;JQfF3]~濵S-l7* S;O)(ewZW2\\ޱyI.ipC>AɃ iˡwVQcT|+q嵟d]4I '5 lˆẏ/uXA*䌀ZV.bêZ,/~, J&>D5<[H8 τ`R!+iLʦΗ HV>F%O1̨ExUKL1&M7OQ PuWcZ ^G+H}$TbSi^%:e]T0KcrH' krz;2ժll X3 )FjZ>nXdQWB^Af4Ϳ|?%icdm22cCwJH[x $V);m,^rolS ʬ񲃙5P ӒzO}~LR~&Jݰ()xҸ@:f]j>igS+fs7 Zu#\b}vwgҥ$?r#RS'GF%vYOwo DUTƾ[/2o !.nC*ݮmڃ뇹B-l7-qV 2 I(I~5MCҫ؞gܹWi@.[0=<52o =CBT}p+cV%!k_IЧGRb;%Q+s֖2Xj,$Q#hG_pMʲG 1wyEPS>&?Շap&>n/pp_;ݐ0*$ݧ_EæP5[dX_F_Gwˍ1a11\eHzȵ Uֆډ ^lX7ZR=$ݾbY#g*1uY@Jq)_Bq^%"H/^ʗSj_]6c \g pkfL{?*5Zʐ;:Y=93A%<:y¶^(l08j@ǯegDw OiO<6w3ApFm7@8.,IN 5&y÷@]\)o OdaPqxBqAecu+ZJ-x`ӳ8"q~Auί r03Y&^˄dT7uSNFRݓ1vsW[a楙yx]Zmk38ػ[*kl0Ÿ[^f!ZZ>Bc|o8`b?0b׸<@vyHEictn{Sy:6fݱ)Ă10 |td79]pZ-t+48%B_n٣JAJ۔㞥!-GwD*VRU!R9WB\ie3=4;AkO"wdMMbz%effȀ2pXP>r/$;2E{G> rjՙj51A矜rd/(5a{F$yd(!rvכ }J]Ey b|Œ>;"/%-3|,ۦr yDzй.* TR(əIv#Y`ᖕC`|VԤ:'Lj@4B1\ `x^:Lr 3a$+8 \=`_:TR8o _Ĵi Ev3OTTjG7kq}Bd}A=%Rދ-`Uѱfu韗&(<훢2klKr Le{>˛8I@ڜ96Noe|WsUtRgALry(ȗh?dedWc631/';:.ݷ>:JȴWScVp7FAzù nNkJϓ(RW-OJ'VC[+)bɕͶ%JuXB>b:/.(d`TSf}]囔߳:^ۦ[V($/^o򅈆ԉVO-p`n;t86;P݊ 0Oj*orĨxc$L5|ҹn}| m,c_Dg}͉p໧efvD a%?ٿdZFR{%CzhJBv;_eᡵ%mڮҠl$C铢,jna Pkb×ωKOdÛLz?zè/Hwrwnִ"_(OL޸٬;riIK kg3r}ru{窫{O܈8&ќqm^нE]R+0=~dpqv}i5PLݭ܀ ҧ Czl਽iO إv9(0?u M#L/k{Rd8.;E@@fS377h N~gPS\6V}ۙA ghu,{95P!P>V& |/~x>PMo,ЍABěQ_ ؁٭A`fRʉlM>DS~ 5%ʷ]J©4Me+3^v[d>9.^Rn8{;Hbn^KimF*дŇk Z_bqOpX"B^Z0rw%K7<~y,͈ܝ8X0;<}T\=D7+s"ꐔ#8/Ы5Z{YX̓ߚ+^pU#.d6p:́I-n- \Tt"i'䘽cfavE:n7:=`~P^ X=ﴹ+t41@ʟW obhQ?6-<ү[ yWH"=WU9~U ]Բ\ʧVfPz<^:eBgv@(˩YAx{A#NZzҕ3la9ፚur{t^5"f3 If곕2SQL5 (O4K.-0LvB5Y͉c#ਣdrVdk{ .)kG:BtogD$WӾoJF|xPF#1Ƥ>KH{{,HNF B :"l8Ӗ5@TpڸJ_{KG z u +& dTKVI"s_ȁųIr2Yڦ~jggi׿q;) - ? m5Nܴ> QBISLN,K|Rzܝъ#YdkcĮiE%eK;Q6!H8n˪ċgdodXvN+)^b9뇂=rJ@Yҋ?xiYev*c_N=t\Iةw.6x @-F10JсY\I{}rBP'z,in><qAOPºhG0Tŵ8w樥2)Q+l'aBt0Pv\O!q;228yxFH"GpW$f8H,Kxv^.N\֘:EtiAs+4}:`D'ښ,nY} Q~^iNjmev<GkJ8Fe6>wjuu?:&C'7=mvx*@8~3 $|Z02W̙e+Ya\N/V4&)vPly&"cmk?ѺwVi3n ʝ.™oWFop͒u8+U.x? P/ *],ԷBmozX #X5lu~_AO2_%8t/ ^w>sKQ@W[(_4m"$ D۵^46]šWsD\ebW:r>CO\x2RUaxV;W.1GJ+UЙ4AcJFrE2BMȶgS}rc kn[^aBl^L4w~j(ypjoACCStfX߆˻]r2"qZ ,GsA5UN O]* N#mvQ-1J[8z®Np[ j#ebY8\x~epp7Ե| Kt!̩E }8}{3BuzЅx~ ^,6")yQMÔX.$2FB< I% ~C1j=JI @Gu &C}Kd>U|{?Oopjxڋ Mm=Z`K?.oUZH'& o#p6$;}TunƁAgǛtjG:?O?!7C胩{*(ϫk `p ;tw#*0l,/eNhLʮ٨nK: !k2Ilp`,!Ӡ˕ėT `wXI<;D2,m"ܸ lӵz5&.Զ:`^iwR.*^.@v#FwniƒfXOM62%B΢o O'*!{Lu*Bs_AOsfƗB-#w0Q@g8Q2^\|IW{ŃII;Crgвf2L'rijFm64Ɣ+np$|y<0ѯzzϬ`=r,2 ߃XqfP"2a ٟi\rOF[gz**fLWzwu=I7s's~ Y Z*d? o=c }pǎV`ypޱb ,3݅`ZY-}fs΀&^ YZ